Đề số 1 - Đề kiểm tra giữa học kì II - Hóa học 11 có đáp án và lời giải chi tiết


Đề số 1 - Đề kiểm tra giữa học kì II - Hóa học 11 có đáp án và lời giải chi tiết

Đề bài

Câu 1 : Hợp chất CH3-CH(CH3)-CH2-CH3 có thể tạo được bao nhiêu dẫn xuất monohalogen?

A. 4.

B. 3.

C. 2.

D. 5.

Câu 2 : Để phân biệt but-1-in và but-2-in người ta dùng thuốc thử nào sau đây?

A. dung dịch HBr.

B. dung dịch Br2.

C. dung dịch AgNO3/NH3.

D. dung dịch KMnO4.

Câu 3 : Hỗn hợp X gồm 2 anken là đồng đẳng liên tiếp có thể tích 4,48 lít (ở đktc). Nếu cho hỗn hợp X đi qua bình đựng nước brom dư, khối lượng bình tăng lên 9,8 gam. Phần trăm thể tích của một trong 2 anken là

A. 70%.

B. 40%.

C. 80%.

D. 50%.

Câu 4 : Chất nào sau đây khi tác dụng với HBr chỉ cho một sản phẩm duy nhất?

A. But-1-en.

B. 2,3-đimetylbut-2-en.

C. propen.

D. 2-metylbut-2-en.

Câu 5 : Hiđrocacbon X mạch hở có phân tử khối là 54. X có bao nhiêu công thức cấu tạo?

A. 2.

B. 3.

C. 5.

D. 4.

Câu 6 : Cho hỗn hợp X gồm CH4, C2H4 và C2H2. Lấy 12,9 gam X tác dụng hết với dung dịch brom (dư) thì khối lượng brom phản ứng là 72 gam. Mặt khác, nếu cho 20,16 lít (ở đktc) hỗn hợp khí X tác dụng với lượng dư dung dịch AgNO3 trong NH3, thu được 54 gam kết tủa. Phần trăm thể tích của C2H4 có trong X là

A. 50%.

B. 45%.

C. 30%.

D. 25%.

Câu 7 : Đốt cháy hoàn toàn một ankađien X ở thể khí thu được H2O và CO2 có tổng khối lượng là 23 gam. Nếu cho sản phẩm cháy đi qua dung dịch Ca(OH)2 dư, được 40 gam kết tủa. Công thức phân tử của X là

A. C2H2.

B. C3H4.

C. C4H6.

D. C5H8.

Câu 8 : Đốt cháy hoàn toàn a gam hỗn hợp eten, propen, but-2-en cần dùng vừa đủ b lít oxi (đktc) thu được 2,4 mol CO2. Giá trị của b là

A. 80,64 lít.

B. 24,9 lít.

C. 94,2 lít.

D. 92,4 lít.

Câu 9 : Toluen là tên gọi chất nào sau đây?

A. C6H5-CH3.

B. C6H6.

C. C6H5-CH=CH2.

D. C6H5-CH2-CH3.

Câu 10 : Cho sơ đồ sau: CH4 → X → Y → poli(vinyl clorua). X, Y tương ứng với dãy chất nào sau đây?

A. axetilen, vinyl axetilen.

B. axetilen, vinyl clorua.

C. etilen, 1,2-điclo etan.

D. etilen, vinyl clorua.

Câu 11 : Cho 4,32 gam hiđrocacbon X tác dụng với AgNO3 dư trong NH3 thu được 12,88 gam kết tủa. Vậy X là

A. but-1-in.

B. axetilen.

C. propin.

D. vinyl axetilen.

Câu 12 : Cho phản ứng giữa buta-1,3-đien và HBr ở 40oC (tỉ lệ mol 1:1), sản phẩm chính của phản ứng là

A. CH3CHBrCH=CH2.

B. CH3-CH=CH-CH2Br.

C. CH2BrCH2CH=CH2.

D. CH3-CH=CBr-CH3.

Câu 13 : Có bao nhiêu ankin ứng với công thức phân tử C5H8?

