Giải đề thi học kì 1 hoá lớp 12 năm 2019 - 2020 sở giáo dục Bình Thuận


Giải chi tiết đề thi học kì 1 môn hoá lớp 12 năm 2019 - 2020 sở giáo dục Bình Thuận với cách giải nhanh và chú ý quan trọng

Câu 1: Tơ nào dưới đây được điều chế từ phản ứng trùng hợp?

A.   Capron từ axit ε- aminocaproic.

B.    Nitron (tơ olon) từ acrilonitrin.

C.   Nilon - 6,6 từ hexametilenđiamin và axit ađipic.

D.   Lapsan từ etilenglicol và axit terephtalic.

Câu 2: Thủy phân hết 0,01 mol este X trong dung dịch NaOH thu được glixerol và 8,62 gam hỗn hợp hai muối là natri stearat và natri panmitat. Phân tử khối của X là

A. 834.                             B. 862.

C. 890.                             D. 806.

Câu 3: X là este mạch hở, đơn chức, không chứa nhóm chức khác. Thủy phân hoàn toàn m gam X bằng dung dịch chứa NaOH (vừa đủ) thu được muối Y và ancol Z (Y và Z có cùng số nguyên tử cacbon). Đốt cháy hết lượng muối Y trên cần vừa đủ 0,36 mol O2, sản phẩm cháy thu được chứa 0,3 mol CO2. Nếu đốt cháy hết lượng ancol Z cần 0,48 mol O2 thu được tổng số mol CO2 và H2O là 0,72 mol. Tổng số nguyên tử có trong phân tử X là

A. 16.              B. 18.                C. 20.             D. 14.

Câu 4: Chất nào thuộc hợp chất monosaccarit?

A. Saccarozơ.                  B. Tinh bột.

C. Xenlulozơ.                 D. Fructozơ.

Câu 5: Phát biểu nào sau đây đúng?

A.   Xenlulozơ bị thuỷ phân trong dung dịch kiềm đun nóng.

B.    Triolein là chất rắn ở điều kiện thường.

C.   Fructozơ có nhiều trong mật ong.

D.   Tinh bột có phản ứng tráng bạc.

Câu 6: Dung dịch không có phản ứng màu biure là

A. Gly-Ala-Val-Gly.              B. Gly-Val.

C. Gly-Ala-Val.                    D. anbumin (lòng trắng trứng).

Câu 7: Cho glyxin tác dụng vừa đủ với 200 ml dung dịch NaOH 0,1 M. Khối lượng muối thu được là

A. 2,91 g.                        B. 1,94 g.

C. 14,55 g.                      D. 0,97 g.

Câu 8: Este X no, đơn chức, mạch hở có 48,648% cacbon về khối lượng. Số đồng phân cấu tạo ứng với công thức phân tử của X là

A. 4.            B. 2.              C. 1.           D. 3.

Câu 9: Khi đun hỗn hợp gồm axitstearic, axit oleic với glixerol. Số triglixerit tối đa thu được là

A. 4.          B. 9              C. 3.           D. 6.

Câu 10: Chất không tham gia phản ứng tráng gương là

A. fructozơ.                     B. etylfomat.

C. glucozơ.                      D. saccarozơ.

Câu 11: Amino axit nào sau đây phản ứng với dung dịch HCl theo tỉ lệ mol tương ứng 1 : 2?

A. Alanin.                        B. Axit glutamic.

C. Lysin.                          D. Valin.

Câu 12: Metyl acrylat có công thức là

A. CH3COOCH=CH2.

B. CH2=CHCOOCH3.

C. CH3COOCH3.

D. HCOOCH3.

Câu 13: Đốt cháy hoàn toàn amin đơn chức X sinh ra 1,12 lít khí N2 (ở đktc). Để phản ứng hết với X cần vừa đủ V ml dung dịch HCl 0,5M. Giá trị của V là

A. 200.              B. 50.              C. 150.           D. 100.

Câu 14: Kết quả thí nghiệm của các dung dịch X, Y, Z, T với thuốc thử được ghi ở bảng sau:

Thuốc thử

Mẫu thử

Hiện tượng

Dung dịch NaHCO3

X

Có bọt khí

Dung dịch AgNO3/NH3, t0

X ,Y

Z

 Kết tủa Ag trắng sáng

 không hiện tượng

Cu(OH)2/ OH-

Y, Z

T

Dung dịch xanh lam

Dung dịch tím

Các chất X, Y, Z, T lần lượt là:

A.   axit fomic, glucozơ, saccarozơ, Lys-Val.

B.    axit fomic, glucozơ, saccarozơ, Glu-Val-Ala.

C.   axit axetic, fructozơ, saccarozơ, Glu-Val-Ala.

D.   fomanđêhit, glucozơ, saccarozơ, Lys-Val-Ala.

Câu 15: Điền cụm từ thích hợp vào khoảng trống trong câu sau đây: Glucozơ và fructozơ có thành phần phân tử giống nhau, nhưng cấu tạo phân tử khác nhau là...................................................................... của nhau.

