Đề số 3 - Đề kiểm tra giữa học kì II - Hóa học 11 có đáp án và lời giải chi tiết


Đề số 3 - Đề kiểm tra giữa học kì II - Hóa học 11 có đáp án và lời giải chi tiết

Đề bài

Câu 1 : Dãy chất nào dưới đây chỉ gồm các hợp chất hữu cơ?

A. C2H4, CH4, C2H6O, C3H9N.

B. CO2, K2CO3, NaHCO3, C2H5Cl.

C. NH4HCO3, CH3OH, CH4, CCl4.

D. (NH4)2CO3, CO2, CH4, C2H6.

Câu 2 : Cho các nhận định sau về hợp chất hữu cơ:

(1) Hợp chất hữu cơ thường bền nhiệt, khó cháy.

(2) Hợp chất hữu cơ thường không tan trong nước, tan nhiều trong dung môi hữu cơ.

(3) Trong công thức cấu tạo của hợp chất hữu cơ, cacbon hóa trị IV, oxi có hóa trị II, hiđro có hóa trị I.

(4) Phân tử hợp chất hữu cơ bắt buộc phải có cacbon và hiđro.

(5) Liên kết hóa học chủ yếu trong phân tử các hợp chất hữu cơ là liên kết cộng hóa trị.

Số nhận định sai

A. 2.

B. 3.

C. 4.

D. 1.

Câu 3 : Ankan X có tỉ khối hơi so với He là 14,5. X có số đồng phân là

A. 1.

B. 2.

C. 3.

D. 4.

Câu 4 : Đốt cháy hoàn toàn 3,36 lít hợp chất hữu cơ X (đktc) cần 8,4 lít khí oxi (đktc) thu được hỗn hợp sản phẩm cháy. Dẫn toàn bộ sản phẩm cháy qua bình chứa Ca(OH)2 dư thấy xuất hiện 30 gam kết tủa và khối lượng bình tăng lên 21,3 gam. CTPT hợp chất hữu cơ X là

A. CH4O.

B. C2H6.

C. CH4.

D. C2H6O2.

Câu 5 : Cho ankan X có CTPT là: CH3–CH(C2H5)−CH2−CH(CH3)–CH3. Tên gọi của X theo IUPAC là:

A. 2,4-đimetylhexan.

B. 3,5-đimetylhexan.

C. 2-etyl-4-metylpentan.

D. 4-etyl-2-metylpentan.

Câu 6 : Ankan X có một nguyên tử cacbon bậc III, một nguyên tử cacbon bậc II, còn lại là các nguyên tử cacbon bậc I. Khi cho X tác dụng với clo (askt) thu được bao nhiêu dẫn xuất monoclo là đồng phân cấu tạo của nhau?

A. 2.

B. 3.

C. 4.

D. 5.

Câu 7 : X có công thức đơn giản nhất là C2H5. Biết X thuộc dãy đồng đẳng của ankan. Công thức phân tử của X là

A. C2H5.

B. C4H10.

C. C6H15.

D. C2H6.

Câu 8 : Đốt cháy hoàn toàn một mẫu hiđrocacbon X người ta thấy thể tích hơi nước sinh ra gấp 1,2 lần thể tích khí cacbonic (đo ở cùng điều kiện). Công thức phân tử của X là

A. C4H10.

B. C3H8.

C. C5H12.

D. C6H14.

Câu 9 : Khái niệm nào sau đây đúng về anken?

A. Những hiđrocacbon có 1 liên kết đôi trong phân tử là anken.

B. Những hiđrocacbon mạch hở, có 1 liên kết đôi trong phân tử là anken.

C. Anken là những hiđrocacbon có liên kết ba trong phân tử.

D. Anken là những hiđrocacbon mạch hở có liên kết ba trong phân tử.

Câu 10 : Thực hiện cracking 0,3 mol ankan X thu được 0,5 mol hỗn hợp Y gồm các hiđrocacbon. Biết Y có tỉ khối so heli là 12,9. Công thức phân tử của X là

A. C3H8.

B. C4H10.

C. C5H12.

D. C6H14.

Câu 11 : Số đồng phân mạch hở ứng với công thức phân tử C5H10

A. 5.

B. 6.

C. 7.

D. 8.

Câu 12 : Clo hóa ankan X (điều kiện ánh sáng) thu được một sản phẩm thế điclo có tỉ khối so với CO2 là 2,25. Công thức cấu tạo của X là

A. CH3–CH3.

B. CH3–CH2–CH3.

C. CH3–CH(CH3)–CH3.

D. CH2=CH2.

Câu 13 : Hợp chất có đồng phân hình học là:

A. 2,3-đimetylpent-2-en.

B. 2,3-điclobut-2-en.

C. 2-clo-but-1-en.

D. 2-metylbut-2-en.

Câu 14 : Anken T có công thức cấu tạo: CH3-CH2-C(CH3)=CH-CH3. Tên của T là

A. 3-metylpent-3-en.

B. 3-metylpent-2-en.

C. isohexan.

D. 2-etylbut-2-en.

Câu 15 : Cho H2 và 1 anken có thể tích bằng nhau qua niken đun nóng ta được hỗn hợp A. Biết tỉ khối hơi của A đối với H2 là 23,2. Hiệu suất phản ứng hiđro hoá là 75%. Công thức phân tử anken là

A. C2H4.

B. C3H6.

C. C4H8.

D. C5H10.

Câu 16 : Cho anken X phản ứng với dung dịch brom dư, thu được chất hữu cơ Y (chứa 74,08% Br về khối lượng). Khi X phản ứng với HBr chỉ thu được 1 sản phẩm cộng duy nhất. Tên gọi của X là

A. but-1-en.

B. but-2-en.

C. propilen.

D. etilen.

Câu 17 : Tiến hành trùng hợp 1 mol etilen ở điều kiện thích hợp, đem sản phẩm sau trùng hợp tác dụng với dung dịch brom dư thì lượng brom phản ứng là 36 gam. Hiệu suất phản ứng trùng hợp và khối lượng polietilen (PE) thu được là

A. 77,5% và 21,7 gam.

B. 85% và 23,8 gam.

C. 77,5% và 22,4 gam.

D. 70% và 23,8 gam.

Câu 18 : Ankađien liên hợp là

A. ankađien có hai liên kết đôi C=C cách nhau 2 nối đơn.

B. ankađien có hai liên kết đôi C=C cách xa nhau.

C. ankađien có hai liên kết đôi C=C cách nhau 1 nối đơn.

D. ankađien có hai liên kết đôi C=C liền nhau.

Câu 19 : Đốt cháy hoàn toàn hỗn hợp 2 anken thu được 7,2 gam nước. Dẫn toàn bộ khí CO2 vừa thu được vào dung dịch Ca(OH)2 dư thì thu được bao nhiêu gam kết tủa?

A. 40 gam.

B. 20 gam.

C. 200 gam.

D. 100 gam.

Câu 20 : Ankađien X + Cl2 → CH2Cl-C(CH3)=CH-CHCl-CH3. Vậy X là

A. 2-metylpenta-1,4-đien.

B. 4-metylpenta-2,3-đien.

C. 2-metylpenta-1,3-đien.

D. 4-metylpenta-2,4-đien.

Câu 21 : Số đồng phân cấu tạo (mạch hở) của ankađien có công thức phân tử C5H8

A. 6.

B. 7.

C. 4.

D. 5.

Câu 22 : Chất nào sau đây không điều chế trực tiếp được axetilen?

A. Ag2C2.

B. CH4.

C. Al4C3.

D. CaC2.

Câu 23 : Cho a gam ankađien X qua dung dịch Br2 dư thấy có 16 gam brom phản ứng. Mặt khác đốt cháy hoàn toàn a gam X cần 7,84 lít O2 (đktc). Công thức của X là

A. C3H4.

B. C6H10.

C. C5H8.

D. C4H6.

Câu 24 : Trùng hợp isopren tạo ra cao su isopren có cấu tạo là

A. (-CH2-C(CH3)-CH-CH2-)n.

B. (-CH2-CH(CH3)-CH2-CH2-)n.

C. (-CH2-C(CH3)-CH=CH2-)n.

D. (-CH2-C(CH3)=CH-CH2-)n.

Câu 25 : Ankin CH≡C–CH(C2H5)–CH(CH3)–CH3 có tên gọi là:

A. 3-etyl-2-metylpent-4-in.

B. 3-metyl-3-etylpent-4-in.

C. 4-metyl-3-etylpent-1-in.

D. 3-etyl-4-metylpent-1-in.

Câu 26 : Hợp chất hữu cơ X có công thức phân tử C6H10. Số đồng phân cấu tạo của X phản ứng được với dung dịch AgNO3/NH3 tạo kết tủa là

A. 3.

B. 6.

C. 5.

D. 4.

Câu 27 : Cho phản ứng: C2H2 + H2O \(\xrightarrow[{{80}^{0}}C]{HgS{{O}_{4}}}\) X. Công thức cấu tạo của X là:

A. CH3COOH.

B. CH3CHO.

C. CH3CH3.

D. C2H5OH.

Câu 28 : Hỗn hợp X gồm 0,4 mol H2 và 0,2 mol axetilen. Nung nóng hỗn hợp X (xúc tác Ni) sau một thời gian thu được hỗn hợp Y có tỉ khối so với hidro bằng 7,5. Dẫn Y qua dung dịch brom dư, sau khi phản ứng xảy ra hoàn toàn, khối lượng brom tham gia phản ứng là