A. 2.

B. 4.

C. 1.

D. 3.

Câu 14 : Cho các chất sau: etan; etilen; axetilen; buta-1,3-đien; benzen; stiren. Số chất làm mất màu dung dịch Br2

A. 2.

B. 4.

C. 3.

D. 5.

Câu 15 : Hỗn hợp khí X gồm C2H6, C3H6 và C4H6. Tỉ khối của X so với H2 bằng 24. Đốt cháy hoàn toàn 2,88 gam X trong oxi dư rồi cho toàn bộ sản phẩm cháy vào 1,5 lít dung dịch Ba(OH)2 0,1M. Sau khi các phản ứng xảy ra hoàn toàn, thu được m gam kết tủa. Giá trị của m là

A. 9,885.

B. 13,795.

C. 17,73.

D. 15,77.

Câu 16 : Biết 8 gam một ankin X có thể làm mất màu tối đa 200 ml dung dịch Br2 2M. Công thức phân tử của X là

A. C4H6.

B. C3H4.

C. C2H2.

D. C5H8.

Câu 17 : Hiđrocacbon X cháy cho thể tích hơi nước gấp 1,2 lần thể tích CO2 (được đo ở cùng điều kiện). Khi tác dụng với clo tạo một dẫn xuất monoclo duy nhất. X có tên là

A. etan.

B. propan.

C. 2,2-đimetylpropan.

D. isobutan.

Câu 18 : Đốt cháy m gam hỗn hợp X gồm C2H6, C3H4, C3H8, C4H10 được 17,6 gam CO2 và 10,8 gam H2O. Giá trị của m là

A. 10,8.

B. 7,2.

C. 6.

D. 12.

Câu 19 : Điều chế etilen trong phòng thí nghiệm từ C2H5OH, (H2SO4 đặc, 170oC) thường lẫn các oxit như SO2, CO2. Chất dùng để làm sạch etilen là

A. dung dịch NaHCO3 dư.

B. dung dịch NaOH dư.

C. dung dịch KMnO4 loãng dư.

D. dung dịch brom dư.

Câu 20 : Cho các hiện tượng sau:

     (1) Sục khí etilen (dư) vào nước brom (màu vàng - da cam), nước brom mất màu.

     (2) Sục khí etilen (dư) vào dung dịch KMnO4 (màu tím - hồng), dung dịch mất màu và có kết tủa trắng.

     (3) Sục khí propilen (dư) vào dung dịch KMnO4 (màu tím - hồng), dung dịch mất màu và có kết tủa đen.

     (4) Cho benzen vào dung dịch Br2 thấy có kết tủa trắng.

     (5) Cho khí axetilen dư vào bình chứa dung dịch AgNO3/NH3 (không màu), xuất hiện kết tủa vàng.

Số hiện tượng được mô tả đúng với thí nghiệm là

A. 5.

B. 3.

C. 2.

D. 4.

Câu 21 : C5H8 có bao nhiêu đồng phân ankađien liên hợp (tính cả đồng phân hình học)?

A. 3.

B. 4.

C. 2.

D. 5.

Câu 22 : Cho các phát biểu sau:

     (1) Ankađien là hiđrocacbon mạch hở mà phân tử có chứa 2 liên kết π.

     (2) Những hiđrocacbon có công thức phân tử là CnH2n là anken.

     (3) Anken là hiđrocacbon không no, mạch hở có công thức phân tử là CnH2n (n ≥ 2).

     (4) Ankin là hiđrocacbon mạch hở mà phân tử có chứa 1 liên kết C≡C.

     (5) Anken có từ 4C trở lên có thể có đồng phân hình học.

Số phát biểu đúng

A. 3.

B. 5.

C. 2.

D. 4.

Câu 23 : Isopren tham gia phản ứng với dung dịch Br2 theo tỉ lệ mol 1:1 tạo ra tối đa bao nhiêu sản phẩm (tính cả đồng phân hình học)?