A. đồng khối.                  B. đồng phân.

C. đồng vị.                      D. đồng đẳng.

Câu 16: Đốt cháy hoàn toàn một lượng polietilen, sản phẩm cháy cho lần lượt đi qua bình 1 đựng H2SO4 đặc và bình 2 đựng dung dịch Ca(OH)2 dư thấy khối lượng bình 1 tăng m gam, bình 2 thu được 200 gam kết tủa. Giá trị của m là

A. 18.          B. 9.              C. 54.            D. 36.

Câu 17: Phân tử polime X có hệ số trùng hợp là 1800, X có phân tử khối 112500u. X là

A. cao su isopren.                        B. poli(metyl metacrylat).

C. poli(acrilonitrin).                      D. poli(vinyl clorua).

Câu 18: Từ quả đào chín người ta tách ra được chất X có công thức phân tử là C3H6O2. X có phản ứng tráng bạc và không tác dụng với Na. Công thức cấu tạo của X là

A. HCOOC2H5.                            B. CH3COOCH3.

C. HO-CH2-CH2-CHO.                  D. CH3CH2COOH.

Câu 19: Loại thực phẩm không chứa nhiều saccarozơ là

A. đường kính.                B. mật ong.

C. mật mía.                    D. đường phèn.

Câu 20: Nilon–6,6 là một loại

A. tơ axetat.                     B. tơ polieste.

C. tơ poliamit.                  D. tơ visco.

Câu 21: Trong các loại tơ dưới đây, tơ nhân tạo là

A. tơ visco.                          B. tơ tằm.

C. tơ nilon -6,6.                   D. tơ capron.

Câu 22: Thủy phân este X trong môi trường kiềm, thu được natri axetat và ancol metylic. Công thức của X là

A. CH3COOCH3.                    B. HCOOCH3.

C. CH3COOC2H5.                   D. HCOOC2H5.

Câu 23: Đốt cháy hoàn toàn 0,1 mol hỗn hợp X gồm glyxin, alanin, valin và lysin bằng oxi vừa đủ thu được 14,52 gam CO2; 35,82 gam H2O và 2,688 lít N2 (đktc). Tỉ khối hơi của X so với H2

A. 55,5.            B. 65,6.            C. 72,5.            D. 45,4.

Câu 24: Xà phòng hóa 2,2 gam etyl axetat bằng 100 ml dung dịch NaOH 0,2M. Sau khi phản ứng xảy ra hoàn toàn, cô cạn dung dịch thu được chất rắn khan có khối lượng là

A. 4,10 g.                 B. 4,28 g.

C. 1,64 g.                 D. 5,20 g.

Câu 25: Cho các chất sau: saccarozơ, tinh bột, xenlulozơ, glucozơ, tristearin, protein. Số chất tham gia phản ứng thủy phân là

A. 6.            B. 4.           C. 5.            D. 3.

Câu 26: Chất dinh dưỡng và được dùng làm thuốc tăng lực cho người già, trẻ em và người ốm là

A. bột ngọt.                      B. xenlulozơ.

C. glucozơ.                      D. tinh bột.

Câu 27: Cho các phát biểu sau:

(a)   Ở nhiệt độ thường, Cu(OH)2 tan được trong dung dịch glixerol.

(b)   Dung dịch glucozơ phản ứng được với nước brom.

(c)   Đốt cháy hoàn toàn etylaxetat thu được số mol CO2 bằng số mol H2O.

(d)   Alanin phản ứng được với dung dịch NaOH. Số phát biểu đúng là

A. 2.             B. 1.             C. 3.            D. 4.

Câu 28: Cho 5,88 gam axit glutamic vào 300 ml dung dịch HCl 1M, thu được dung dịch X. Cho X tác dụng hoàn toàn với 240 ml dung dịch NaOH 2M, thu được dung dịch Y. Cô cạn Y, thu được m gam chất rắn khan. Giá trị của m là

A. 23,39.                          B. 25,19.

C. 27,39.                          D. 29,19.

Câu 29: Chất tác dụng với dung dịch brom tạo kết tủa màu trắng là

A. protein.                       B. anilin.

C. alanin.                         D. glucozơ.

Câu 30: Cho các dung dịch: CH3NH2, NH3, C6H5NH2, CH3COOH. Có bao nhiêu dung dịch làm quỳ tím hóa xanh?

A. 3.           B. 4.            С. 2.              D. 1.

Câu 31: Nhận định nào sau đây đúng?

A.   Thủy phân (xúc tác là enzim) tetrapeptit thu được tối đa 5α-aminoaxit.

B.    Các hợp chất chứa liên kết peptit đều cho phản ứng màu biure.

C.   Các protein đều tan ít trong nước và tạo thành dung dịch keo.

D.   Từ Glyxin và Alanin có thể tạo ra 2 đipeptit đồng phân.

Câu 32: Đốt cháy hoàn toàn một mẩu polime X sinh ra khí CO2 và hơi nước có thể tích bằng nhau ở cùng điều kiện, X là polime nào trong các polime sau?

