Giải đề thi học kì II (2018 - 2019) trường THPT Nguyễn Chí Thanh Quảng Bình


Đề thi học kì II (2018 - 2019) trường THPT Nguyễn Chí Thanh Quảng Bình có đáp án và lời giải chi tiết

Đề bài

PHẦN I: TRẮC NGHIỆM (3,0 điểm)

Câu 1 : Khí thiên nhiên được dùng làm nhiên liệu và nguyên liệu cho các nhà máy sản xuất điện, sứ, đạm, ancol metylic,... Thành phần chính của khí thiên nhiên là metan. Công thức phân tử của metan là

A. CH4.

B. C2H4.

C. C2H2.

D. C6H6.

Câu 2 : Chất nào sau đây làm mất màu dung dịch brom?

A. Butan.

B. But-1-en.

C. CO2.

D. Metylpropan.

Câu 3 : Chất nào sau đây có đồng phân hình học?

A. CH2=CH-CH=CH2

B. CH3-CH=C(CH3)2

C. CH3-CH=CH-CH=CH2

D. CH2=CH-CH2-CH3

Câu 4 : Trong số các ankin có công thức phân tử C5H8 có mấy chất tác dụng được với dd AgNO3 trong NH3?

A. 1

B. 2

C. 3

D. 4

Câu 5 : Thực hiện thí nghiệm như hình vẽ bên. Kết thúc thí nghiệm, trong bình đựng dung dịch AgNO3 trong NH3 xuất hiện kết tủa màu vàng nhạt. Chất X là

 

A. CaO.                                  B. Al4C3.

C. CaC2.                                 D. Ca.

 

Câu 6 : Đốt cháy hoàn toàn 0,2 mol hỗn hợp X gồm một ankan và một anken, thu được 0,35 mol CO2 và 0,4 mol H2O. Phần trăm số mol của anken trong X là

A. 40%.

B. 75%.

C. 25%.

D. 50%.

Câu 7 : Cho ancol có công thức cấu tạo: CH3-CH(CH3)-CH2-CH2-CH2-OH. Tên nào dưới đây ứng với ancol trên?

A. 2-metylpentan-1-ol

B. 4-metylpentan-1-ol

C. 4-metylpentan-2-ol

D. 3-metylhexan-2-ol

Câu 8 : Cho 3,70 gam một ancol X no, đơn chức, mạch hở tác dụng với Na dư thấy có 0,56 lít khí thoát ra (đktc). Công thức phân tử của X là

A. C2H6O.

B. C3H10O.

C. C4H10O.

D. C4H8O.

Câu 9 : Cho các chất có công thức cấu tạo như sau: HOCH2-CH2OH (X); HOCH2-CH2-CH2OH (Y); HOCH2-CHOH-CH2OH (Z); CH3-CH2-O-CH2-CH3 (R); CH3-CHOH-CH2OH (T). Những chất tác dụng được với Cu(OH)2 tạo thành dung dịch màu xanh lam là

A. X, Y, R, T.

B. X, Z, T.

C. Z, R, T.

D. X, Y, Z, T.

Câu 10 : Khi tách nước từ rượu (ancol) 3-metylbutan-2-ol, sản phẩm chính thu được là

A. 3-metylbut-1-en.

B. 2-metylbut-2-en.

C. 3-metylbut-2-en.

D. 2-metylbut-3-en.

Câu 11 : Ảnh hưởng của nhóm -OH đến gốc C6H5- trong phân tử phenol thể hiện qua phản ứng giữa phenol với

A. dung dịch NaOH.

B. Na kim loại.

C. nước Br2.

D. H2 (Ni, nung nóng).

Câu 12 : Ở điều kiện thích hợp: chất X phản ứng với chất Y tạo ra anđehit axetic; chất X phản ứng với chất Z tạo ra ancol etylic. Các chất X, Y, Z lần lượt là:

A. C2H2, H2O, H2.

B. C2H4, O2, H2O.

C. C2H2, O2, H2O.

D. C2H4, H2O, CO.

PHẦN II: TỰ LUẬN (7,0 điểm)

Câu 1 : (1,0 điểm) Hoàn thành chuỗi phản ứng sau:

Metan \(\xrightarrow{(1)}\)axetilen \(\xrightarrow{(2)}\) etilen \(\xrightarrow{(3)}\) etanol \(\xrightarrow{(4)}\) anđehit axetic.