A. 2.

B. 3.

C. 1.

D. 4.

Câu 24 : Hỗn hợp X gồm metan và anken, cho 5,6 lít X qua dung dịch brom dư thấy khối lượng bình brom tăng 7,28 gam và có 2,688 lít khí bay ra (các khí đều đo ở đktc). Công thức phân tử của anken là

A. C4H8.

B. C3H6.

C. C5H10.

D. C2H4.

Câu 25 : Công thức chung của ankan là

A. CnH2n+2 (n ≥ 2).

B. CnH2n (n ≥ 2).

C. CnH2n-2 (n ≥ 3).

D. CnH2n+2 (n ≥ 1).

Câu 26 : Hãy cho biết cặp tên nào sau đây thuộc cùng một chất?

A. isopropyl axetilen và 2-metylbut-3-in.

B. etyl metyl axetilen và pent-2-in.

C. vinyl axetilen và buta-1,3-điin.

D. đimetyl axetilen và but-1-in.

Câu 27 : Khối lượng etilen thu được khi đun nóng 230 gam rượu etylic với H2SO4 đậm đặc, hiệu suất phản ứng đạt 40% là

A. 350 gam.

B. 84 gam.

C. 196 gam.

D. 56 gam.

Câu 28 : Cho sơ đồ sau: axetilen \(\xrightarrow{HCl}\) vinyl clorua \(\xrightarrow{{{t}^{o}},xt,p}\) PVC. Tính thể tích axetilen (đktc) cần lấy để điều chế 1,2 tấn PVC, biết hiệu suất phản ứng cộng và phản ứng trùng hợp lần lượt là 80% và 62,5%.

A. 860,16 m3.

B. 537,6 m3.

C. 1075,2 m3.

D. 430,08,4 m3.

Câu 29 : Hỗn hợp X gồm 0,1 mol C2H2; 0,15 mol C2H4; 0,2 mol C2H6 và 0,3 mol H2. Đun nóng X với bột Ni xúc tác 1 thời gian được hỗn hợp Y. Đốt cháy hoàn toàn hỗn hợp Y được số gam CO2 và H2O lần lượt là

A. 3,96 và 3,35.

B. 39,6 và 11,6.

C. 39,6 và 46,8.

D. 39,6 và 23,4.

Câu 30 : Anken X có công thức cấu tạo: CH3-CH2-C(CH3)=CH-CH3. Tên của X là

A. 3-metylpent-2-en.

B. isohexan.

C. 3-metylpent-3-en.

D. 2-etylbut-2-en.

Câu 31 : Cho sơ đồ chuyển hoá: Canxi cacbua → X1 → X2 → X3 → Cao su buna. X2 là chất nào sau đây?

A. Axetilen.

B. Vinyl axetilen.

C. Etilen hoặc axetilen.

D. Etilen.

Câu 32 : Trong phòng thí nghiệm khí C2H2 được điều chế từ chất nào sau đây?

A. C2H4.

B. CaC2.

C. C2H6.

D. CH4.

Câu 33 : Cho 3,36 lít hỗn hợp etan và etilen (đktc) đi chậm qua qua dung dịch brom dư. Sau phản ứng khối lượng bình brom tăng thêm 2,8 gam. Số mol etan và etilen trong hỗn hợp lần lượt là

A. 0,1 và 0,05.

B. 0,05 và 0,1.

C. 0,12 và 0,03.

D. 0,03 và 0,12.

Câu 34 : Dãy nào sau đây chỉ gồm các chất thuộc dãy đồng đẳng của metan?

A. CH4, C2H6, C4H10, C5H12.

B. C2H6, C3H8, C5H10, C6H12.

C. CH4, C2H2, C3H4, C4H10.  

D. C2H2, C3H4, C4H6, C5H8.

Câu 35 : Hợp chất hữu cơ CH3-CH=C(CH3)-CH=CH2 có tên gọi là

A. 3-metylpent-2-en.

B. 2-metylbuta-1,3-đien.

C. 3-metylpenta-1,3-đien.

D. 2-metylpent-2-en.

Câu 36 : Trong một bình kín có chứa hỗn hợp khí X gồm 0,35 mol C2H2; 0,65 mol H2 và một ít bột Ni. Nung nóng bình một thời gian thu được hỗn hợp khí Y có tỉ khối so với H2 bằng 8. Sục Y vào dung dịch AgNO3 dư trong NH3 đến phản ứng hoàn toàn thu được hỗn hợp khí Z và 12 gam kết tủa. Hỗn hợp khí Z phản ứng vừa đủ với bao nhiêu mol Br2 trong dung dịch?