A. Xenlulozơ.

B. Poli (vinyl clorua).

C. Poli (vinyl axetat). 

D. Poli propilen.

Câu 33: Chọn phát biểu đúng

A.   Các este thường dễ tan trong nước.

B.    Phản ứng thủy phân este trong môi trường axit là phản ứng một chiều.

C.   Mỡ bò, lợn, gà, dầu lạc, dầu vừng có thành phần chính là chất béo.

D.   Triglixerit đều có phản ứng cộng hiđro.

Câu 34: Thủy phân hoàn toàn 0,1 mol hỗn hợp X gồm hai chất béo trong môi trường axit, thu được hỗn hợp gồm axit stearic, axit panmitic và glixerol. Nếu đốt cháy hoàn toàn 0,1mol X cần dùng 7,79 mol O2 sản phẩm cháy dẫn qua bình đựng dung dịch Ca(OH)2 dư, thu được dung dịch Y có khối lượng giảm m gam so với dung dịch ban đầu. Giá trị gần nhất của m là

A. 220.                             B. 230.

C. 210.                             D. 240.

Câu 35: Để phân biệt các dung dịch: etylamin, glyxin, axit axetic cần dùng thuốc thử là

A. dung dịch NaOH.      B. Cu(OH)2.

C. quỳ tím.                      D. dung dịch brom.

Câu 36: Chất nào sau đây không phải chất béo?

A. Dầu ăn.                       B. Dầu cá.

C. Mỡ bôi trơn máy.        D. Mỡ động vật.

Câu 37: Đốt cháy hoàn toàn m gam hỗn hợp X gồm glucozơ, saccarozơ và tinh bột thu được 52,8 gam CO2 và 20,7 gam nước. Giá trị m là

A. 39,7.          B. 35,1.            C. 54,3.          D. 36,7.

Câu 38: Este X được điều chế từ aminoaxit. Tỉ khối hơi của X so với H2 là 51,5. Cho 41,2 gam X phản ứng vừa đủ với dung dịch NaOH thu được 38,8 gam muối. Công thức của X:

A. CH3(NH2)CH-COOC2H5.

B. H2N-CH2-COOCH2CH3.

C. H2N-CH2 -COOCH3.

D. CH3CH(NH2)COOCH3.

Câu 39: Isoamyl axetat có mùi chuối chín, được điều chế từ

A. CH3COOH, (CH3)2CH-CH2-CH2OH.

B. (CH3)2CH-CH2OH, CH3COOH.

C. CH3OH, CH3COOH. 

D. C2H5COOH, C2H5OH.

Câu 40: Cần bao nhiêu gam saccarozơ để pha thành 300ml dung dịch có nồng độ 1M ?

A. 51,3 g.                        B. 85,5 g.

C. 34,2 g.                        D. 102,6 g. 

ĐÁP ÁN

1B

11C

21A

31D

2A

12B

22A

32D

3A

13A

23C

33C

4D

14B

24C

34C

5C

15B

25C

35C

6B

16D

26C

36C

7B

17D

27D

37B

8B

18A

28D

38B

9D

19B

29D

39A

10D

20C

30C

40D

HƯỚNG DẪN GIẢI CHI TIẾT

Thực hiện:  Ban chuyên môn Loigiaihay.com

Câu 1:

Phương pháp:

Dựa vào khái niệm thế nào là polime được điều chế bằng phản ứng trùng hợp, trùng ngưng. Từ đó phân loại được tơ nào điều chế bằng phương pháp trùng hợp.

Hướng dẫn giải:

A. Loại vì được điều chế bằng phản ứng trùng ngưng

B. Thỏa mãn

C. Loại, vì được điều chế bằng phản ứng trùng ngưng

nH2N-(CH2)6 -NH2 + nHOOC-(CH2)4-COOH \(\xrightarrow{{{t^0},p,xt}}\)  n-(-HN-(CH2)6-NH-CO-(CH2)4-CO-)-n + 2nH2O

hexametilenđiamin             axit ađipic                                             Nilon – 6,6

D. Loại, vì được điều chế bằng phản ứng trùng ngưng

n(p-HCOOC6H4COOH) + n(HOCH2CH2OH) \(\xrightarrow{{{t^0},p,xt}}\) -(-OC-C6H4-CO-OCH2-CH2-O-)-n + 2nH2O

          Axit terephtalic            etilenglicol                                  Tơ lapsan

Chọn B

Câu 2:

Phương pháp:

- Tính số mol NaOH, nC3H5(OH)3

Áp dụng: nNaOH = 3neste ; nC3H5(OH)3 = neste  

- Tính m:

BTKL ta có: mX + mNaOH = mmuối + mC3H5(OH)3 → mX 

Hướng dẫn giải:

nNaOH = 3neste = 0,03 (mol)

nC3H5(OH)3 = neste  = 0,01 (mol)

BTKL ta có: mX + mNaOH = mmuối + mC3H5(OH)3

→ mX + 0,03.40 = 8,62 + 0,01.92

→ mX = 8,34 (g)

→ MX = mX : nX = 8,34 : 0,01 = 834 (g/mol)

Chọn A

Câu 3:

Phương pháp:

Gọi công thức phân tử của Y là CxHyO2Na (a mol)

- Tìm x, y

+ Viết phương trình phản ứng đốt cháy Y

+ Theo phương trình, tính số mol CO2 theo số mol Y (1)

+ Theo phương trình, tính số mol O2 theo số mol Y (2)

+ Lấy (1) : (2), biện luận tìm giá trị x và y

- Kết luận CTCT của Y

- Thay x, y vào (1), tìm a.

