Giải đề thi học kì 1 hoá lớp 12 năm 2019 - 2020 sở giáo dục Hà Nam


Giải chi tiết đề thi học kì 1 môn hoá lớp 12 năm 2019 - 2020 sở giáo dục Hà Nam với cách giải nhanh và chú ý quan trọng

Đề bài

Câu 1: Saccarozo, tinh bột và xenlulozo đều tham gia vào

A. Phản ứng tráng bạc

B. Phản ứng thủy phân

C. Phản ứng với Cu(OH)2

D. Phản ứng với I2 tạo màu xanh

Câu 2: Chất X có công thức phân tử C3H6O2 là este của axit axetic. Công thức cấu tạo thu gọn của X là

A. CH3COOCH3

B. HO-C2H4-CHO

C. C2H5COOH

D. HCOOC2H5

Câu 3: Cho các chất sau: triolein (I), tripanmitin (II), tristearin (III). Nhiệt độ nóng chảy của chất được sắp xếp theo chiều tăng dần là

A. (II), (III), (I)

B. (III), (II), (I)

C. (I), (II), (III)

D. (II), (I), (III)

Câu 4: Este A điều chế từ ancol metylic có tỉ khối so với oxi là 2,3125. Công thức của A là

A. CH3COOC2H5

B. CH3COOCH3

C. C2H5COOC2H5

D. C2H5COOCH3

Câu 5: Cho dãy các chất: phenyl axetat, anlyl axetat, metyl axetat, etyl format, tripanmitin. Số chất trong dãy khi thủy phân trong môi trường NaOH dư, đun nóng sinh ra ancol là

A. 2

B. 4

C. 5

D. 3

Câu 6: Cho các chất: CH2=CHCl; CH2=CH2; CH2=CH-CH=CH2; H2NCH2COOH. Số chất trong dãy có khả năng tham gia phản ứng trùng hợp là

A. 3

B. 2

C. 4

D. 1

Câu 7: Điểm giống nhau của glucozo và saccarozo là

A. Đều phản ứng với H2 có xúc tác Ni nung nóng cùng thu được 1 ancol đơn chức

B. Đều phản ứng với AgNO3/NH3 tạo Ag

C. Đều bị thủy phân trong môi trường axit

D. Đều phản ứng với Cu(OH)2 tạo dung dịch màu xanh lam

Câu 8: Cho glixerol tác dụng với axit axetic (xúc tác H2SO4 đậm đặc). Số chất chứa chức este tối đa được tạo ra là

A. 2

B. 5

C. 3

D. 4

Câu 9: Đun glixerol với hỗn hợp các axit stearic, oleic, panmitic (có xúc tác H2SO4 đặc xúc tác) có thể thu được bao nhiêu loại trieste (chỉ tính đồng phân cấu tạo)

A. 17

B. 15

C. 18

D. 16

Câu 10: Tơ nào sau đây thuộc loại tơ bán tổng hợp (tơ nhân tạo)

A. Tơ tằm

B. Bông

C. Tơ visco

D. Tơ nilon-6,6

Câu 11: Số đipeptit mạch hở tối đa có thể tạo ra từ mọt hỗn hợp gồm 3 a – aminoaxit: Glyxin, alanin và valin là

A. 12

B. 9

C. 4

D. 6

Câu 12: Hợp chất hữu cơ X có công thức phân tử là C3H6O2, chất X vừa có phản ứng tráng bạc vừa tác dụng với NaOH. Công thức cấu tạo thu gọn của X là

A. CH3CH2COOH

B. CH2(OH)CH2CHO

C. HCOOC2H5

D. CH3COOCH3

Câu 13: Công thức chung của este tạo bởi ancol no, đơn chức mạch hở và axit cacboxylic không no, có một liên kết đôi C=C, đơn chức mạch hở là

A. CnH 2n-2O2

B. CnH2nO2

C. CnH2n+2O2

D. CnH2n+1 O2

Câu 14: Có bao nhiêu đồng phân mạch hở có công thức phân tử C4H8O2 tác dụng với NaOH nhưng không tác dụng với Na?