A. 0,25.

B. 0,2.

C. 0,15.

D. 0,1.

Câu 37 : Chất nào sau đây thường được dùng để kích thích hoa quả nhanh chín?

A. CaC2.

B. Al4C3.

C. SiO2.

D. CaCO3.

Câu 38 : Trùng hợp đivinyl tạo ra cao su buna có cấu tạo là

A. (-CH2-CH-CH-CH2-)n.

B. (-CH2-CH-CH=CH2-)n.

C. (-CH2-CH=CH-CH2-)n.    

D. (-CH2-CH2-CH2-CH2-)n.

Câu 39 : Số đồng phân hiđrocacbon thơm ứng với công thức phân tử C8H10

A. 3.

B. 2.

C. 5.

D. 4.

Câu 40 : Chất nào sau đây phản ứng được với dung dịch AgNO3/NH3?

A. buta-1,3-đien.

B. but-2-in.

C. stiren.

D. propin.

Lời giải chi tiết

ĐÁP ÁN VÀ HƯỚNG DẪN GIẢI

Câu 1

Lý thuyết về phản ứng thế của ankan.

Hướng dẫn giải:

 

(Dấu mũi tên là vị trí nguyên tử halogen thế vào).

Vậy có 4 sản phẩm thế monohalogen.

Đáp án A

Câu 2

Để phân biệt but-1-in và but-2-in ta có thể dùng dung dịch AgNO3/NH3:

+ Xuất hiện kết tủa vàng nhạt → But-1-in.

+ Không hiện tượng → But-2-in.

Đáp án C

Câu 3

nhh anken = 4,48/22,4 = 0,2 mol

mhh anken = mbình tăng = 9,8 gam

⟹ \({{\bar{M}}_{anken}}=\frac{9,8}{0,2}=49\)

Đặt công thức chung của 2 anken là \({{C}_{{\bar{n}}}}{{H}_{2\bar{n}}}\)

→ \(14\bar{n}=49\to \bar{n}=3,5\)

Mà 2 anken là đồng đẳng liên tiếp → C3H4 và C4H6.

Ta thấy \(3,5=\frac{3+4}{2}\) ⟹ mỗi anken chiếm 50% về thể tích.

Đáp án D

Câu 4

Anken khi cộng HBr cho sản phẩm duy nhất ⟹ Anken có tính chất đối xứng.

⟹ 2,3-đimetylbut-2-en thỏa mãn.

PTHH: CH3-C(CH3)=C(CH3)-CH3 + HBr → CH3-CH(CH3)-CBr(CH3)-CH3

Đáp án B

Câu 5

Đặt CTPT của X là CxHy → 12x + y = 54 → y = 54 - 12x.

Hiđrocacbon luôn có H ≤ 2C + 2 → y ≤ 2x + 2 → 54 - 12x ≤ 2x + 2 → x ≥ 3,7 (1)

Mà 12x < 54 → x < 4,5 (2)

Từ (1) (2) → x = 4; y = 6 thỏa mãn.

Các hiđrocacbon có CTPT C4H6 là:

C ≡ C - C - C                          ;

C - C ≡ C - C

C = C = C - C                         ;

C = C - C = C

Vậy có 4 CTCT thỏa mãn.

Đáp án D

Câu 6

Giả sử trong 12,9 gam hỗn hợp X có nCH4 = x mol; nC2H4 = y mol; nC2H2 = z mol.

+) mX = 16x + 28y + 26z = 12,9 (1)

+) nBr2 = nC2H4 + 2nC2H2 → y + 2z = 72/160 = 0,45 (2)

+) Cho 0,9 mol hỗn hợp X tác dụng với AgNO3/NH3 dư thì nAg2C2 = 54/240 = 0,225 mol

Tỷ lệ:   0,9 mol        X sinh ra       0,225 mol     Ag2C2

         (x+y+z) mol    X sinh ra       z mol          Ag2C2

→ 0,9.z = 0,225.(x + y + z) (3)

Giải hệ (1) (2) (3) được x = 0,3; y = 0,15; z = 0,15.

