Đề số 4 - Đề kiểm tra học kì 2 - Hóa học 11


Đáp án và lời giải chi tiết Đề số 4 - Đề kiểm tra học kì 2 (Đề thi học kì 2) - Hóa học 11

Đề bài

Câu 1 : Cho các chất sau: CH3CH2CHO (1), CH2=CH-CHO (2), CH≡C-CHO (3); CH2=CH-CH2-CHO (4);  (CH3)2CHOH (5). Những chất phản ứng hoàn toàn với lượng dư H2 (Ni, to) cùng tạo ra một sản phẩm là

A. (1), (2), (4), (5).

B. (1), (2), (3), (4).

C. (1), (2), (3).

D. (2), (3), (4), (5).

Câu 2 : Chất nào tác dụng với CuO ở nhiệt độ cao tạo ra xeton?

A. 2-metylpropan-2-ol

B. Butan-1-ol

C. Butan-2-ol

D. 2-metyl propan-1-ol

Câu 3:  Đốt cháy axit A được số mol CO2 bằng số mol H2O. A là

A. axit no, mạch hở, đơn chức.

B. axit đơn chức, no, mạch vòng.

C. axit no 2 chức, mạch hở.

D. axit đơn chức, có một nối đôi, mạch hở.

Câu 4 : Cho các chất sau: methanol,  glixerol, phenol, etanal.  Số chất vừa tác dụng với Na vừa tác dụng với NaOH là

A. 1                                         B. 3

C. 4                                         D. 2

Câu 5 : Dãy gồm các chất được sắp xếp theo chiều tăng dần nhiệt độ sôi từ trái qua phải là ?

A. CH3CHO, CH3COOH, C2H5OH

B. CH3CHO, C2H5OH, CH3COOH

C. C2H5OH, CH3COOH, CH3CHO

D. CH3COOH,  C2H5OH,  CH3CHO

Câu 6: Phát biếu đúng

A. Anđehit vừa có tính khử vừa có tính oxi hóa.

B. Anđehit tác dụng với H2 (xúc tác Ni) luôn tạo ra ancol bậc nhất.

C. Axit chưa no khi cháy luôn cho số mol CO2 lớn hơn số mol H2O.

D. Tất cả đều đúng.

Câu 7 : Số đồng phân ancol bậc 1 ứng với CTPT C5H12O là

A. 8                                         B. 5

C. 6                                         D. 4

Câu 8 :  Dãy gồm các chất đều phản ứng với axit fomic là

A. Dung dịch NH3, dung dịch NaHCO3, Cu, CH3OH

B. Dung dịch AgNO3/NH3, dung dịch Na2CO3, Fe, C6H5OH

C. Mg, dung dịch NaOH, CH3OH, dung dịch AgNO3/NH3

D. Na, dung dịch Na2CO3, CH3OH, dung dịch Na2SO4

Câu 9 : Cho 0,04 mol hỗn hợp X gồm CH2=CH-COOH, CH3COOH và CH2=CH-CHO phản ứng vừa đủ với dung dịch chứa 6,4 gam brom. Mặt khác để trung hòa 0,04 mol X cần vừa đủ 40 ml dung dịch NaOH 0,75M. Khối lượng của CH2=CH-COOH trong X là

A. 0,72 gam                            B. 1,44 gam

C. 2,88 gam                            D. 0,56 gam

Câu 10 : Dãy gồm các chất có thể điều chế trực tiếp (bằng một phản ứng) tạo ra axit axetic là

A. CH3CHO, C2H5OH, C2H5COOCH3

B. CH3CHO, C6H12O6 (glucozơ), CH3OH

C. C2H4(OH)2, CH3OH, CH3CHO

D. CH3OH, C2H5OH, CH3CHO

Câu 11 : X là một ancol no, mạch hở. Đốt cháy hoàn toàn 0,05 mol X cần 5,6 gam O2, thu được hơi nước và 6,6 gam CO2. Công thức của X là

A. C3H6(OH)2                         B. C3H5(OH)3

C. C3H7OH                             D. C2H4(OH)2

Câu 12 : Cho 1,97 gam dung dịch fomalin tác dụng với dung dịch AgNO3/NH3 dư thu được 10,8 gam Ag. Nồng độ % của anđehit fomic trong fomalin là