A. 0 gam.

B. 16 gam.

C. 24 gam.

D. 32 gam.

Câu 29 : Đốt cháy hoàn toàn hỗn hợp gồm 2 ankin đồng đẳng kế tiếp nhau, thu được 3,52 gam CO2 và 0,9 gam H2O. Công thức phân tử của 2 ankin là

A. C5H8 và C6H10.

B. C3H4 và C4H6.

C. C4H6 và C5H8.

D. C2H2 và C3H4.

Câu 30 : Trong một bình kín chứa 0,35 mol C2H2; 0,65 mol H2 và một ít bột Ni. Nung nóng bình một thời gian thu được hỗn hợp khí X có tỉ khối so với H2 bằng 8. Sục X vào dung dịch AgNO3 dư trong NH3 đến phản ứng hoàn toàn thu được hỗn hợp khí Y và 24 gam kết tủa. Hỗn hợp khí Y phản ứng vừa đủ với bao nhiêu mol Br2 trong dung dịch?

A. 0,25 mol.

B. 0,20 mol.

C. 0,15 mol.

D. 0,10 mol.

Câu 31 : Phát biểu nào sau đây về tính chất vật lí của benzen là đúng?

A. Chất lỏng, có mùi đặc trưng, không tan trong nước.

B. Chất rắn, không màu, tan tốt trong nước.

C. Chất lỏng, không mùi, không tan trong nước.

D. Chất khí, không mùi, không tan trong nước.

Câu 32 : Cho V lít (đktc) ankin X tác dụng với AgNO3 thì thu được 23,52 gam kết tủa. Mặt khác, đốt cháy V lít (đktc) X thì thu được 10,752 lít CO2 (đktc). Vậy công thức của ankin X là

A. C5H8.

B. C3H4.

C. C4H6.

D. C2H2.

Câu 33 : A có công thức phân tử là C8H8, tác dụng với dung dịch KMnO4 ở nhiệt độ thường tạo ra ancol 2 chức. 1 mol A tác dụng tối đa với

A. 4 mol H2; 1 mol brom.

B. 3 mol H2; 1 mol brom.

C. 3 mol H2; 3 mol brom.

D. 4 mol H2; 4 mol brom.

Câu 34 : Tiến hành trùng hợp 10,4 gam stiren được hỗn hợp X gồm polistiren và stiren (dư). Cho X tác dụng với 200 ml dung dịch Br2 0,15M, sau đó cho dung dịch KI dư vào thấy xuất hiện 1,27 gam iot. Hiệu suất trùng hợp stiren là

A. 60%.

B. 75%.

C. 80%.

D. 83,33%.

Câu 35 : Hỗn hợp X gồm metan, axetilen và propen có tỉ khối so với H2 là 13,1. Đốt cháy hoàn toàn 0,2 mol hỗn hợp X sau đó dẫn sản phẩm cháy vào bình chứa dung dịch Ca(OH)2 dư thì thu được 38 gam kết tủa trắng và khối lượng bình tăng thêm m gam. Giá trị của m là

A. 21,72 gam.

B. 16,68 gam.

C. 22,84 gam.

D. 16,72 gam.

Câu 36 : Đốt cháy hoàn toàn 0,25 mol hỗn hợp X gồm hai hiđrocacbon mạch hở Y và Z (MY < MZ) cần dùng vừa đủ 14 lít O2 (đktc). Hấp thụ toàn bộ sản phẩm cháy vào bình đựng dung dịch Ca(OH)2, sau khi các phản ứng xảy ra hoàn toàn thu được 30 gam kết tủa và một dung dịch có khối lượng giảm 4,3 gam so với dung dịch Ca(OH)2 ban đầu. Công thức phân tử của Z là

A. C4H4.

B. C3H4.

C. C2H2.

D. C4H2.

Câu 37 : Crackinh 4,4 gam propan được hỗn hợp X (gồm 3 hiđrocacbon). Dẫn X qua nước brom dư thấy khí thoát ra (Y) có tỉ khối so với H2 là 10,8. Hiệu suất crackinh propan là

A. 90%.

B. 80%.

C. 75%.

D. 60%.

Câu 38 : Hỗn hợp X gồm 2 hiđrocacbon là chất khí ở điều kiện thường, đều chứa liên kết 3, mạch hở và trong phân tử hơn kém nhau 1 liên kết pi. Biết 8,96 lít khí X (dktc) phản ứng tối đa với 232g brom trong dung dịch. Cho 10,15g X tác dụng với hoàn toàn dung dịch AgNO3 dư trong NH3, thu được m gam kết tủa. Giá trị của m là

A. 44,925.

B. 33.

C. 11,925.

D. 31,55.

Câu 39 : Một bình kín chỉ chứa các chất sau: axetilen (0,5 mol), vinylaxetilen (0,4 mol), hiđro (0,65 mol) và một ít bột niken. Nung nóng bình một thời gian, thu được hỗn hợp khí X có tỉ khối so với H2 bằng 19,5. Khí X phản ứng vừa đủ với 0,7 mol AgNO3 trong dung dịch NH3, thu được m gam kết tủa và 10,08 lít hỗn hợp khí Y (đktc). Khí Y phản ứng tối đa với 0,55 mol Br2 trong dung dịch. Giá trị của m là