Câu 14 : (1,5 điểm) Hoàn thành PTHH của các phản ứng sau (viết các sản phẩm chính):

a) CH3-CH(OH)-CH2-CH3 \(\xrightarrow{{{H}_{2}}S{{O}_{4}}, 17{{0}^{0}}\mathrm{C}}\)

b) iso-C3H7OH + CuO \(\xrightarrow{{{\mathrm{t}}^{0}}}\)

c) C6H5OH + Br2

d) CH3-CH2-CH3 + Br2 \\(\xrightarrow[1:1]{askt}\)

e) CH2=C(CH3)-CH3 + HBr →

Câu 15 : (2,0 điểm) Viết công thức cấu tạo các đồng phân ancol C4H10O và gọi tên theo danh pháp thay thế?

Câu 16 : (2,5 điểm) Cho 12,2 gam hỗn hợp X gồm etanol và propan-1-ol tác dụng với Na dư thu được 2,8 lít khí (đktc).

a) Tính thành phần % khối lượng của mỗi chất trong hỗn hợp ban đầu.

b) Cho hỗn hợp X qua ống đựng CuO đun nóng. Viết PTHH của các phản ứng xảy ra.

----- HẾT -----

 

Lời giải chi tiết

ĐÁP ÁN VÀ LỜI GIẢI CHI TIẾT

1.A

2.B

3.C

4.B

5.C

6.B

7.B

8.C

9.B

10.B

11.C

12.B

 

PHẦN I: TRẮC NGHIỆM (3,0 điểm)

Câu 1:

Phương pháp:

Xem lại bài metan

Hướng dẫn giải:

Metan có CTHH là CH4.

Đáp án A

Câu 2:

Phương pháp:

HS ghi nhớ một số chất làm mất màu dung dịch Br2 (đã học):

- Chất chứa liên kết π kém bền (anken, ankin, …)

- Xicloankan có chứa vòng 3 cạnh

- Chất chứa nhóm chức -CHO

Hướng dẫn giải:

But - 1- en có CTCT là CH2=CH-CH2-CH3 có chứa 1 liên kết đôi kém bền nên làm mất màu dung dịch brom.

Đáp án B

Câu 3:

Phương pháp:

Điều kiện để có đồng phân hình học

Chất trên có đồng phân hình học khi A ≠ B và C ≠ D.

Hướng dẫn giải:

Dựa vào điều kiện để có đồng phân hình học suy ra chất có đồng phân hình học là 5CH3-4CH=3CH-2CH=1CH2.

Lưu ý: Liên kết đôi ở vị trí 1 không có đồng phân hình học; liên kết đôi ở vị trí thứ 3 có đồng phân hình học.

Đáp án C

Câu 4:

Phương pháp:

Ankin phản ứng với AgNO3/NH3 khi có nối ba ở cacbon đầu mạch.

Hướng dẫn giải:

Các ankin có CTPT C5H8 tác dụng với AgNO3/NH3 là:

CH≡C-CH2-CH2-CH3

CH≡C-CH(CH3)-CH3

→ 2 CTCT thỏa mãn

Đáp án B

Câu 5:

Phương pháp:

Từ các phương án => Chất X phù hợp với thí nghiệm.

Hướng dẫn giải:

- Phương án A: CaO + H2O → Ca(OH)2

Phản ứng không tạo khí → loại

- Phương án B: Al4C3 + 12H2O → 4Al(OH)3 + 3CH4

CH4 không phản ứng với AgNO3/NH3 → loại

- Phương án C: CaC2 + 2H2O → Ca(OH)2 + C2H2 ;

C2H2 + 2AgNO3 + 2NH3 → Ag2C2↓ vàng + 2NH4NO3

→ Thỏa mãn

- Phương án D: Ca + 2H2O → Ca(OH)2 + H2

Khí H2 không phản ứng với AgNO3/NH3 → loại

Đáp án C

Câu 6:

Phương pháp:

Đốt cháy X:

Anken → nH2O(do anken) - nCO2(do anken) = 0 (1)

Ankan → nH2O(do ankan) - nCO2(do ankan) = nankan (2)

Cộng 2 vế của (1) và (2) => ∑nH2O - ∑nCO2 = nankan

Từ đó tính được số mol ankan => số mol anken

Tính phần trăm số mol của anken

Hướng dẫn giải:

Đốt cháy X:

Anken → nH2O(do anken) - nCO2(do anken) = 0 (1)

Ankan → nH2O(do ankan) - nCO2(do ankan) = nankan (2)