A. 38,07%                              B. 50%

C. 40%                                   D. 49%

Câu 13 : Cho 2,46 gam hỗn hợp gồm HCOOH, CH3COOH, C6H5OH tác dụng vừa đủ với 400 ml dung dịch NaOH 1M. Tổng khối lượng muối thu được sau phản ứng là

A. 11,26 gam                          B.5,32 gam

C. 4,46 gam                            D. 3,54 gam

Câu 14 : Cho axit sau CH3CH(C2H5)CH2CH(CH3)COOH có tên quốc tế là

A. Axit 2,4-đimetyl  hexanoic

B. Axit 4-etyl-2-metyl pentanoic

C. Axit 3,5-đimetyl hexanoic

D. Axit 2-etyl-4-metyl pentanoic

Câu 15 : Khi đun nóng butan-2-ol với H2SO4 đặc ở 170oC thì nhận được sản phẩm chính là

A. But-1- en                           B. Điety ete

C. Đibutyl ete                        D. But-2-en

B. Phần tự luận:

Câu 1 : Viết phương  trình hóa học dưới dạng CTCT thu gọn để hoàn thành dãy chuyển hóa (ghi rõ điều kiện phản ứng):

Câu 2 : Cho 13,4 gam hỗn hợp X gồm hai axit no, đơn chức, mạch hở, kế tiếp nhau trong cùng dãy đồng đẳng tác dụng với Mg thu được 2,24 lít khí H2 (đktc)

a) Tìm CTPT của hai axit trong hỗn hợp X

b) Tính % khối lượng của mỗi axit trong hỗn hợp X

Câu 3 : Cho m gam hỗn hợp X gồm hai rượu (ancol) đơn chức, bậc 1, kế tiếp nhau trong dãy đồng đẳng tác dụng với CuO dư, nung nóng thu được hỗn hợp hơi Y gồm nước và anđehit. Tỉ khối hơi của Y so với H2 là 13,75. Cho toàn bộ Y phản ứng với một lượng dư AgNO3 trong NH3 đun nóng, sinh ra 64,8 gam Ag. Tìm giá trị của m?

Lời giải chi tiết

Câu 1:

Phương pháp:

- Các chất chứa liên kết bội sẽ cộng H2 đến no.

- Các anđehit cộng vào nhóm CHO tạo thành ancol tương ứng.

Hướng dẫn giải:

Khi cho các chất trên phản ứng với lượng dư H2 (Ni, to)  thì:

(1) CH3CH2CHO + H2 \(\xrightarrow{{{t}^{o}},xt\,Ni}\) CH3CH2CH2OH

(2) CH2=CH-CHO + 2H2 \(\xrightarrow{{{t}^{o}},xt\,Ni}\) CH3CH2CH2OH

(3) CH≡C-CHO + 3H2 \(\xrightarrow{{{t}^{o}},xt\,Ni}\) CH3CH2CH2OH

(4) CH2=CH-CH2-CHO + 2H2 \(\xrightarrow{{{t}^{o}},xt\,Ni}\) CH3CH2CH2CH2OH

(5) (CH3)2CHOH không phản ứng với H2

→ Các chất (1), (2) và (3) tạo cùng một sản phầm CH3CH2CH2OH

Đáp án C

Câu 2:

Phương pháp: Xeton được tạo từ phản ứng ancol bậc 2 với CuO ở nhiệt độ cao.

(Bậc ancol là bậc của nguyên tử C mà nhóm -OH đó gắn vào).

Hướng dẫn giải:

Xeton được tạo từ phản ứng ancol bậc 2 với CuO ở nhiệt độ cao.

(Bậc ancol là bậc của nguyên tử C mà nhóm -OH đó gắn vào)

A là ancol bậc 3 nên không phản ứng với CuO

B là ancol bậc 1 nên phản ứng tạo anđehit

C là ancol bậc 2:

CH3-CHOH-CH2-CH3  + CuO \(\xrightarrow{{{t}^{o}}}\) CH3-CO-CH2-CH3 + H2O + Cu

D là ancol bậc 1 nên phản ứng tạo anđehit

Đáp án C

Câu 3:

Hướng dẫn giải: Axit đốt cháy thu được số mol CO2 bằng số mol H2O chỉ có thể là no, đơn chức, mạch hở.