\(%{{V}_{{{C}_{2}}{{H}_{2}}}}=%{{n}_{{{C}_{2}}{{H}_{4}}}}=\frac{0,15}{0,3+0,15+0,15}.100%=25%\)

Đáp án D

Câu 7

nCO2 = nCaCO3 = 40/100 = 0,4 mol

mH2O = 23 - 0,4.44 = 5,4 gam → nH2O = 0,3 mol

Đốt ankađien: nankađien = nCO2 - nH2O = 0,1 mol

Số C = \(\frac{{{n}_{C{{O}_{2}}}}}{{{n}_{ank\text{ad}ien}}}\) =  = 4

⟹ CTPT của ankađien là C4H6.

Đáp án C

Câu 8

Đốt anken: \({{n}_{C{{O}_{2}}}}={{n}_{{{H}_{2}}O}}=2,4\left( mol \right)\)

\(\xrightarrow{BTNT.O}2{{n}_{{{O}_{2}}}}=2{{n}_{C{{O}_{2}}}}+{{n}_{{{H}_{2}}O}}\to {{n}_{{{O}_{2}}}}=\frac{2.2,4+2,4}{2}=3,6\left( mol \right)\)

\(\to {{V}_{{{O}_{2}}}}=3,6.22,4=80,64\left( l \right)\)

Đáp án A

Câu 9

Toluen là C6H5-CH3.

Đáp án A

Câu 10

Sơ đồ: CH4 → C2H2 (X) → C2H4Cl (Y) → Poli(vinyl clorua).

PTHH:

            2CH4 \(\xrightarrow{{{1500}^{o}}C,lamlanhnhanh}\) C2H2 + 3H2

            CH≡CH + HCl \(\xrightarrow{H{{g}^{2+}}}\) CH2=CHCl

            nCH2=CHCl \(\xrightarrow{{{t}^{o}},xt,p}\) (CH2-CHCl)n

Vậy X là axetilen; Y là vinyl clorua.

Đáp án B

Câu 11

Giả sử hiđrocacbon có k nguyên tử H bị thay thế bằng k nguyên tử Ag.

mtăng theo PT = 108k - k = 107k (g)

mtăng theo ĐB = 12,88 - 4,32 = 8,56 (g)

→ nhiđrocacbon = \(\frac{8,56}{107k}\) = \(\frac{0,08}{k}\)

+ Nếu k = 1 → n hiđrocacbon = 0,08 mol → M hiđrocacbon = 4,32 : 0,08 = 54 (C4H6).

+ Nếu k = 2 → n hiđrocacbon = 0,04 mol → M hiđrocacbon = 4,32 : 0,04 = 108 (loại).

⟹ Hiđrocacbon là but-1-in.

Đáp án A

Câu 12

Trong phản ứng cộng vào ankađien liên hợp (tỉ lệ mol 1:1):

+ Ở 40oC sản phẩm chính là sản phẩm cộng-1,4.

+ Ở -80oC sản phẩm chính là sản phẩm cộng-1,2.

\(C{{H}_{2}}=CH-CH=C{{H}_{2}}+HB\text{r}\xrightarrow{{{40}^{o}}C}C{{H}_{3}}-CH=CH-C{{H}_{2}}B\text{r}\left( spc \right)\)

Đáp án B

Câu 13

Ankin có các loại đồng phân:

+ Đồng phân mạch C.

+ Đồng phân vị trí liên kết ba.

Các ankin có CTPT C5H8 là:

C ≡ C - C - C - C

C - C ≡ C - C - C

C - C(C) - C ≡ C

Vậy có 3 đồng phân ankin có CTPT C5H8.

Đáp án D

Câu 14

Các chất làm mất màu dung dịch Br2 là: etilen (C2H4); axetilen (C2H2); buta-1,3-đien (CH2=CH-CH=CH2); stiren (C6H5-CH=CH2) (4 chất).