A. 1

B. 4

C. 3

D. 2

Câu 15: Đun nóng CH3COOC6H5 (phenyl axetat) với lượng dư dung dịch NaOH thu được sản phẩm hữu cơ là?

A. CH3OH và C6H5ONa

B. CH3COOH và C6H5ONa

C. CH3COOH và C6H5OH

D. CH3COONa và C6H5ONa

Câu 16: Polime nào sau đây được tổng hợp bằng phản ứng trùng ngưng?

A. Poliacrilonitrin

B. Polistiren

C. Poli (metyl metacrylat)

D. Poli (etylen terephtalat)

Câu 17: Phân tích định lượng este X người ta thu được kết quả %C = 40%; %H = 6,66%. Este X có tên gọi là?

A. Metyl format

B. Metyl acrylat

C. Etyl propionat

D. Metyl axetat

Câu 18: Cho CH3COOCH3 vào dung dịch NaOH đun nóng sinh ra các sản phẩm là

A. CH3OH và CH3COOH

B. CH3COOH và CH3ONa

C. CH3COONa và CH3COOH

D. CH3COONa và CH3OH

Câu 19: Triolein không tác dụng với chất (hoặc dung dịch) nào sau đây?

A. Cu(OH)2 (ở điều kiện thường)

B. Dung dịch NaOH (đun nóng)

C. H2O (xúc tác H2SO4 loãng, đun nóng)

D. H2 (xúc tác Ni đun nóng)

Câu 20: Hỗn hợp M goofmm 2 este X, Y là đồng đẳng của nhau. Khi cho 1 mol hỗn hợp M (với tỉ lệ số mol bất kì) tác dụng vừa đủ với NaOH dư đều thu được tổng khối lượng ancol như nhau. Cặp công thức cấu tạo đúng của X, Y lần lượt là

A. CH2=CH-COOCH3 và CH3-CH2-COOCH3

B. HCOOC2H5 và CH3COOC2H5

C. HCOO-CH2-CH2-CH3 và HCOO-CH(CH3)2

D. CH3-COOC2H5 và CH3-CH2-COOCH3

Câu 21: Thủy phân este X mạch hở có công thức phân tử C4H6O2 sản phẩm có khả năng tham gia phản ứng tráng bạc. Số este X thỏa mãn tính chất trên là

A. 3

B. 4

C. 6

D. 5

Câu 22: Hợp chất X có công thức phân tử là C5H8O2 khi tham gia phản ứng xà phòng hóa thu được 1 andehit và 1 muối chứa axit cacboxylic. Số chất thỏa mãn tính chất trên của X là

A. 4

B. 3

C. 6

D. 5

Câu 23: Cho các chất hữu cơ: CH3CH(CH3)NH2 (X) và CH3CH(NH2)COOH (Y)

Tên thay thế của X, Y lần lượt là

A. propan-1-amin và axit 2-aminopropanoic

B. propan-1-amin và axit aminoetanoic

C. propan-2-amin và axit aminoetanoic

D. propan-2-amin và axit 2-aminopropanoic

Câu 24: Thủy phân C2H5COOCH=CH2 trong môi trường axit tạo thành các sản phẩm bền là

A. C2H5COOH, HCHO

B. C2H5COOH, CH2=CH-OH

C. C2H5COOH, CH3CHO

D. C2H5COOH, C2H5OH

Câu 25: Trong số các este mạch hở có cùng CTPT C4H6O2

HCOO-CH=CH-CH2 (1)

HCOO-CH2-CH=CH2 (2)

HCOO-C(CH3)=CH2 (3)

CH3COOCH=CH2 (4)

CH2=CH-COO-CH3 (5)

Các este có thể điều chế trực tiếp từ axit và ancol là

A. (2) và (4)

B. (2) và (5)

C. (1) và (3)

D. (3) và (4)

Câu 26: Cho một dipeptit Y có công thức phân tử là C6H12N2O3. Số đồng phân peptit của Y mạch hở là