Cộng 2 vế của (1) và (2) => ∑nH2O - ∑nCO2 = nankan = 0,4 - 0,35 = 0,05 mol

=> nanken = nX - nankan = 0,2 - 0,05 = 0,15 mol

=> %nanken = \(\frac{{0,15}}{{0,2}}.100\% \) = 75%

Đáp án B

Câu 7:

Phương pháp:

Danh pháp của ancol:

*Tên thông thường: Ancol + tên gốc hiđrocacbon + ic

*Tên thay thế: Tên hiđrocacbon tương ứng theo mạch chính + số chỉ vị trí nhóm OH + ol

+ Mạch chính được quy định là mạch C dài nhất có chứa nhóm OH

+ Số chỉ vị trí được bắt đầu từ phía gần nhóm OH hơn

Hướng dẫn giải:

Ancol 5CH3-4CH(CH3)-3CH2-2CH2-1CH2-OH có tên là: 4-metylpentan-1-ol.

Đáp án B

Câu 8:

Phương pháp:

Gọi ancol X có CTHH là CnH2n+1OH

2CnH2n+1OH + 2Na → 2CnH2n+1ONa + H2

=> MX = \(\frac{{{m_X}}}{{{n_X}}}\) => n

Hướng dẫn giải:

Gọi ancol X có CTHH là CnH2n+1OH

nH2 = 0,025 mol

2CnH2n+1OH + 2Na → 2CnH2n+1ONa + H2

 0,05                                 ←               0,025 (mol)

\( \to {M_X} = \frac{{{m_X}}}{{{n_X}}} = \frac{{3,7}}{{0,05}} = 74\)

=> 14n + 18 = 74 => n = 4

=> CTPT của X là C4H10O.

Đáp án C

Câu 9:

Phương pháp:

Những chất (đã học) phản ứng với Cu(OH)2 tạo thành dung dịch màu xanh lam:

- Ancol đa chức có các nhóm -OH gắn vào những nguyên tử C cạnh nhau

- Axit cacboxylic

Hướng dẫn giải:

Những chất tác dụng được với Cu(OH)2 tạo thành dung dịch màu xanh lam là:

HOCH2-CH2OH (X)

HOCH2-CHOH-CH2OH (Z)

CH3-CHOH-CH2OH (T)

Đáp án B

Câu 10:

Phương pháp:

Từ tên gọi viết được CTCT của ancol

Quy tắc Zaixep: Khi tách loại dẫn xuất halogen (X) hoặc gốc -OH thì X hoặc gốc -OH sẽ bị tách cùng với nguyên tử hiđro tại nguyên tử cacbon ở liền bên cạnh có bậc cao nhất tạo thành sản phẩm chính.

Hướng dẫn giải:

3-metylbutan-2-ol có CTCT là CH3-CHOH-CH(CH3)-CH3

Quy tắc Zaixep: Khi tách loại dẫn xuất halogen (X) hoặc gốc -OH thì X hoặc gốc -OH sẽ bị tách cùng với nguyên tử hiđro tại nguyên tử cacbon ở liền bên cạnh có bậc cao nhất tạo thành sản phẩm chính.

=> Sản phẩm chính là CH3CH=C(CH3)-CH3, có tên gọi là 2-metylbut-2-en.

Đáp án B

Câu 11:

Phương pháp:

Nhóm -OH ảnh hưởng đến gốc C6H5- khiến cho dễ thế vào vòng benzen của phenol hơn so với benzen C6H6.

Hướng dẫn giải:

- Nhóm -OH ảnh hưởng đến gốc C6H5- khiến phản ứng thế vào vòng benzen của phenol dễ dàng hơn so với benzen C6H6

⟹ Phản ứng thể hiện sự ảnh hưởng này là phản ứng của phenol với Br2

- So sánh phản ứng của phenol và benzen với Br2:

C6H5OH + 3Br2(dd) → C6H2OHBr3 ↓ + 3HBr (không cần xúc tác)

C6H6 + Br2(khan) → C6H5Br + HBr (xúc tác bột sắt)

Đáp án C

Câu 12:

Phương pháp: Dựa vào đáp án chọn ra các chất X, Y, Z thỏa mãn.