- Gọi công thức phân tử của Z là CxHzO (a mol)

- Viết phương trình phản ứng đốt cháy Z

- Theo phương trình, tính số mol O2 theo số mol của Z, tìm được z.

- Kết luận CTCT của Z

- Suy ra CTCT của X

- Tìm mX.

Hướng dẫn giải:

Gọi công thức phân tử của Y là CxHyO2Na (a mol)

PTHH: \(2{C_x}{H_y}{O_2}Na + (2{\rm{x}} + \dfrac{y}{2} - 1,5){O_2} \to (2{\rm{x}} - 1)C{O_2} + y{H_2}O + N{a_2}C{O_3}\)

Theo phương trình: \({n_{C{O_2}}} = \dfrac{{2{\rm{x}} - 1}}{2}{n_Y} \to \dfrac{{2{\rm{x}} - 1}}{2}.a = 0,3\)(1)

Và \({n_{{O_2}}} = (2{\rm{x}} + \dfrac{y}{2} - 1,5).\dfrac{1}{2}{n_Y} \\\to (2{\rm{x}} + \dfrac{y}{2} - 1,5).\dfrac{1}{2}a = 0,36\)(2)

Lấy (1) : (2) \(\dfrac{{2{\rm{x}} - 1}}{{2{\rm{x}} + \dfrac{y}{2} - 1,5}} = \dfrac{{0,3}}{{0,36}} \\\to  - 4{\rm{x}} + 5y = 3\)

Chọn x = y = 3 \( \to Y:C{H_2} = CH - COON{\rm{a}}\)

Thay x = 3 vào (1) => a = 0,12 mol

Gọi công thức phân tử của Z là CxHzO (0,12 mol)

PTHH: \({C_x}{H_z}O + (x + \dfrac{z}{4} - 0,5){O_2} \to xC{O_2} + \dfrac{z}{2}{H_2}O\)

Theo phương trình: \({n_{{O_2}}} = (x + \dfrac{z}{4} - 0,5){n_Z} \\\to 0,12.(x + \dfrac{z}{4} - 0,5) = 0,48\)

\( \to 0,12.(3 + \dfrac{z}{4} - 0,5) = 0,48 \\\to z = 6\)

Vậy X là CH2=CH-CH2OH

Vậy CT của X là CH2=CHCOOCH2CH=CH2 

X là este đơn chức nên CTPT của X: C6H8O2

→ Tổng số nguyên tử có trong phân tử X là: 6 + 8 + 2 = 16

Chọn A

Câu 4:

Phương pháp: Dựa vào sự phân loại cacbohidrat trong sgk hóa 12

Hướng dẫn giải:

Fructozo thuộc monosaccarit

Chọn D

Câu 5:

Phương pháp: Dựa vào kiến thức được học về chất béo và cacbohiđrat

Hướng dẫn giải:

A. Sai vì xenlulozơ bị thuỷ phân trong dung dịch axit

B. Sai, Triolein là chất lỏng ở điều kiện thường

C. Đúng

C. Sai, tinh bột không có phản ứng tráng bạc

Chọn C

Câu 6:

Phương pháp:

Từ tri peptit trở nên mới có phản ứng màu biure (phản ứng với Cu(OH)2/OH-, t0)

Hướng dẫn giải:

Gly – Ala là đi peptit nên không có phản ứng màu biure

Chọn B

Câu 7:

Phương pháp:

- Tính số mol NaOH: nNaOH = VNaOH × CM 

- Tính m­muối

H2N-CH2-COOH + NaOH → H2N-CH2-COONa + H2O

→ nH2N-CH2-COONa  => m muối 

Hướng dẫn giải:

200 ml = 0,2 (lít)

nNaOH = VNaOH × CM = 0,2×0,1 = 0,02 (mol)

PTHH: H2N-CH2-COOH + NaOH → H2N-CH2-COONa + H2O

(mol)                                     0,02    → 0,02

→ m­muối = m H2N-CH2-COONa = 0,02. 97= 1,94 (g)

Chọn B

Câu 8:

Phương pháp:

- Tìm CTPT của X

Đặt công thức phân tử của este no, đơn chức, mạch hở là: CnH2nO2 (đk: n ≥ 2)

Áp dụng công thức

\(\% {m_C} = \frac{{12n}}{{14n + 32}}.100\%    \Rightarrow n \)

→ CTPT của X

- Viết đồng phân

Hướng dẫn giải:

Đặt công thức phân tử của este no, đơn chức, mạch hở là: CnH2nO2 (đk: n ≥ 2)

Theo bài có:

\(\begin{array}{l}\% {m_C} = \frac{{12n}}{{14n + 32}}.100\%  = 48,648\% \\ \Rightarrow 1200n = 681,072n + 1556,736\\ \Rightarrow 518,928n = 1556,736\\ \Rightarrow n \approx 3\end{array}\)

Vậy công thức phân tử: C3H6O2

Các đồng phân este: HCOOCH2CH3 ; CH3COOCH3

→ Có 2 CTCT

Chọn B

Câu 9:

Phương pháp:

Công thức tính số trieste ( triglixerit ) tạo bởi glixerol và hỗn hợp n axít béo :
Số tri este = \(\frac{{{n^2}(n + 1)}}{2}\)

Hướng dẫn giải:

Áp dụng công thức: số triglixerit \(\frac{{{n^2}(n + 1)}}{2} = \frac{{{2^2}(2 + 1)}}{2} = 6\) với n là hỗn hợp axit béo ban đầu

Chọn D

Câu 10:

Phương pháp: Chất không có nhóm –CHO trong phân tử hoặc trong môi trường kiềm không thủy phân ra chất có nhóm –CHO thì không có phản ứng tráng bạc.

Hướng dẫn giải:

Saccarozơ trong phân tử không còn nhóm –CHO nên không tham gia pư tráng gương.

Chọn D

Câu 11:

Phương pháp: Chọn Aminoaxit có 2 nhóm –NH2 trong phân tử

Hướng dẫn giải:

A. Alanin: H2N-CH2(CH3)-COOH → phản ứng với HCl theo tỉ lệ 1:1

B. Axit glutamic: HCOO-(CH2)2-CH(NH2)-COOH  → phản ứng với HCl theo tỉ lệ 1:1

C. Lysin: H2N- (CH2)4 –CH(NH2)-COOH → phản ứng với HCl theo tỉ lệ 1:2

D. Valin: CH3-CH(CH3)-CH(NH2)-COOH → phản ứng với HCl theo tỉ lệ 1:1

Chọn C

Câu 12:

Phương pháp:

Este có CTPT: RCOOR’

Tên este = tên gốc R’+ tên gốc RCOO + at

Hướng dẫn giải:

Metyl acrylat: CH2=CH-COOCH3

Chọn B

Câu 13:

Phương pháp:

 - Tính số mol X: BTNT N=> nX = 2nN 

- Tính V: Do amin đơn chức nên: n­HCl = namin → VHCl 

Hướng dẫn giải:

nN2(đktc) = 1,12 : 22,4 = 0,05 (mol)

BTNT “N”: nX = 2nN = 2.0,05 = 0,1 (mol) (Vì X đơn chức)

Amin đơn chức nên: n­HCl = namin = 0,1 (mol) → VHCl = nHCl : CM = 0,1 : 0,5 = 0,2 (lít) = 200 ml

Chọn A

Câu 14:

Phương pháp:

Dựa vào kiến thức tổng hợp về các chất vô cơ với 1 số lưu ý sau:

+ Tác dụng với dd NaHCO3 có bọt khí → Chất đó phải là axit

+ Có phản ứng tráng gương → phân tử phải có nhóm –CHO trong phân tử

+ Có phản ứng với dung dịch Cu(OH)2/OH- tạo dd màu xanh lam → phân tử phải chứa 2 hay nhiều nhóm –OH kề nhau

+ Có phản ứng dung dịch Cu(OH)2/OH- tạo phức màu tím → phải là tripeptit trở nên.

Hướng dẫn giải:

X tạo khí với dd NaHCO3 và tạo kết tủa Ag với dd AgNO3/NH3, t0 → X phải là axit và có nhóm –CHO trong phân tử → X là axit fomic

Y tạo kết tủa với dd AgNO3/NH3, t0 và tạo dd màu xanh lam với Cu(OH)2/OH- → Y phải có nhóm –CHO và nhiều nhóm –OH kề nhau trong phân tử → Y là glucozơ

T chỉ tạo phức tím với Cu(OH)2/OH- → T là tripeptit trở lên → T là Glu-Val-Ala

Z không có hiện tượng gì với dd AgNO3/NH3, t0 kết hợp với đáp án → Z là saccarozơ

Vậy X, Y, Z, T theo thứ tự lần lượt là: axit fomic, glucozơ, saccarozơ, Glu-Val-Ala

Chọn B

Câu 15:

Phương pháp: Dựa vào các khái niệm thế nào là đồng đẳng; đồng phân ; đồng vị

Hướng dẫn giải:

Glucozo và fructozo là đồng phân của nhau

Chọn B

Câu 16:

Phương pháp:

- Tính số mol nH2O

Đốt cháy polietile (CH2-CH2)n luôn thu được nH2O = nCO2

BTNT “C”: n­CO2 = nCa(OH)2  → nH2O 

- Tính m : mbình tăng = mH2O 

Hướng dẫn giải:

Đốt cháy polietile (CH2-CH2)n luôn thu được nH2O = nCO2

BTNT “C”: n­CO2 = nCa(OH)2 = 200 : 100 = 2 (mol)

→ nH2O = nCO2 = 2 (mol)

Khối lượng bình H2SO4 đặc tăng chính là khối lượng của H2O → mbình tăng = mH2O = 2×18 = 36 (g)

Chọn D

Câu 17:

Phương pháp: Áp dụng công thức: \({M_{mat\,xich}} = \frac{{Phan\,tu\,khoi\,X}}{{he\,so\,trung\,hop}} \) => X

Hướng dẫn giải:

Phân tử khối 1 mắt xích của X là: \({M_{mat\,xich}} = \frac{{Phan\,tu\,khoi\,X}}{{he\,so\,trung\,hop}} = \frac{{112500}}{{1800}} \\= 62,5\,(g/mol)\) → X là poli (vinyl clorua)  (-CH2-CH(Cl)-)n

Chọn D

Câu 18:

Phương pháp: Suy luận

X có phản ứng tráng bạc → cấu tạo trong X có nhóm –CHO

X không tác dụng với Na → X không có nhóm –OH hay –COOH trong phân tử

Từ đó dựa vào đáp án chọn X thỏa mãn.

Hướng dẫn giải:

CTPT của X: C3H6O2

X có phản ứng tráng bạc → cấu tạo trong X có nhóm –CHO

X không tác dụng với Na → X không có nhóm –OH hay –COOH trong phân tử

Vậy CTCT của X thỏa mãn là: HCOOC2H5

Chọn A

Câu 19:

Phương pháp: Dựa vào trạng thái tự nhiên của saccarzơ trong sgk hóa 12

Hướng dẫn giải:

Mật ong chứa nhiều fructozo chứ không chứa nhiều saccarzơ

Các thực phẩm còn lại: đường kính, mật mía, đường phèn chứa nhiều saccarzơ

Chọn B

Câu 20:

Phương pháp: Dựa vào kiến thức học về tơ

Hướng dẫn giải:

Nilon -6,6 được tổng hợp bằng phản ứng trùng ngưng giữa axit ađipic và hexametilen điamin

nH2N-(CH2)6 -NH2 + nHOOC-(CH2)4-COOH \(\xrightarrow{{{t^0},p,xt}}\)  n-(-HN-(CH2)6-NH-CO-(CH2)4-CO-)-n + 2nH2O

hexametilenđiamin             axit ađipic                                             Nilon – 6,6

→ Cấu tạo nilon -6,6 có nhóm –NH-CO-

→ Thuộc tơ poliamit

Chọn C

Câu 21:

Phương pháp: Dựa vào sự phân loại tơ gồm:

Tơ thiên nhiên: có sẵn trong tự nhiên

Tơ bán tổng hợp (nhân tạo): 1 phần từ thiên nhiên và 1 phần do con người tạo ra.

Tơ tổng hợp: 100% do con người chế tạo ra

Hướng dẫn giải:

Tơ visco là tơ nhân tạo

Tơ tằm là tơ thiên nhiên

Tơ nilin -6,6 và tơ capron là tơ tổng hợp

Chọn A

Câu 22:

Phương pháp:

RCOOR’ + NaOH → RCOONa + R’OH

Từ sản phẩm thu được là natri axetat (CH3COONa) và ancol metylic (CH3OH) tương ứng suy được R và R’. Từ đó tìm được CTCT este ban đầu

Hướng dẫn giải:

este ban đầu là: CH3COOCH3

PTHH minh họa: CH3COOCH3 + NaOH → CH3COONa (natri axetat) + CH3OH

Chọn A

Câu 23:

Phương pháp:

- Tính nO(trong X) 

Dễ thấy trong X các chất đều có 2 nguyên tử O trong phân tử → nO(trong X) = 2nX 

- Tính MX  

BTKL ta có: mX = mC + mH + mN + mO(X) → MX 

- Tính d: \({d_{X/{H_2}}} = \frac{{{M_X}}}{{{M_{{H_2}}}}}\)

Hướng dẫn giải:

- nCO2 = 14,52 : 44 = 0,33 (mol)

nH2O = 35,82 : 18 = 1,99 (mol)

nN2(đktc) = 2,688 : 22,4 = 0,12 (mol)

- Hh X các chất đều có 2 nguyên tử O trong phân tử

→ nO(trong X) = 2nX = 2.0,1 = 0,2 (mol)

- BTKL ta có: mX = mC + mH + mN + mO(X) = 0,33.12 + 2.1,99 + 0,12.28 + 0,2.16 = 14,5 (g)

→ MX = mX : nX = 14,5 : 0,1 = 145 (g/mol)

- \({d_{X/{H_2}}} = \dfrac{{{M_X}}}{{{M_{{H_2}}}}} = \dfrac{{145}}{2} = 72,5\)

Chọn C

Câu 24:

Phương pháp:

Đổi số mol các chất, tính toán theo PTHH sau: CH3COOC2H5 + NaOH → CH3COONa + C2H5OH

Chú ý: Nếu NaOH dư thì chất rắn thu được sau phản ứng gồm muối và NaOH dư.