A. 5

B. 6

C. 7

D. 4

Câu 27: Cho một số tính chất: Amilopectin là một thành phần của tinh bột có cấu trúc polime dạng mạch phân nhánh (1); tan trong nước lạnh (2); tạo với dung dịch I2 màu xanh (3); tạo dung dịch keo khi đun nóng với nước (4); phản ứng với dung dịch H2SO4 loãng (5); tham gia phản ứng tráng bạc (6). Các tính chất của tinh bột là

A. 1,3,4,5

B. 3,4,5,6

C. 1,2,3,4

D. 1,3,4,6

Câu 28: Phát biểu nào sau đây không đúng?

A. Anilin không làm đổi màu quì tím ẩm

B. Anilin là bazo yếu hơn NH3, ảnh hưởng hút electron của nhân thơm lên nhóm NH3

C. Anilin tác dụng được với HBr vì trên N còn dư đôi elctron tự do

D. nhờ có tính bazo, anilin tác dụng được với dung dịch Br2 tạo kết tủa trắng

Câu 29: Các chất X, Y, Z là ba axit cacboxylic đơn chức cùng dãy đồng đẳng (MX < MY < MZ), T là este tạo bởi X, Y, Z với một ancol no, ba chức mạch hở E. Đốt cháy hoàn toàn 26,6 gam hỗn hợp M gồm X, Y, Z, T (trong đó Y và Z có cùng số mol) bằng lượng vừa đủ khí O2, thu được 22,4 lít CO2 và 16,2 gam H2O. Mặt khác đun nóng 26,6 gam M với lượng dư dung dịch AgNO3/NH3. Sau khi các phản ứng xảy ra hoàn toàn, thu được 21,6 gam Ag. Mặt khác cho 13,3 gam M phản ứng hết với 400ml dung dịch NaOH 1M và đun nóng thu được dung dịch N. Cô cạn dung dịch N thu được m gam chất rắn khan. Gía trị của m gần nhất là

A. 38,04

B. 25,01

C. 16,74

D. 24,74

Câu 30: Dãy tất cả các chất đều có khả năng tham gia phản ứng trùng hợp là?

A. 1,2-diclopropan; vinylaxetilen; vinylbenzen; toluen

B. buta-1,3-dien; cumen; etilen; tranbut-2-en

C. 1,1,2,2-tetrafloeten; propilen; stiren; vinylclorua

D. Stiren, clobenzen, isopren, but-1-en

Câu 31: Hỗn hợp X gồm 2 este mạch hở X1 và X2 (MX1 < MX2) đều tạo từ ancol Y và hai axit cacboxylic đơn chức kế tiếp nhau trong dãy đồng đẳng. Hỗn hợp X không tác dụng với Na. Cho m gam hỗn hợp X tác dụng với 600 ml dung dịch NaOH 1M. Cô cạn dung dịch sau phản ứng thu được chất rắn Z và 12,4 gam hơi của ancol Y. Nung chất rắn Z trong bình chứa oxi dư, sau phản ứng hoàn toàn thu được Na2CO3, H2O và 4,48 lít khí CO2. Mặt khác, oxi hóa 12,4 gam Y bằng CuO dư đun nóng thu được chất hữu cơ E (chỉ chứa 1 loại nhóm chức). Cho toàn bộ E tác dụng với lượng dư AgNO3/NH3 thu được 86,4 gam Ag. Thành phần % theo khối lượng của X1 trong hỗn hợp X là

A. 52,8%

B. 40,0%

C. 60,0%

D. 47,2%

Câu 32: Cho các phát biểu sau:

(a) Peptit Gly – Ala có phản ứng màu biure

(b) Trong phân tử dipeptit mạch hở có 2 liên kết peptit

(c) Có thể tạo ra tối đa 4 dipeptit từ hỗn hợp amino axit Gly, Ala

(d) Dung dịch Glyxin làm đổi màu quỳ tím

Số phát biểu đúng là

A. 3

B. 4

C. 1

D. 2

Câu 33: Cho hỗn hợp E chứa 4 chất hữu cơ mạch hở gồm peptit X (cấu tạo từ 2 amino axit có dạng H2NCmH2mCOOH) este Y (CnH2n-12O6) và 2 axit không no Z, T (Y, Z, T có cùng số mol). Đun nóng 24,64 gam hỗn hợp E với dung dịch 0,35 mol KOH, cô cạn dung dịch sau phản ứng thu được glixerol và a gam hỗn hợp rắn M chỉ chứa 4 muối. Mặt khác, đốt cháy hoàn toàn 24,64 gam hỗn hợp E cần vừa đủ 1,12 mol O2 thu được 0,96 mol CO2. Gía trị của a gần nhất là

A. 41,9 gam

B. 27,76 gam

C. 43,8 gam

D. 49,5 gam

Câu 34: Hỗn hợp X gồm 3 peptit Y,Z,T (đều mạch hở) với tỉ lệ mol tương ứng là 2 : 3 : 4.Tổng số liên kết trong phân tử Y,Z,T bằng 12. Thủy phân hoàn toàn 39,05 gam X, thu được 0,11 mol X1, 0,16 mol X2 và 0,2 mol X3. Biết X1, X2, X3 đều có dạng H2NCnH2nCOOH. Mặt khác đốt cháy hoàn toàn m gam X cần 32,816 lít khí O2 (ở đktc). Gía trị gần nhất của m là

A. 27

B. 24

C. 25

D. 26

Câu 35: Este A tạo bởi 2 axit cacboxylic X, Y (đều mạch hở, đơn chức) và ancol Z. Xà phòng hóa hoàn toàn a gam A bằng 140 ml dung dịch NaOH x M thì cần dùng 80 ml dung dịch HCl 0,25M để trung hòa vừa đủ lượng NaOH (dư) thu được dung dịch B. Cô cạn B thu được b gam hỗn hợp muối khan N. Nung N trong NaOH khan (dư) có thêm CaO thu được chất rắn R và hỗn hợp khí K gồm 2 hidrocacbon có tỉ khối với oxi là 0,625. Dẫn K lội qua nước brom thấy có 5,376 lít một khí thoát ra, cho toàn bộ R tác dụng với H2SO4 loãng thấy có 8,064 lít khí CO2 sinh ra. Đốt cháy hoàn toàn 2,76 gam Z cần dùng 2,352 lít O2 sinh ra H2O, CO2 có tỉ lệ khối lượng 6 : 11. Biết các thể tích đo ở đktc. Gía trị của a là?

A. 26,6

B. 27,6

C. 25,6

D. 28,6

Câu 36: Công thức chung của các amino axit no, mạch hở phân tử chứa 1 nhóm chức  amino và 2 nhóm chức cacboxyl là

A. Cn+1H2n+3O4N

B. CnH2n+3O4N

C. CnH2n-1O4N

D. CnH2n+1O4N

Câu 37: Phát biểu nào sau đây đúng?

A. Khi cho dung dịch lòng trắng trứng vào Cu(OH)2 thấy xuất hiện phức chất màu xanh thẫm

B. Trong môi trường kiềm, tất cả các peptit đều có phản ứng màu biure

C. Tất cả các peptit đều có khả năng tham gia phản ứng thủy phân

D. Liên kết peptit là liên kết –CO-NH- giữa 2 đơn vị amino axit

Câu 38: Cho các chất glucozo, saccarozo, tinh bột, glixerol và các phát biểu sau:

(1) Có 3 chất tác dụng được với dung dịch AgNO3/NH3

(2) Có 2 chất có phản ứng thủy phân trong môi trường axit

(3) có 3 chất hòa tan được Cu(OH)2

(4) Có 4 chất đều có nhóm (-OH) trong phân tử

Số phát biểu đúng là

A. 3

B. 1

C. 4

D. 2

Câu 39: X, Y (MX < MY) là 2 peptit mạch hở, đều tạo bởi glyxin và alanin (X, Y hơn kém nhau 1 liên kết peptit), Z là (CH3COO)2C3H5. Đun nóng toàn bộ 31,88 gam hỗn hợp T gồm X, Y, Z trong 1 lít dung dịch NaOH 0,44M vừa đủ thu được dung dịch B chứa 41,04 gam hỗn hợp muối. Biết trong T nguyên tố oxi chiếm 37,139% về khối lượng. Phần trăm khối lượng của Y có trong T gần nhất là