A. 75,9.

B. 91,8.

C. 92,0.

D. 76,1.

Câu 40 : X là hỗn hợp gồm propan, butan, buta-1,3-đien và but-1-en. Đốt cháy hoàn toàn m gam X thu được 52,8 gam CO2 và 26,4 gam H2O. Thêm H2 vừa đủ vào m gam X rồi đun nóng với xúc tác Ni thu được hỗn hợp Y (chỉ chứa 2 ankan) có tỉ khối so với H2 là 26,2. Tỉ khối của X so với H2

A. 23,95.

B. 26.

C. 24.

D. 25,75.

Lời giải chi tiết

Câu 1

B. Loại CO2, K2CO3, NaHCO3 là các chất vô cơ.

C. Loại NH4HCO3, CCl4 là các chất vô cơ.

D. Loại (NH4)2CO3, CO2 là các chất vô cơ.

Đáp án A

Câu 2

(1) sai, hợp chất hữu cơ thường kém bền với nhiệt, dễ cháy.

(4) sai, phân tử hợp chất hữu cơ bắt buộc phải có cacbon, không bắt buộc phải có hiđro.

Đáp án A

Câu 3

Gọi công thức phân tử của ankan là CnH2n+2 (n ≥ 1).

MX = 14n + 2 = 14,5.4 = 58 ⟹ n = 4.

⟹ CTPT của X là C4H10.

X có 2 đồng phân là:

 

Đáp án B

Câu 4

X + O2 → CO2 + H2O

⟹ nCO2 = nCaCO3 = 0,3 mol ⟹ nC = 0,3 mol.

mbình tăng = mCO2 + mH2O ⟹ mH2O = 8,1 gam ⟹ nH = 0,9 mol.

BTKL ⟹ mX + mO2 = mCO2 + mH2O ⟹ mX = 9,3 gam.

⟹ mO(X) = 4,8 gam ⟹ nO = 0,3 mol.

Gọi CTPT của X là CxHyOz.

⟹ x = nC/nX = 2; y = nH/nX = 6; z = nO/nX = 2.

Vậy CTPT của X là C2H6O2.

Đáp án D

Câu 5 

Phương pháp:

Tên thay thế ankan = số chỉ vị trí nhánh + tên nhánh + ankan ứng với mạch chính

Lưu ý:

- Chọn mạch chính là mạch cacbon dài nhất và có nhiều nhánh nhất.

- Đánh số mạch chính từ phía gần nhánh hơn.

- Gọi tên mạch nhánh theo thứ tự vần chữ cái.

- Giữa số chỉ vị trí và tên nhánh phân cách nhau bằng dấu "-".

Hướng dẫn giải:

Khai triển mạch sau đó chọn mạch chính là mạch C dài nhất. Đánh số từ phía gần nhánh hơn:

 

Vậy tên gọi của X là: 2,4-đimetylhexan.

Đáp án A

Câu 6

Ankan X có một nguyên tử cacbon bậc III, một nguyên tử cacbon bậc II, còn lại là các nguyên tử cacbon bậc 1. Do đó X có công thức cấu tạo là:

CH3-CH(CH3)-CH2-CH3

Vậy khi cho X tác dụng với clo tỉ lệ 1:1:

 

Có 4 vị trí nguyên tử Cl có thể thế vào. Vậy có 4 dẫn xuất monoclo là đồng phân cấu tạo của nhau.

Đáp án C

Câu 7

X có CTPT là (C2H5)n ⟺ C2nH5n

Vì X là ankan ⟹ 5n = 2n.2 + 2 ⟹ n = 2.

Vậy CTPT của X là C4H10.

Đáp án B

Câu 8

Ta có VH2O > VCO2 ⟹ X là ankan.

Gọi CTPT của ankan là CnH2n+2 (n ≥ 1).

⟹ \(\frac{{{V_{H2O}}}}{{{V_{CO2}}}} = \frac{{{n_{H2O}}}}{{{n_{CO2}}}} = \frac{{n + 1}}{n} = 1,2 \Rightarrow n = 5\)

Vậy CTPT của X là C5H12.

Đáp án C

Câu 9

Anken là những hiđrocacbon mạch hở, có 1 liên kết đôi trong phân tử.

Đáp án B

Câu 10

Tỉ khối Y so với He là 12,9 ⟹ MY = 12,9.4 = 51,6

BTKL ⟹ mX = mY = 25,8 g.

⟹ MX = mX/nX = 86.

Gọi CTPT của ankan là CnH2n+2 (n ≥ 1).

⟹ 14n + 2 = 86 ⟹ n = 6.

Vậy CTPT của ankan là C6H14.