Đáp án B

Câu 15

- Ta có \({{\bar{M}}_{X}}=48\) → ${{n}_{X}}=\frac{2,88}{48}=0,06\left( mol \right)\)

Nhận thấy các chất đều có 6H. Đặt công thức trung bình hỗn hợp là \({{C}_{{\bar{n}}}}{{H}_{6}}\)

\(\xrightarrow{{{{\bar{M}}}_{X}}=48}12\bar{n}+6=48\to \bar{n}=3,5\)

\(\xrightarrow{BTNT.C}{{n}_{C{{O}_{2}}}}=3,5.{{n}_{X}}=3,5.0,06=0,21\left( mol \right)\)

- Khi cho 0,21 mol CO2 hấp thụ vào dung dịch chứa 0,15 mol Ba(OH)2:

Ta thấy \(1<\frac{{{n}_{O{{H}^{-}}}}}{{{n}_{C{{O}_{2}}}}}=\frac{0,3}{0,21}=1,43<2\)

→ Tạo 2 muối BaCO3 (x mol) và Ba(HCO3)2 (y mol)

Ta có hệ phương trình: 

→ m = mBaCO3 = 0,09.197 = 17,73 gam.

Đáp án C

Câu 16

nBr2 = 0,2.2 = 0,4 mol

Đặt CTPT của ankin là CnH2n-2 (n ≥ 2).

CnH2n-2 + 2Br2 → CnH2n-2Br4

0,2 ←       0,4                        (mol)

\(\to {{M}_{X}}=\frac{8}{0,2}=40\to 14n-2=40\to n=3\)

→ CTPT của X là C3H4.

Đáp án B

Câu 17

nH2O = 1,2.nCO2

Giả sử nCO2 = 1 mol; nH2O = 1,2 mol

nH2O > nCO2 ⟹ X là ankan

nankan = nH2O - nCO2 = 0,2 mol

\(\to C=\frac{{{n}_{C{{O}_{2}}}}}{{{n}_{X}}}=\frac{1}{0,2}=5\to CTPT:{{C}_{5}}{{H}_{12}}\)

Khi cho ankan tác dụng với Cl2 tạo 1 dẫn xuất monoclo duy nhất nên ankan phải có cấu tạo đối xứng

⟹ Ankan là 2,2-đimetylpropan.

 

Đáp án C

Câu 18

\(\xrightarrow{BTNT.C}{{n}_{C}}={{n}_{C{{O}_{2}}}}=\frac{17,6}{44}=0,4\left( mol \right)\)

\(\xrightarrow{BTNT.H}{{n}_{H}}=2{{n}_{{{H}_{2}}O}}=2.\frac{10,8}{18}=1,2\left( mol \right)\)

\(\xrightarrow{BTKL}{{m}_{hh.X}}={{m}_{C}}+{{m}_{H}}=0,4.12+1,2.1=6\left( g \right)\)

Đáp án C

Câu 19

Để làm sạch hỗn hợp C2H4 lẫn SO2, CO2 ta có thể dùng dung dịch NaOH dư:

            SO2 + 2NaOH → Na2SO3 + H2O

            CO2 + 2NaOH → Na2CO3 + H2O

Đáp án B

Câu 20

(1) đúng.

(2) sai, dung dịch mất màu và có kết tủa đen MnO2.

(3) đúng.

(4) sai, benzen không phản ứng với dung dịch Br2.

(5) đúng.

Vậy có 3 hiện tượng đúng với thí nghiệm.

Đáp án B

Câu 21

Các đồng phân ankađien liên hợp có CTPT C5H8 là:

cis-C = C - C = C - C

trans-C = C - C = C - C

C = C(C) - C = C

Vậy có 3 đồng phân ankađien liên hợp có CTPT C5H8.

Đáp án A

Câu 22

(1) sai, ankađien là hiđrocacbon mạch hở có chứa 2 liên kết đôi C=C (còn 2π thì có thể là liên kết C≡C).

(2) sai, CnH2n vừa có thể là anken hoặc xicloankan.

(3) đúng.

(4) đúng.

(5) đúng.

→ 3 phát biểu đúng.