Hướng dẫn giải:

\(\begin{array}{l}{n_{C{H_3}COO{C_2}{H_5}}} = 2,2:88 = 0,025\,\,\,(mol)\\{n_{NaOH}} = {V_{NaOH}}.{C_M} = 0,1.0,2 = 0,02\,(mol)\end{array}\)

PTHH: CH3COOC2H5 + NaOH → CH3COONa + C2H5OH

pứ (mol)  0,02             ← 0,02    →  0,02

        dư 0,0005

NaOH pư hết, este dư. Mọi tính toán theo số mol NaOH

Theo PTHH: nCH3COONa = nNaOH = 0,02 (mol)

→ mrắn = mCH3COONa = 0,02×82 = 1,64 (g)

Chọn C

Câu 25:

Phương pháp: Dựa vào kiến thức về cacbohiđrat, chất béo, protein trong sgk hóa 12

Hướng dẫn giải:

Các chất tham gia phản ứng thủy phân là: saccarozơ, tinh bột, xenlulozơ, tristearin, protein → có 5 chất

Chọn C

Câu 26:

Phương pháp: Dựa vào ứng dụng của các chất trong chương 2 cacbohiđrat – sgl hóa 12

Hướng dẫn giải:

Glucozơ được dùng làm chất dinh dưỡng và thuốc tăng lực cho người già, trẻ em và người ốm vì nó dễ hấp thu và cung cấp nhiều năng lượng.

Chọn C

Câu 27:

Phương pháp: Dựa vào kến thức lí thuyết tổng hợp về hữu cơ

Hướng dẫn giải:

 (a) đúng, PTHH minh họa: 2C3H5(OH)3 + Cu(OH)2 → (C3H5(OH)2O)2Cu + 2H2O

                                                                                             phức xanh

(b) đúng, vì phân tử glucozơ vẫn còn nhóm –CHO nên tham gia được phản ứng với dd Br2

PTHH minh họa: CH2OH(CH2OH)4CHO + Br2 + H2O \(\xrightarrow{{M{n^{2 + }},{t^0}}}\) CH2OH(CH2OH)COOH + 2HBr

(c) đúng, PTHH minh họa: CH3COOC2H5 + 5O2 \(\xrightarrow{{{t^0}}}\) 4CO2 + 4H2O

(d) đúng, PTHH minh họa: CH3-CH(NH2)-COOH + NaOH → CH3-CH(NH2)-COONa + H2O

→ cả 4 phát biểu đúng

Chọn D

Câu 28:

Phương pháp:

Ta bỏ qua quá trình trung gian tạo dd X, coi như hh gồm axit glutamic và dd HCl phản ứng hết với dd NaOH

PTHH: HOOC- CH2-CH2-CH(NH2)-COOH + 2NaOH → NaOOC- CH2-CH2-CH(NH2)-COONa + 2H2O

             HCl + NaOH → NaCl + H2O

- Tính số mol nước: nH2O = 2nAxit glutamic + nHCl 

- Tính khối lượng chất rắn khan:

BTKL ta có: mrắn khan = maxit glutamic + mHCl + mNaOH – mH2O

Hướng dẫn giải:

naxit glutamic = 5,88 : 147 = 0,04 (mol)

HCl = 0,3.1 = 0,3 (mol)

n­­NaOH = 0,24.2 = 0,48 (mol)

Ta bỏ qua quá trình trung gian tạo dd X, coi như hh gồm axit glutamic và dd HCl phản ứng hết với dd NaOH

Ta có: nH2O = 2nAxit glutamic + nHCl = 0,08 + 0,3 = 0,38 (mol)

BTKL ta có: mrắn khan = maxit glutamic + mHCl + mNaOH – mH2O

                                  = 5,88 + 0,3.36,5 + 0,48.40 – 0,38.18

                                  = 29,19 (g)

Chọn D

Câu 29:

Phương pháp: Dựa vào kiến thức tổng hợp lí thuyết hóa hữu cơ

Hướng dẫn giải:

Anilin + Br2 → 2,4,6 – tribrom anilin (kết tủa trắng)

 

Chọn B

Câu 30:

Phương pháp: axit làm quỳ tím chuyển sang màu đỏ, dd bazo làm quỳ tím chuyển sang màu xanh

Các chất có tính axit quá yếu, bazo quá yếu hoặc trung tính thì không làm đổi màu quỳ tím.