Đáp án D

Câu 11

Độ bất bão hòa của phân tử C5H10 là k = (2.5 - 10 + 2)/2 = 1 = số liên kết π + vòng

Do phân tử mạch hở nên phân tử C5H10 có 1 liên kết π (có 1 liên kết đôi).

Có 6 đồng phân thỏa mãn là:

CH2=CH-CH2-CH­2-CH3

CH3-CH=CH-CH2-CH3 (cis - trans)

CH2=CH-CH(CH3)2

CH2=C(CH3)-CH2-CH3

(CH3)2C=CH-CH3

Đáp án B

Câu 12

Gọi công thức phân tử của ankan là CnH2n+2 (n ≥ 1).

Khi thực hiện phản ứng clo hóa ankan thu được một sản phẩm thế điclo có công thức CnH2nCl2.

Mđiclo = 14n + 71 = 44.2,25 = 99 ⟹ n = 2.

Vậy CTPT của X là C2H6 có CTCT là CH3–CH3.

Đáp án A

Câu 13

Dựa vào điều kiện để 1 chất có đồng phân hình học:

+ Có liên kết đôi C=C

+ 2 nhóm nguyên tử đính vào cùng 1 nguyên tử cacbon của liên kết đôi phải khác nhau.

Công thức cấu tạo của các chất là:

A. 2,3-đimetylpent-2-en: CH3-C(CH3)=C(CH3)-CH2-CH3 không có đồng phân hình học.

B. 2,3-điclobut-2-en: CH3-CCl=CCl-CH3 có đồng phân hình học.

C. 2-clo-but-1-en: CH2=CCl-CH2-CH3 không có đồng phân hình học.                            

D. 2-metylbut-2-en: CH3-C(CH3)=CH-CH3 không có đồng phân hình học.

Đáp án B

Câu 14

Tên thay thế của anken = số chỉ vị trí nhánh + tên nhánh + tên mạch chính + số chỉ vị trí liên kết đôi + en

Chú ý:

+ Chọn mạch chính là mạch C dài nhất có chứa liên kết đôi.

+ Đánh số các nguyên tử cacbon trên mạch chính từ phía gần liên kết đôi hơn.

Như vậy ta đánh số mạch chính như sau:

 \(\mathop {{\rm{ }}C}\limits^5 {H_3} - \mathop {{\rm{ }}C}\limits^4 {H_2} - \mathop {{\rm{ }}C}\limits^3 \left( {C{H_3}} \right) = \mathop {{\rm{ }}C}\limits^2 H - \mathop {{\rm{ }}C}\limits^1 {H_3}\)

Vậy tên của anken là 3-metylpent-2-en.

Đáp án B

Câu 15

Chọn nanken (bđ) = nH2 (bđ) = 1 mol ⟹ nanken pư = nH2 pư = nankan = 1.75% = 0,75 mol

⟹ nsau = nđầu - nH2 pư = 2 - 0,75 = 1,25 mol

Đặt công thức anken là CnH2n (n ≥ 2).

BTKL: mH2 bđ + manken bđ = msau

⇔ 1.2 + 1.14n = 1,25.23,2.2

⇔ n = 4

Vậy CTPT của anken là C4H8.

Đáp án C

Câu 16

Gọi công thức anken là CnH2n (n ≥ 2).

CnH2n (X) + Br2 → CnH2nBr2 (Y)

⟹ \(\% {m_{B{\rm{r}}}} = \frac{{2.80}}{{14n + 2.80}}.100\%  = 74,08\%  \to n = 4\)

⟹ CTPT của anken là C4H8

Do anken phản ứng với HBr thu được 1 sản phẩm cộng duy nhất nên anken có tính đối xứng

⟹ CTCT của X là CH3-CH=CH-CH3 có tên là but-2-en.

Đáp án B

Câu 17

nBr2pứ = netilen dư = 0,225 mol

⟹ netilen trùng hợp = 0,775mol

⟹ H% = (0,775/1).100% = 77,5%

mPE = metilen trùng hợp = 0,775.28 = 21,7 gam.

Đáp án A

Câu 18

Ankađien liên hợp là ankađien có hai liên kết đôi C=C cách nhau 1 nối đơn.

Đáp án C

Câu 19

Gọi công thức anken là CnH2n (n ≥ 2).

- Phản ứng đốt cháy anken:

CnH2n + \(\frac{{3n}}{2}\)O2 \(\xrightarrow{{{t}^{o}}}\) nCO2 + nH2O

Vậy khi đốt anken ta luôn có: nCO2 = nH2O = 7,2/18 = 0,4 (mol)

- Dẫn khí CO2 vào Ca(OH)2 dư:

CO2 + Ca(OH)2 → CaCO3 + H2O

0,4 →                        0,4 (mol)

⟹ mCaCO3 = 0,4.100 = 40 gam

Đáp án A

Câu 20

Ankađien X + Cl2 → CH2Cl-C(CH3)=CH-CHCl-CH3

⟹ X là 1CH2=2C(CH3)-3CH=4CH-5CH3 có tên gọi là 2-metylpenta-1,3-đien.