Đáp án A

Câu 4:

Phương pháp: Chất tác dụng với Na và NaOH cần có nhóm OH liên kết với vòng thơm hoặc có nhóm COOH.

Hướng dẫn giải:

Metanol (CH3OH) chỉ phản ứng với Na

Glixerol (C3H5(OH)3) chỉ phản ứng với Na

Phenol (C6H5OH) phản ứng với cả Na và NaOH

Etanal (CH3CHO) không phản ứng với cả 2

Vậy chỉ có 1 chất vừa phản ứng với NaOH và Na.

Đáp án A

Câu 5:

Phương pháp: So sánh nhiệt độ sôi các chất có liên kết cộng hóa trị:

- Các yếu tố ảnh hướng tới nhiệt độ sôi:

(1) Liên kết H (Các chất có lực liên kết hidro càng lớn thì nhiệt độ sôi càng lớn)

VD: -COOH > -OH > -COO- > -CHO > -CO-)

(2) Khối lượng phân tử (Các chất có phân tử khối càng lớn thì nhiệt độ sôi càng cao)

(3) Hình dạng phân tử (Phân tử càng phân nhánh thì nhiệt độ sôi càng thấp)

Hướng dẫn giải: Các chất có nhiệt độ sôi tăng dần là CH3CHO, C2H5OH, CH3COOH.

Đáp án B

Câu 6:

Hướng dẫn giải:

A đúng

B đúng vì RCHO + H2 → RCH2OH (ancol bậc 1)

C đúng vì đốt axit không no luôn tạo ra số mol CO2 > H2O

→ D đúng

Đáp án D

Câu 7:

Phương pháp: Ancol bậc 1 là ancol có nhóm OH đính với C bậc 1.

Hướng dẫn giải:

Các công thức đồng phân ancol bậc 1 là

CH3-CH2-CH2-CH2-CH2-OH

CH3-CH(CH3)-CH2-CH2-OH

CH3-CH2-CH(CH3)-CH2-OH

CH3-C(CH3)2-CH2-OH

→ Có 4 công thức đồng phân ancol bậc 1

Đáp án D

Câu 8:

Hướng dẫn giải:

A có Cu không phản ứng với axit fomic

B có C6H5OH không phản ứng với axit fomic

C có tất cả các chất phản ứng với axit fomic

D có dung dịch Na2SO4 không phản ứng với axit fomic

Đáp án C

Câu 9:

Phương pháp:

Đặt số mol của CH2=CH-COOH, CH3COOH và CH2=CH-CHO lần lượt là x, y và z mol → x + y + z (1)

CH2=CH-COOH + Br2 → CH2Br-CHBr-COOH

CH2=CH-CHO + 2Br2 + H2O → CH2Br-CHBr-COOH + 2HBr  → nBr2 (2)

X + NaOH: CH2=CH-COOH + NaOH → CH2=CH-COONa + H2O

CH3COOH + NaOH → CH3COONa + H2O → nNaOH  (3)

Giải (1)(2)(3) có x ; y; z

Hướng dẫn giải:

Đặt số mol của CH2=CH-COOH, CH3COOH và CH2=CH-CHO lần lượt là x, y và z mol

→ x + y + z = 0,04 mol (1)

*X tác dụng với Br2:

CH2=CH-COOH + Br2 → CH2Br-CHBr-COOH

CH2=CH-CHO + 2Br2 + H2O → CH2Br-CHBr-COOH + 2HBr

→ nBr2 = 0,04 = x + 2z (2)

*X tác dụng NaOH:

CH2=CH-COOH + NaOH → CH2=CH-COONa + H2O

CH3COOH + NaOH → CH3COONa + H2O

→ nNaOH = 0,04.0,75 = x + y = 0,03 (3)

Giải (1)(2)(3) có x = 0,02 mol; y = z = 0,01 mol

→ mCH2=CH-COOH = 0,02.72 = 1,44 gam

Đáp án B

Câu 10:

Phương pháp: Xem lại các phản ứng điều chế CH3COOH

CH3COOH thường được điều chế từ este của axit axetic, muối axetat, C2H5OH, CH3CHO, CH3OH

Hướng dẫn giải:

- A có C2H5COOCH3 không trực tiếp tạo ra CH3COOH

- B có C6H12O6 (glucozơ) không trực tiếp tạo ra CH3COOH

- C có C2H4(OH)2 không trực tiếp tạo ra CH3COOH

- D đúng vì:

CH3OH + CO \(\xrightarrow{{{t}^{o}},xt}\) CH3COOH

2CH3CHO + O2 \(\xrightarrow{{{t}^{o}}}\) 2CH3COOH

C2H5OH + O2 \(\xrightarrow{men\,giam}\) CH3COOH + H2O

Đáp án D

Câu 11:

Phương pháp:

X có CTPT là CnH2n+2Om

CnH2n+2Om → nCO2 + (n+1)H2O

Ta có nH2O = nCO2 + nX

Bảo toàn O có nO(X) → số nguyên tử O trong X là m = nO(X) : nX

Số nguyên tử C trong X là n = nCO2 : nX

Hướng dẫn giải:

nCO2 = 0,15 mol và nO2 = 0,175 mol

X có CTPT là CnH2n+2Om

CnH2n+2Om → nCO2 + (n+1)H2O

Ta có: nH2O = nCO2 + nX = 0,15 + 0,05 = 0,2 mol

Bảo toàn O có:

nO(X) = 2nCO2 + nH2O - 2nO2

= 2.0,15 + 0,2 - 2.0,175 = 0,15 mol

→ Số O = nO(X) : nX = 0,15 : 0,05 = 3

     Số C = nCO2 : nX = 0,15 : 0,05 = 3

→ X là C3H8O3 hay C3H5(OH)3

Đáp án B

Câu 12:

Phương pháp:

HCHO + 4AgNO3 + 6NH3 + 2H2O → 4NH4NO3 + 4Ag + (NH4)2CO3

C%[HCHO] = mHCHO :mdung dịch .100%

Hướng dẫn giải:

HCHO + 4AgNO3 + 6NH3 + 2H2O → 4NH4NO3 + 4Ag + (NH4)2CO3

  0,025 ←                                                             0,1 

→ mHCHO = 0,025.30 = 0,75 gam

→ C%[HCHO] = 0,75 : 1,97 .100% = 38,07%

Đáp án A

Câu 13:

Phương pháp:

HCOOH + NaOH → HCOONa + H2O

CH3COOH + NaOH → CH3COONa + H2O

C6H5OH + NaOH → C6H5ONa + H2O

Theo PTHH thì nH2O = nNaOH

Bảo toàn khối lượng có

mmuối = mhỗn hợp + mNaOH - mH2O

Hướng dẫn giải:

Đặt số mol của HCOOH, CH3COOH, C6H5OH lần lượt là x, y và z mol thì 46x + 60y + 94z = 2,46 g (1)

HCOOH + NaOH → HCOONa + H2O

CH3COOH + NaOH → CH3COONa + H2O

C6H5OH + NaOH → C6H5ONa + H2O

Theo PTHH thì nH2O = nNaOH = 0,4 mol

Bảo toàn khối lượng có:

mmuối = mhỗn hợp + mNaOH - mH2O

= 2,46 + 0,4.40 - 0,4.18 = 11,26 gam

Đáp án A

Câu 14:

Phương pháp:

Cách đọc tên thay thế của axit cacboxylic no, đơn chức, mạch hở:

Tên thay thế = Axit + tên hiđrocacbon no tương ứng với mạch chính + oic

Chú ý: Mạch chính là mạch C dài nhất có chứa nhóm COOH, được đánh số từ nhóm COOH

Hướng dẫn giải:

CTCT khai triển là:

→ Tên gọi là: Axit 2,4-đimetyl hexanoic.

Đáp án A

Câu 15:

Phương pháp:

Khi đun nóng ancol (trừ CH3OH) với H2SO4 đặc ở 170oC xảy ra phản ứng tách nước trong đó ưu tiên tách OH cùng với nguyên tử H của C bên cạnh có bậc cao hơn.

Hướng dẫn giải:

CH3-CHOH-CH2-CH3 \(\xrightarrow{{{H}_{2}}S{{O}_{4}}\,dac,\,nong}\) CH3-CH=CH-CH3 (spc)+ H2O

                                                      Hoặc CH2=CH-CH2-CH3(spp) + H2O

Vậy sản phẩm chính là CH3-CH=CH-CH3 có tên gọi là but-2-en.