Đáp án A

Câu 23

Isopren là CH2=C(CH3)-CH2=CH2 khi cộng Br2 (tỉ lệ mol 1 : 1) có thể tạo ra các sản phẩm là:

            CH2Br-CBr(CH3)-CH2=CH2

            CH2=C(CH3)-CH2Br-CH2Br

            cis-CH2Br-C(CH3)=CH2-CH2Br

            trans-CH2Br-C(CH3)=CH2-CH2Br

Vậy tạo tối đa 4 sản phẩm cộng.

Đáp án D

Câu 24

Anken phản ứng với Br2 nên bị hấp thụ vào bình, ankan không phản ứng nên bay ra khỏi bình.

nankan = 2,688/22,4 = 0,12 mol

→ nanken = 0,25 - 0,12 = 0,13 mol.

manken = mbình tăng = 7,28 gam

→ Manken = 7,28 : 0,13 = 56.

Đặt công thức anken là CnH2n (n ≥ 2)

→ 14n = 56 → n = 4.

→ CTPT của anken là C4H8.

Đáp án A

Câu 25

Công thức chung của ankan là CnH2n+2 (n ≥ 1).

Đáp án D

Câu 26

- Xét A:

            Isopropyl axetilen: C-C(C)-C≡C

            2-metylbut-3-in: tên gọi không đúng, tên đúng là 3-metylbut-1-in

- Xét B:

            Etyl metyl axetilen: C-C≡C-C-C

            Pent-2-in: C-C≡C-C-C

- Xét C:

            Vinyl axetilen: C≡C-C=C

            Buta-1,3-điin: C≡C-C≡C

- Xét D:

            Đimetyl axetilen: C-C≡C-C

            But-1-in: C≡C-C-C

Đáp án B

Câu 27

nC2H5OH (bđ) = 230/46 = 5 mol → nC2H5OH (pư) = 5.40% = 2 mol.

C2H5OH \(\xrightarrow{{{H}_{2}}S{{O}_{4}}dac,{{170}^{o}}C}\) C2H4 + H2O

→ nC2H4 = nC2H5OH(pư) = 2 mol → mC2H4 = 2.28 = 56 gam.

Đáp án D

Câu 28

Sơ đồ: C2H2 → C2H3Cl → PVC

BTKL: mC2H3Cl = mPVC = 1,2 tấn = 1200 kg.

→ nC2H2(LT) = nC2H3Cl = 1200/62,5 = 19,2 kmol.

→ VC2H2(LT) = 19,2.22,4 = 430,08 m3.

→ VC2H2(TT) = 430,08.(100/80).(100/62,5) = 860,16 m3.

Đáp án A

Câu 29

\(\xrightarrow{BTNT.C}{{n}_{C{{O}_{2}}}}=2{{n}_{{{C}_{2}}{{H}_{2}}}}+2{{n}_{{{C}_{2}}{{H}_{4}}}}+2{{n}_{{{C}_{2}}{{H}_{6}}}}=0,9\left( mol \right)\to {{m}_{C{{O}_{2}}}}=39,6\left( g \right)\)

\(\xrightarrow{BTNT.H}{{n}_{{{H}_{2}}O}}={{n}_{{{C}_{2}}{{H}_{2}}}}+2{{n}_{{{C}_{2}}{{H}_{4}}}}+3{{n}_{{{C}_{2}}{{H}_{6}}}}+{{n}_{{{H}_{2}}}}=1,3\left( mol \right)\to {{m}_{{{H}_{2}}O}}=23,4\left( g \right)\)

Đáp án D

Câu 30

Tên thay thế của anken:

+ Xuất phát từ tên của ankan có cùng mạch cacbon bằng cách đổi đuôi -an thành -en. Từ C4H8 trở đi cần thêm số chỉ vị trí nguyên tử cacbon bắt đầu liên kết đôi.

+ Mạch chính là mạch C dài nhất chứa liên kết đôi.

+ Mạch C được đánh từ phía gần liên kết đôi hơn.

 

⟹ Tên gọi là 3-metylpent-2-en.

Đáp án A

Câu 31

Sơ đồ:

CaC2 → C2H2 (X1) → CH≡C-CH=CH2 (X2) → CH2=CH-CH=CH2 (X3) → (-CH2-CH=CH-CH2-)n.