Đáp án C

Câu 21

(1) CH2=C=CH-CH2-CH3

(2) CH2-CH=C=CH-CH3

(3) CH2=CH-CH=CH-CH3

(4) CH2=CH-CH2-CH=CH2

(5) CH3-C(CH3)=C=CH2

(6) CH2=C(CH3)-CH=CH2

⟹ 6 đồng phân

Đáp án A

Câu 22

Các chất điều chế trực tiếp được C2H2:

Ag2C2 + 2HCl → 2AgCl + C2H2

2CH4 \(\xrightarrow[lamlanhnhanh]{{{1500}^{o}}C}\) C2H2 + 3H2

CaC2 + 2H2O → C2H2 + Ca(OH)2

Đáp án C

Câu 23

nBr2 = 0,1 mol; nO2 = 0,35 mol

Ankađien X phản ứng với Br2 dư ⟹ phản ứng theo tỉ lệ 1 : 2

⟹ nX = 0,5.nBr2 = 0,05 mol

Gọi công thức phân tử của X là CnH2n-2 (n ≥ 3).

CnH2n-2 + (3n - 1)/2 O2  → CO2 + (n - 1)H2O

0,05           0,35 mol

⟹ 0,05.(3n - 1)/2 = 0,35 ⟹ n = 5

Vậy CTPT của X là C5H8.

Đáp án C

Câu 24

Phương trình phản ứng trùng hợp isopren là:

nCH2=C(CH3)-CH=CH2 → (-CH2-C(CH3)=CH-CH2-)n.

           isopren                       cao su isopren

Đáp án D

Câu 25

1CH≡2C–3CH(C2H5)–4CH(CH3)–5CH3

Tên gọi: 3-etyl-4-metylpent-1-in.

Đáp án D

Câu 26

Độ bất bão hòa: \(k = \frac{{2C + 2 - H}}{2} = \frac{{2.6 + 2 - 10}}{2} = 2\)

Mặt khác, X là hiđrocacbon có k = 2 và tác dụng với AgNO3/NH3 tạo kết tủa nên X là ankin có liên kết ba ở đầu mạch.

Có 4 đồng phân thỏa mãn là:

 

Đáp án D

Câu 27

 \({{C}_{2}}{{H}_{2}}+\text{ }{{H}_{2}}O\xrightarrow[{{80}^{0}}C]{HgS{{O}_{4}}}C{{H}_{3}}CHO\)

Vậy công thức cấu tạo của X là CH3CHO.

Đáp án B

Câu 28

mX = 0,4.2 + 0,2.26 = 6 gam

BTKL: mY = mX = 6 gam → nY = 6/7,5.2 = 0,4 mol

nH2pư  = 0,4 + 0,2 - 0,4 = 0,2 mol

Bảo toàn liên kết π: 2nC2H2 = nH2 pư  + nBr2

→ 2.0,2 = 0,2 + nBr2 → nBr2 = 0,2 mol

→ mBr2 = 32 gam.

Đáp án D

Câu 29

Ta có: nCO2 = 0,08 mol; nH2O = 0,05 mol

→ nankin = nCO2 - nH2O = 0,03 mol

Vậy số C trung bình của 2 ankin là:

\(\bar C = \frac{{{n_{C{O_2}}}}}{{{n_{ankin}}}} = \frac{{0,08}}{{0,03}} = 2,67\)

Vì 2 ankin đồng đẳng kế tiếp nhau nên công thức phân tử của 2 ankin là C2H2 và C3H4.

Đáp án D

Câu 30

Gọi A là hỗn hợp khí ban đầu.

Theo định luật bảo toàn khối lượng ta có: mX = mA = 0,35.26 + 0,65.2 = 10,4 (g)

Ta có: MX = 16 → nX = mX : MX = 10,4 : 16 = 0,65 (mol)

Suy ra số mol H2 phản ứng là nH2 phản ứng  =  nA - nX = (0,35 + 0,65) - 0,65 = 0,35 mol

Ta có: nC2H2 dư = nAg2C2 = 24 : 240 = 0,1 mol

Theo bảo toàn liên kết π ta có: 2.nC2H2 ban đầu = nH2 phản ứng + 2.nC2H2 dư + nB2

→ nBr2 = 2.0,35 - 0,35 - 2.0,1 = 0,15 (mol).

Đáp án C

Câu 31

Benzen là chất lỏng, có mùi đặc trưng, không tan trong nước.