Hướng dẫn giải:

A sai vì C2H2 (X) + H2 (Z) không tạo ra C2H5OH

B đúng vì C2H4 + O2 → CH3CHO và C2H4 + H2O \(\xrightarrow{xt\,{{H}^{+}},{{t}^{o}}}\) C2H5OH

C sai vì C2H2 (X) + H2O (Z) → CH3CHO

D sai vì C2H4 (X) + CO (Z) không phản ứng

Đáp án B

PHẦN II: TỰ LUẬN (7,0 điểm)

Câu 1:

Hướng dẫn giải:

(1) 2CH4 \(\xrightarrow{{{1500}^{o}}C,lam\,lanh\,nhanh}\) CH≡CH + 3H2

(2) CH≡CH + H2 \(\xrightarrow{Pd/PbC{{O}_{3}}}\) CH2=CH2

(3) CH2=CH2 + H2O \(\xrightarrow{xt\,{{H}^{+}},{{t}^{o}}}\) CH3CH2OH

(4) CH3CH2OH + CuO \(\xrightarrow{{{t}^{o}}}\) CH3CHO + Cu + H2O

Câu 2:

Hướng dẫn giải:

a) CH3-CH(OH)-CH2-CH3 \(\xrightarrow{{{H}_{2}}S{{O}_{4}}, 17{{0}^{0}}\mathrm{C}}\) CH3-CH=CH-CH3 + H2O

b) CH3CHOHCH3+CuO \(\xrightarrow{{{\mathrm{t}}^{o}}}\) CH3-CO-CH3 + H2O + Cu

c)

 

d) CH3-CH2-CH3 + Br2 \(\xrightarrow[1:1]{askt}\) CH3-CHBr-CH3 + HBr

e) CH2=C(CH3)-CH3 + HBr → CH3-CBr(CH3)-CH3

Câu 3:

Phương pháp:

- Ancol có các loại đồng phân:

+ Đồng phân mạch cacbon

+ Đồng phân vị trí nhóm OH

- Cách đọc tên ancol:

*Tên thông thường: Ancol + tên gốc hiđrocacbon + ic

*Tên thay thế: Tên hiđrocacbon tương ứng theo mạch chính + số chỉ vị trí nhóm OH + ol

+ Mạch chính được quy định là mạch C dài nhất có chứa nhóm OH

+ Số chỉ vị trí được bắt đầu từ phía gần nhóm OH hơn

Hướng dẫn giải:

Các đồng phân ancol có CTPT C4H10O là:

CH3-CH2-CH2-CH2-OH: Butan-1-ol

CH3-CHOH-CH2-CH3: Butan-2-ol

CH3-CH(CH3)-CH2-OH: 2-metylpropan-1-ol

CH3-C(OH)(CH3)-CH3: 2-metylpropan-2-ol

Câu 4:

Phương pháp:

a)

Đặt nC2H5OH = x mol và nC3H7OH = y mol

=> phương trình khối lượng hỗn hợp X (1)

Khi cho X tác dụng với Na thì:

2C2H5OH + 2Na → 2C2H5ONa + H2

2C3H7OH + 2Na → 2C3H7ONa + H2

=> phương trình về số mol H2 (2)

Giải hệ phương trình (1) (2) thu được giá trị của x, y

Tính phần trăm khối lượng của các ancol trong X

b) Xem lại ancol bậc 1 tác dụng với CuO → anđehit + Cu + H2O

Hướng dẫn giải:

a)

Đặt nC2H5OH = x mol và nC3H7OH = y mol

Ta có mX = 46x + 60y = 12,2 (1)

Khi cho X tác dụng với Na thì:

2C2H5OH + 2Na → 2C2H5ONa + H2

x            →                               0,5x (mol)

2C3H7OH + 2Na → 2C3H7ONa + H2

y           →                                0,5y (mol)

=> nH2 = 0,5x + 0,5y = 0,125 (2)

Giải (1) (2) có x = 0,2 mol và y = 0,05 mol

Thành phần % khối lượng các chất trong hỗn hợp ban đầu là

\(\% {m_{{C_2}{H_5}OH}} = \frac{{0,2.46}}{{12,2}}.100\%  = 75,41\% \)

\(\% {m_{{C_3}{H_7}OH}} = 100\%  - 75,41\%  = 24,59\% \)

b)

PTHH:

CH3CH2OH + CuO \(\xrightarrow{{{t}^{o}}}\) CH3CHO + H2O + Cu

CH3CH2CH2OH + CuO \(\xrightarrow{{{t}^{o}}}\) CH3CH2CHO + Cu + H2O

Loigiaihay.com

 

Sub đăng ký kênh giúp Ad nhé !


Bình chọn:
4.9 trên 7 phiếu

Các bài liên quan:

Luyện Bài tập trắc nghiệm môn Hóa lớp 11 - Xem ngay

>>KHOÁ NỀN TẢNG LỚP 12 DÀNH CHO 2K4 NĂM 2022 học sớm chiếm lợi thế luyện thi TN THPT & ĐH


Gửi bài