Các PTHH:

              CaC2 + 2H2O → Ca(OH)2 + C2H2

              2C2H2 \(\xrightarrow{CuCl,N{{H}_{4}}Cl,{{t}^{o}}}\) CH≡C-CH=CH2

              CH≡C-CH=CH2 + H2 \(\xrightarrow{P\text{d}/PbC{{O}_{3}},{{t}^{o}}}\) CH2=CH-CH=CH2

              nCH2=CH-CH=CH2 \(\xrightarrow{{{t}^{o}},xt,p}\) (-CH2-CH=CH-CH2-)n

Đáp án B

Câu 32

Trong phòng thí nghiệm khí C2H2 được điều chế bằng các hòa tan đất đèn CaC2 vào nước:

CaC2 + 2H2O → Ca(OH)2 + C2H2

Đáp án B

Câu 33

nhỗn hợp = 3,36/22,4 = 0,15 mol.

Khi cho hỗn hợp gồm C2H6, C2H4 vào dd Br2 thì chỉ có C2H4 phản ứng với Br2.

→ mC2H4 = mbình tăng = 2,8 gam

→ nC2H4 = 2,8/28 = 0,1 mol

→ nC2H6 = 0,15 - 0,1 = 0,05 mol

Vậy số mol etan và etilen lần lượt là 0,05 mol và 0,1 mol.

Đáp án B

Câu 34

Ankan có công thức chung là CnH2n+2 (n ≥ 1)

- A đúng.

- B loại C5H10, C6H12.

- C loại C2H2, C3H4.

- D loại C2H2, C3H4, C4H6, C5H8.

Đáp án A

Câu 35

\(\overset{5}{\mathop{\text{ }C}}\,{{H}_{3}}-\overset{4}{\mathop{\text{ }C}}\,H=\overset{3}{\mathop{\text{ }C}}\,\left( C{{H}_{3}} \right)-\overset{2}{\mathop{\text{ }C}}\,H=\overset{1}{\mathop{\text{ }C}}\,{{H}_{2}}\)

⟹ Tên gọi là 3-metylpenta-1,3-đien.

Đáp án C

Câu 36

Theo đề bài MY = 8.MH2 = 16 g/mol.

BTKL: mX = mY ⟹ 0,35.26 + 0,65.2 = nY.16 ⟹ nY = 0,65 mol.

Ta có ngiảm = nH2 (pư) = nX - nY = (0,35 + 0,65) - 0,65 = 0,35 mol.

nC2H2 (dư) = nAg2C2 = 12/240 = 0,05 mol.

Bảo toàn số mol liên kết π ta có: nπ(X) = nπ (do H2 phá vỡ) + n π (trong C2H2 dư) + nπ (do Br2 phá vỡ)

⇔ 2nC2H2 (bđ) = nH2 (pư) + 2nC2H2(dư) + nBr2 (pư)

⇔ 2.0,35 = 0,35 + 2.0,05 + nBr2 pư

⇔ nBr2 pư = 0,25 mol

Đáp án A

Câu 37

Do khi CaC2 phản ứng với nước sinh ra khí C2H2 có tác dụng kích thích hoa quả mau chín nên người ta thường dùng đất đèn để dấm hoa quả.

Đáp án A

Câu 38

Cao su buna có công thức cấu tạo là (-CH2-CH=CH-CH2-)n.

Đáp án C

Câu 39

Các hiđrocacbon thơm có CTPT C8H10 là:

 

→ 4 đồng phân

Đáp án D

Câu 40

Propin (CH≡C-CH3) có chứa liên kết ba đầu mạch nên phản ứng được với AgNO3/NH3:

PTHH: CH≡C-CH3 + AgNO3 + NH3 → CAg≡C-CH3↓ vàng + NH4NO3

Đáp án D

Loigiaihay.com

Sub đăng ký kênh giúp Ad nhé !


Bình chọn:
4.9 trên 7 phiếu

Các bài liên quan:

Luyện Bài tập trắc nghiệm môn Hóa lớp 11 - Xem ngay

>>KHOÁ NỀN TẢNG LỚP 12 DÀNH CHO 2K4 NĂM 2022 học sớm chiếm lợi thế luyện thi TN THPT & ĐH


Gửi bài