Đáp án A

Câu 32

nCO2(đktc) = VCO2/22,4 = 10,752/22,4 = 0,48 (mol)

TH1: Nếu ankin là C­2H2

BTNT C ⟹ nC2H2 = 1/2.nCO2 = 0,48/2 = 0,24 (mol)

C2H2 + AgNO3 + NH3 → Ag2C2↓ + NH4NO3

 0,24                        →    0,24                       (mol)

⟹ mAg2C2 = 57,6 (g) ⟹ loại (đề bài cho mkết tủa = 23,52 g)

TH2: Ankin khác C2H2

Đặt công thức phân tử ankin là CnH2n-2 (đk: n >2)

CnH2n-2 + (3n-1)/2O2 \(\xrightarrow{{{t}^{0}}}\) nCO2 + (n-1)H2O (1)

Theo PTHH (1) ⟹ nankin = 0,48/n (mol)

CnH2n-2 + AgNO3 + NH3 → CnH2n-3Ag↓ (vàng) + NH4NO3 (2)

Theo PTHH (2) ⟹ nkết tủa = nankin = 0,48/n (mol)

Lại có mkết tủa = (14n + 105).0,48/n = 23,52 ⟹ n = 3

Vậy ankin là C3H4.

Đáp án B

Câu 33

Tác dụng với dung dịch KMnO4 ở nhiệt độ thường tạo ra ancol 2 chức ⟹ chứa nối đôi C=C.

⟹ A là C6H5-CH=CH2 (stiren).

⟹ 1 mol A tác dụng tối đa với 4 mol H2; 1 mol brom.

Đáp án A

Câu 34

nStiren ban đầu = 10,4 / 104 = 0,1 mol

(1) C6H5CH=CH2 + Br2 → C6H5CHBr-CH2Br

(2) Br2 + 2KI → 2KBr + I2

Theo (2): nBr2 dư = nI2 = 0,005 mol ⟹ nBr2 pư = 0,03 – 0,005 = 0,025 mol

Theo (1): nStiren dư = nBr2 pứ = 0,025 mol

⟹ nStiren tham gia pứ trùng hợp = n ban đầu – n = 0,1 – 0,025 = 0,075 mol

H% = nphản ứng. 100% / nban đầu = 0,075. 100% / 0,1 = 75%

Đáp án B

Câu 35

Đặt nCH4 = x; nC2H2 = y; nC3H6 = z (mol)

+) nX = x + y + z = 0,2 (1)

+) Tỉ khối:

\({M_X} = \frac{{16x + 26y + 42z}}{{0,2}} = 13,1.2\) (2)

+) nCaCO3 = nCO2 = 38 : 100 = 0,38 mol ⟹ nCO2 = x + 2y + 3z = 0,38 (3)

Giải (1) (2) (3) được: x = 0,06; y = 0,1; z = 0,04

BTNT "H": nH2O = 2x + y + 3z = 0,34 mol

m bình tăng = mCO2 + mH2O = 0,38.44 + 0,34.18 = 22,84 gam.

Đáp án C

Câu 36

nO2 = 0,625 mol.

Gọi số mol H2O và CO2 mà phản ứng đốt cháy tạo ra là x và y mol

BTNT O ⟹ 2nO2 = 2nCO2 + nH2O ⟹ 2.0,625 = 2y + x (1)

Khi cho sản phẩm vào dung dịch Ca(OH)2 có nCaCO3 = 0,3 mol

⟹ mdd giảm = mCaCO3 – mH2O – mCO2 ⟹ 4,3 = 30 – 44y – 18x (2)

Từ (1)(2) ⟹ x = 0,45 mol và y = 0,4 mol.

X  có số C trung bình là C = nCO2/nX = 0,4/0,25 = 1,6 ⟹ Y là CH4

X có số H trung bình là H = 2nH2O/nX = (0,45.2)/0,2 = 3,6 ⟹ Z có chứa số nguyên tử H < 3,6

⟹ số nguyên tử H của Z là 2 (số nguyên tử H chẵn).

X có CH4: a mol và CmH2: b mol có nX = a + b = 0,25 mol

BTNT H ⟹ nH = 4a + 2b = 2nH2O = 0,9 mol ⟹ a = 0,2 và b = 0,05.

BTNT C ⟹ nC = a + m.b = 0,4 ⟹ 0,2 + 0,05m = 0,4 ⟹ m = 4

⟹ Z là C4H2.

Đáp án D

Câu 37

\({C_3}{H_8}(0,1) \to X\left\{ {\begin{array}{*{20}{l}}{C{H_4}}\\{{C_2}{H_4}}\\{{C_3}{H_8}}\end{array}} \right. \to {C_2}{H_4} + Y\left\{ {\begin{array}{*{20}{l}}{C{H_4}}\\{{C_3}{H_8}}\end{array}} \right.\)

Gọi số mol C3H8 phản ứng là x (mol)

C3H8 \(\xrightarrow{{{t}^{0}},p,xt}\) CH4 + C2H4

Theo PTHH ⟹ nCH4 = nC2H4 = nC3H8(pứ) = x (mol)

Ta có Y gồm CH4 x (mol) và C3H8 dư 0,1 – x (mol)

⟹ \({M_Y} = \frac{{16x + 44(0,1 - x)}}{{0,1}} = 10,8.2\) ⟹ x = 0,08 (mol)

Vậy \(H = \frac{{0,08.100\% }}{{0,1}} = 80\% \).