A. 18%

B. 27%

C. 36%

D. 16%

Câu 40: Cho các phát biểu sau về cacbohidrat

(1) Glucozo và saccarozo đều là chất rắn, vị ngọt, dễ tan trong nước

(2) Tinh bột và xenlulozo đều là polisaccarit

(3) Trong dung dịch, glucozo và saccarozo đều hòa tan Cu(OH)2, tạo phức màu xanh lam

(4) Khi thủy phân hoàn toàn hỗn hợp gồm tinh bột và saccarozo trong môi trường axit, chỉ thu được 1 loại monosaccarit duy nhất

(5) Khi đun nóng glucozo (hoặc fructozo) với dung dịch AgNO3/NH3 thu được Ag

(6) Glucozo và saccarozo đều tác dụng với H2 (xúc tác Ni, đun nóng) tạo sobitol

Số phát biểu đúng là

A. 6

B. 4

C. 3

D. 5

Lời giải chi tiết

Đáp án

1.B

6.A

11.D

16.D

21.A

26.A

31.D

36.C

2.A

7.D

12.D

17.A

22.C

27.A

32.C

37.C

3.C

8.B

13.A

18.D

23.D

28.D

33.A

38.A

4.B

9.D

14.B

19.A

24.C

29.D

34.D

39.A

5.B

10.C

15.D

20.B

25.B

30.C

35.B

40. B

 

Câu 3:

Nhiệt độ nóng chảy của chất béo không no < Nhiệt độ nóng chảy của chất béo no

Ngoài ra còn so sánh nhiệt độ nóng chảy dựa vào khối lượng nguyên tử

(Khối lượng nguyên tử càng lớn thì nhiệt độ nóng chảy càng cao)

Đáp án C

Câu 5:

Các chất thỏa mãn đề bài là: anlyl axetat, metyl axetat, etyl format, tripanmitin

Đáp án B

Câu 6:

Các chất có khả năng tham gia phản ứng trùng hợp là chất trong CTCT có chứa liên kết kém bền hoặc vòng kém bền

Đáp án A

Câu 15:

CH3COOC6H5 + 2NaOH → CH3COONa + C6H5ONa + H2O

Đáp án D

Câu 17:

n C : n H : n O = (40 : 12 ) : (6,66 : 1) : (53,34 : 32) = 1 : 2 : 1

=> CTPT của este là C2H4O2

Đáp án A

Câu 20:

Ở mọi điệu kiện tỉ lệ đều thu được lượng ancol như nhau

=> 2 este có cùng gốc R’

Mặt khác 2 este này là đồng đẳng

=> có đồng dạng CTCT và hơn kém nhau 1 hoặc nhiều nhóm CH2

Đáp án B

Câu 21:

HCOOC=C-C

HCOOC-C=C

CH3COO-C=C

Đáp án A

Câu 22:

HCOOC=C-C-C

HCOOC=C(CH3)-C

CH3COOC=C-C

CH3-CH2COOC=C

Đáp án A

Câu 26:

Do Y là dipeptit

=> Y có 1 nhóm –CO-NH-; 1 nhóm NH2; 1 nhóm COOH

=> Ta còn C4H8

Các CTCT thỏa mãn là:

NH2CH(CH3)CO-NH-CH(CH3)-COOH

NH2-CH2-CONH-CH(C2H5)COOH

NH2-CH(C2H5)CONH-CH2-COOH

NH2-CH2-CONH-CH(CH3)2COOH

NH2-CH(CH3)2CONH-CH2-COOH

Đáp án A

Câu 29:

M tác dụng với AgNO3/NH3 sinh ra Ag

=> X là HCOOH

=> Y và Z thuộc dãy đồng đẳng của HCOOH

=> Quy M về HCOOH, CH3COOH, C2H5COOH và (HCOO)(CH3COO)(C2H5COO)C3H5, CH2

Đặt n HCOOH =x mol; n CH3COOH = n C2H5COOH = y mol; n este = z mol

Tổng số mol Ag = 0,2 mol

=> 2x + 2z = 0,2

m M = 46x + 60y + 74y + 218z + 14t = 26,6 gam

n CO2 = x + 2y + 3y + 9z + t = 1 mol

n H2O = x + 2y + 3y + 7z + t = 0,9 mol

Giải hệ trên ta có:

x = 0,05 mol; y = 0,1 mol; z = 0,05 mol; t = 0 mol

Theo đó 13,3 gam M gồm có 0,025 mol HCOOH; 0,05 mol CH3COOH

0,05 mol C2H5COOH và 0,025 mol (HCOO)(CH3COO)(C2H5COO)C3H5

=> n NaOH phản ứng = 0,025 + 0,05 + 0,05 + 0,025 . 3 = 0,2 < 0,4

n H2O thủy phân = 0,025 + 0,05 + 0,05 = 0,125 mol

n C3H5(OH)3 = 0,025 mol

Bảo toàn khối lượng m = 13,3 + 0,4 . 40 – 0,125 . 18 – 0,025 . 92 = 24,75 gam

Câu 31:

Y + CuO sinh ra andehit

=> Y là ancol bậc 1

Andehit có dạng R(CH2OH)a

n Ag = 0,8 => n R(CH2OH)r = n R(CHO)r = 0,8/2a

=> MY = R + 31a = 12,4 . 2r/ 0,8

=> R = 0

Vậy Y là C2H4(OH)2

n Y = 0,2 mol

n NaOH đã dùng 0,6 mol

=> Z gồm có  ACOONa (0,4 mol) và NaOH dư = 0,2 mol

Áp dụng định luật bảo toàn Na

=> n Na2CO3 = 0,3

Áp dụng định luật bảo toàn C

=> n C = n Na2CO3 + n CO2 = 0,5 mol

=> Số C = 0,5 / 0,4 = 1,25

Muối gồm HCOONa (0,3 mol) và CH3COONa (0,1 mol)

TH1: X1 là (HCOO)2C2H4 (0,15 mol) và X2 HCOO-C2H4-OOC-CH3 (0,05 mol)

=> %X1 = 70,8%

TH2: X1 là (HCOO)2C2H4 (0,1 mol) và HCOOC2H4OOC-CH3 (0,1 mol)

=> %X1 = 47,2%

Đáp án D

Câu 33:

Phân tử Y có độ không no bằng 7 Y được tạo thành từ 2 axit không no Z và T

=> Z có k = 2 ; T có k = 3 và Y chứa 2 gốc Z và 1 gốc T

n Y = n Z = n T = a mol

Quy đổi Y,Z,T thành Z (3a mol) ; T (2a mol); C3H5(OH)3 (a mol) và H2O

CTPT chung của Z, T là Cn H2n-2,8O2 (5a mol)

Quy đổi E thành:

Cn H2n-2,8O2 (5a mol)

C3H5(OH)3 a mol

Cm H2m+1 NO2 b mol

n KOH = 5a + b = 0,35

n CO2 = 5na + mb +3a = 0,96

n O2 = 5a(1,5n -1,7) + b(1,5n – 0,75) + 3,5a = 1,12

=> a = 0,01; b = 0,3 và 5na + mb = 0,93

Muối gồm có CnH 2n-3,8 O2K (5a mol) và Cm H2m NO2K (b mol)

=> m Muối = 5a (14n + 67,2) + b (14m + 85)

=> m Muối = 14 (5na + mb) + 67,2 . 5a + 85b = 41,88

Đáp án A

Câu 34:

X gồm 3 peptit Aa, Bb, Cc với tỉ lệ mol tương ứng là 2 : 3 : 4

Biến đổi 2Aa + 3Bb + 4Cc => 1 (Aa)2(Bb)3(Cc)4 + 8H2O

1(Aa)2(Bb)3(Cc)4 + ? H2O → 11k X1 + 16k X2 + 20k X3 (k nguyên)

=> 2a + 3b + 4c = 47k

Lại có (a – 1) + (b – 1) + ( c – 1) = 12

=> a + b + c = 15

=> 2a + 3b + 4c < 4( a + b + c) = 60

=> 47k < 60 => k = 1 là giá trị thỏa mãn

Vậy X gồm [2A + 3B + 4C] + 38H2O => 11X1 + 16X2 + 20X3

Quy X về C2H3NO, CH2, H2O

=> n C2H3NO = 0,11 + 0,16 + 0,2 = 0,47 mol

=> n H2O = 0,02 + 0,03 + 0,04 = 0,09

=> n CH2 = 0,76 mol

Đốt 39,05 gam X cần 2,25 . 0,47 + 1,5 . 0,76 = 2,1975 mol O2

=> m = 39,05 . 1,465 : 2,1975 = 26,03

Đáp án D

Câu 35:

n O2 = 0,105 . m CO2 = 11p và m H2O = 6p

Áp dụng định luật bảo toàn khối lượng

=> 2,76 + 0,105 . 32 = 11p + 6p

=> p = 0,36

n CO2 = 0,09 và n H2O = 0,12

n Ancol = n H2O – n CO2 = 0,03

Số C = n CO2 / n H2O = 3

Bảo toàn nguyên tố O

=> n O trong ancol = 0,09

Số O = 3

n XCOONa = x mol; n YCOONa = 0,24 mol

=> n Na2 CO3 = x + 0,24

n CO2 = n Na2CO3 = x + 0,24 = 0,36

=> n CO2 = 0,12 mol

m Khí = 0,12 (X + 1) + 0,24 (Y + 1) = 0,36 . 32 . 0,625

=> X + 2Y = 57

X là gốc không no, Y là gốc no

=> X = 27 và Y = 15

X là CH2=CH-COOH; Y là CH3COOH

A là (CH2=CH-COO)(CH3COO)2C3H5

n A = n C2H3-COONa = 0,12 ; n HCl = 0,02

=> n NaOH = 3n A + n HCl = 0,38

=> m A = a = 27,6 gam

Đáp án B

Câu 39:

Quy đổi hỗn hợp T thành:

C2H3ON : a mol

CH2: b mol

H2O: c mol

(CH3COO)3C3H5: d mol

=> 57a + 14a +18a +218d = 31,88

n NaOH = a + 3d = 0,44

m muối = 57a + 14b + 40a + 82.3d = 41,04

n O = a + c + 6d = 31,88 . 37,139%/16 = 0,74

=> a = 0,2; b = 0,14; c = 0,06; d = 0,08

Ta có số N = a /c = 10/3

=> X là tripeptit (0,04 mol); Y là tetra peptit (0,02 mol)

n Gly = x; n Ala = y

=> x + y = 0,2

n C = 2x + 3y = 2a + b = 0,54

=> x = 0,06 ; y = 0,14

X là (Gly)u(Ala)3-u

Y là (Gly)v(Ala)4-v

=> n Gly = 0,04u + 0,02v = 0,06

=> 2u + v = 3

TH1: u = 1 và v = 1

=> X là (Gly)(Ala)2 và Y là (Gly)(Ala)3

=> %Y = 18,07%

Đáp án A

Loigiaihay.com

Sub đăng ký kênh giúp Ad nhé !


Bình chọn:
4.3 trên 6 phiếu

Luyện Bài tập trắc nghiệm môn Hóa lớp 12 - Xem ngay

>> Luyện thi tốt nghiệp THPT và Đại học năm 2021, mọi lúc, mọi nơi tất cả các môn cùng các thầy cô giỏi nổi tiếng, dạy hay dễ hiểu trên Tuyensinh247.com. Đã có đầy đủ các khóa học từ nền tảng tới luyện thi chuyên sâu.


Gửi bài