Đáp án D

B. Phần tự luận: (5,5 điểm)

Câu 1:

Hướng dẫn giải:

(1) C2H5OH + CuO \(\xrightarrow{{{t}^{o}}}\) CH3CHO + Cu + H2O

(2) CH3CHO + 2AgNO3 + 3NH3 + H2O \(\xrightarrow{{{t}^{o}}}\) CH3COONH4 + 2NH4NO3 + 2Ag

(3) CH3COONH4 + NaOH → CH3COONa + NH3 + H2O

(4) CH3COONa + HCl → NaCl + CH3COOH

Câu 2:

Phương pháp:

a) Gọi CTTB của 2 axit trong X là CnH2n+1COOH thì ta có

2CnH2n+1COOH  + Mg → (CnH2n+1COO)2Mg + H2

Từ mol H2 tính được nX → MX = 14n + 46 → giá trị của n

Dựa vào dữ kiện 2 axit no, mạch hở, đơn chức đồng đẳng kế tiếp → CTPT của 2 axit.

b) Đặt số mol của CH3COOH và C2H5COOH là x và y mol

Từ khối lượng → phương trình khối lượng (1)

Từ tổng mol của X → phương trình số mol (2)

Giải (1) (2) được x; y

Hướng dẫn giải:

a) nH2 = 0,1 mol

Gọi CTTB của 2 axit trong X là CnH2n+1COOH thì ta có

2CnH2n+1COOH  + Mg → (CnH2n+1COO)2Mg + H2

0,2      ←                                                              0,1 (mol)

→ MX = 13,4 : 0,2 = 67 = 14n + 46 → n = 1,5

Vì X tạo bởi 2 axit no, mạch hở, đơn chức đồng đẳng kế tiếp nên 2 axit này là CH3COOH và C2H5COOH

b)

Đặt số mol của CH3COOH và C2H5COOH là x và y mol

+) mX = 60x + 74y = 13,4 (1)

+) nX = x + y = 0,2 mol (2)

Giải (1) (2) có x = y = 0,1 mol

 % khối lượng của mỗi axit trong hỗn hợp X là

%mCH3COOH = (0,1.60 : 13,4) . 100% = 44,78%

%mC2H5COOH = 100% - 44,78% = 55,22%

Câu 3:

Hướng dẫn giải:

nAg = 64,8/108 = 0,6 mol

Đặt công thức chung của ancol là RCH2OH

- Khi oxi hóa ancol bằng CuO:

RCH2OH + CuO \(\xrightarrow{{{t}^{o}}}\) RCHO + Cu + H2O

Ta thấy số mol anđehit thu được luôn bằng số mol H2O nên ta có:

\({{M}_{Y}}=\frac{{{M}_{RCHO}}+{{M}_{{{H}_{2}}O}}}{2}\Rightarrow \frac{R+29+18}{2}=13,75.2\to 1\,(H-)<\,\,R=8\,\,<15\,(C{{H}_{3}}-)\)

→ Anđehit chứa HCHO (a mol) và CH3CHO (b mol)

- Khi anđehit thực hiện tráng gương:

HCHO + 4AgNO3 + 6NH3 + 2H2O → 4NH4NO3 + 4Ag + (NH4)2CO3

CH3CHO + 2AgNO3 + 3NH3 + H2O \(\xrightarrow{{{t}^{o}}}\) CH3COONH4 + 2Ag + 2NH4NO3

Ta có hệ phương trình:

- Oxi hóa hỗn hợp CH3OH, C2H5OH bằng CuO:

CH3OH + CuO \(\xrightarrow{{{t}^{o}}}\) HCHO + Cu + H2O

0,1 ←                               0,1

CH3CH2OH + CuO \(\xrightarrow{{{t}^{o}}}\) CH3CHO + Cu + H2O

0,1 →                                         0,1

Vậy hỗn hợp ancol ban đầu có chứa: 0,1 mol CH3OH và 0,1 mol CH3CH2OH

→ m = 0,1.32 + 0,1.46 = 7,8 gam


Bình chọn:
4.9 trên 7 phiếu

Luyện Bài tập trắc nghiệm môn Hóa lớp 11 - Xem ngay

>>Học trực tuyến Lớp 11 trên Tuyensinh247.com, mọi lúc, mọi nơi tất cả các môn. Các thầy cô giỏi nổi tiếng, dạy hay dễ hiểu


Gửi bài