Đáp án B

Câu 38

nX = 8,96 : 22,4 = 0,4 mol; nBr2 = 232 : 160 = 1,45 mol

⟹ nBr2 : nX = 3,625 = số liên kết pi trung bình của 2 chất trong X

⟹ 2 chất trong X có 3 liên kết pi và 4 liên kết pi trong phân tử.

Vì 2 hiđrocacbon là chất khí ⟹ số C ≤ 4

⟹ 2 chất phải là: CH≡C-CH=CH2 (x mol) và CH≡C-C≡CH (y mol)

⟹ nX = x + y = 0,4 mol và nBr2 = 3x + 4y = 1,45 mol

⟹ x = 0,15 và y = 0,25.

⟹ x : y = 0,15 : 0,25 = 3 : 5 (tỉ lệ số mol 2 chất trong hỗn hợp X)

- Trong 10,15g X có CH≡C-CH=CH2 (3n mol) và CH≡C-C≡CH (5n mol)

⟹ mX = 3n.52 + 5n.50 = 10,15 ⟹ n = 0,025.

Khi phản ứng với AgNO3/NH3 thu được hỗn hợp kết tủa gồm: 0,075 mol AgC≡C-CH=CH2 và 0,125 mol AgC≡C-C≡CAg

⟹ mkết tủa = 44,925 g.

Đáp án A

Câu 39

BTKL: m hh đầu = mX ⟹ nX = mhh đầu : MX = (0,5.26 + 0,4.52 + 0,65.2) : 39 = 0,9 mol

nH2 phản ứng = nban đầu  - nX = (0,5 + 0,4 + 0,65) - 0,9 = 0,65 mol ⟹ số mol H2 đã phản ứng (H2 hết)

Trong X, ta đặt số mol CH≡CH, CH≡C-CH=CH2; CH≡C-CH2-CH3 lần lượt là x, y, z.

+) x + y + z = nX – nY = 0,9 – 0,45 = 0,45 (1)

+) nAgNO3 = 2nC2H2 + nC4H4 + nC≡C-C-C ⟹ 2x + y + z = 0,7 (2)

+) BT liên kết π: 2nC2H2 bđ + 3nC4H4 bđ  = nH2 pư + 2nC2H2 dư + 3nC4H4 dư + 2nC≡C-C-C + nBr2

⟹ 0,5.2 + 0,4.3 = 0,65 + 2x + 3y + 2z + 0,55 ⟹ 2x + 3y + 2z = 1 (3)

Từ (1), (2) và (3) ⟹ x = 0,25 mol; y = 0,1 mol; z = 0,1 mol

⟹ Kết tủa tạo thành:

CAg≡CAg (0,25 mol);

CAg≡C−CH=CH2 (0,1 mol);

CAg≡C−CH2−CH3 (0,1 mol)

⟹ m kết tủa = 0,25.240 + 0,1.159 + 0,1.161 = 92g

Đáp án C

Câu 40

* Đốt hỗn hợp X:

BTNT "C": nC = nCO2 = 1,2 mol

BTNT "H": nH = 2nH2O = 44/15 mol

⟹ mX = mC + mH = 1,2.12 + 44/15 = 52/3 (g)

* Cho X tác dụng với H2 vừa đủ tạo ra Y

Đặt công thức của Y là CnH2n+2

MY = 14n + 2 = 26,2.2 ⟹ n = 3,6

Vậy Y có công thức trung bình là C3,6H9,2

BTNT "C": nCO2 = 3,6.nY ⟹ 1,2 = 3,6.nY ⟹ nY = 1/3 mol

BTKL: mH2 = mY - mX = (1/3).26,2.2 - 52/3 = 2/15 gam ⟹ nH2 = 1/15 mol

Đặt công thức của X là: C3,6H2.3,6+2-2k hay C3,6H9,2-2k (với k là liên kết pi trong X)

C3,6H9,2-2k + kH2 → C3,6H9,2

Theo PTHH ⟹ nH2 = k.nY

⟹ 1/15 = k/3 ⟹ k = 0,2

⟹ X là C3,6H8,8 có MX = 52

Vậy dX/H2 = 52/2 = 26.

Đáp án B

Loigiaihay.com

Sub đăng ký kênh giúp Ad nhé !


Bình chọn:
4.9 trên 7 phiếu

Các bài liên quan:

Luyện Bài tập trắc nghiệm môn Hóa lớp 11 - Xem ngay

>>KHOÁ NỀN TẢNG LỚP 12 DÀNH CHO 2K4 NĂM 2022 học sớm chiếm lợi thế luyện thi TN THPT & ĐH


Gửi bài