Hướng dẫn giải:

CH3COOH làm quỳ tím chuyển đỏ

C6H5NH2 không làm quỳ tím chuyển màu

CH3NH2; NH3 làm quỳ tím hóa xanh

→ Có 2 dd làm quỳ tím chuyển xanh

Chọn C

Câu 31:

Phương pháp: Dựa vào kiến thức tổng hợp hóa hữu cơ

Hướng dẫn giải:

A. Sai, thu được tối đa 4 α-aminoaxit

B. Sai, phải từ tripeptit trở nên mới có phản ứng màu Biure

C. Sai, protein hình sợi không tan trong nước còn protein hình cầu tan trong nước tạo thành dd dạng keo

D. Đúng, có thể tạo ra 2 peptit đồng phân là Ala – Gly và Gly – Ala,

Chọn D

Câu 32:

Phương pháp:

Đốt X cho VCO2 = VH2O → X được cấu tạo từ C, H có thể có O và có chỉ số H gấp 2 lần chỉ số C trong phân tử

Hướng dẫn giải:

Đốt X cho VCO2 = VH2O → X được cấu tạo từ C, H có thể có O và có chỉ số H gấp 2 lần chỉ số C trong phân tử

A. (C6H10O5)n → loại vì H không gấp 2 lần C

B. Loại vì số H không gấp 2 lần C

C.  Loại vì số H không gấp 2 lần số C

D. (-CH2-CH(CH3)-)n  → Thỏa mãn

Chọn D

Câu 33:

Phương pháp: Dựa vào kiến thức về este, chất béo

Hướng dẫn giải:

A. Sai, các este ít tan trong nước

B. Sai, phản ứng thủy phân este trong môi trường axit là phản ứng 2 chiều, thuận nghịch

C. Đúng

D. Sai, phải triglixerit của các axit béo không no mới có phản ứng cộng hiđro.

Chọn C

Câu 34:

Câu 34:

Phương pháp:

- Nhận xét: Vì X được tạo bởi các gốc axit béo no nên kx = 3

\( \to {n_{C{O_2}}} - {n_{{H_2}O}} = 2{n_X}\)(1)

- Áp dụng bảo toàn nguyên tố O: \(6{n_X} + 2{n_{{O_2}}} = 2{n_{C{O_2}}} + {n_{{H_2}O}}\)(2)

- Từ (1) và (2) tìm được số mol CO2 và H2O

- Bảo toàn nguyên tố C, tìm số mol CaCO3: \({n_{CaC{{\rm{O}}_3}}} = {n_{C{O_2}}}\)

- Tính khối lượng dung dịch giảm: mdd giảm = \({m_{CaC{{\rm{O}}_3}}} - ({m_{C{O_2}}} + {m_{{H_2}O}})\)

Hướng dẫn giải:

Vì chất béo trong X được tạo bởi các gốc axit béo no nên ta có kX = 3

\(=>{n_{C{O_2}}} - {n_{{H_2}O}} = 2{n_X} \\\to {n_{C{O_2}}} - {n_{{H_2}O}} = 2.0,1 = 0,2\,(1)\)

Áp dụng bảo toàn nguyên tố O: \(6{n_X} + 2{n_{{O_2}}} = 2{n_{C{O_2}}} + {n_{{H_2}O}}\)

\( \to 2{n_{C{O_2}}} + {n_{{H_2}O}} = 6.0,1 + 2.7,79 = 16,18(2)\)

Từ (1) và (2) \( \to {n_{C{O_2}}} = 5,46;{n_{{H_2}O}} = 5,26\)

Bảo toàn nguyên tố C: \({n_{CaC{{\rm{O}}_3}}} = {n_{C{O_2}}} = 5,46\,\,mol\)

Ta có: mdd giảm = \({m_{CaC{{\rm{O}}_3}}} - ({m_{C{O_2}}} + {m_{{H_2}O}}) = 5,46.100 - (5,46.44 + 5,26.18)\)= 211,08 gam

Câu 35:

Phương pháp: Dựa vào kiến thức tính chất hóa học khác nhau của 3 chất để chọn thuốc thử phù hợp

Hướng dẫn giải:

Dùng quỳ tím phân biệt 3 chất trên.

Khi cho quỳ tím lần lượt vào 3 chất

+ quỳ tím chuyển sang màu xanh là etylamin

+ quỳ tím chuyển sang màu đỏ là axit axetic

+ quỳ tím không chuyển màu là glyxin

Chọn C

Câu 36:

Phương pháp: Dựa vào trạng thái tồn tại của chất béo trong sgk hóa 12

Hướng dẫn giải:

Mỡ bôi trơn máy chủ yếu là các ankan mạch dài chứ không phải chất béo

Chọn C

Câu 37:

Phương pháp:

Hỗn hợp X gồm 3 chất có công thức chung là Cm(H2O)n

nC = nCO2 = ? (mol) ; nH2O(trong hhX) = nH2O = ? (mol)

BTKL ta có: mX = mC + mH2O = ?

Hướng dẫn giải:

Hỗn hợp X gồm 3 chất có công thức chung là Cm(H2O)n

nCO2 = 52,8 : 44 = 1,2 (mol) → nC = nCO2 = 1,2 (mol)

nH2O = 20,7 : 18 = 1,15 (mol) → nH2O(trong hhX) = nH2O = 1,15 (mol)

BTKL ta có: mX = mC + mH2O = 1,2.12 + 1,15.18 = 35,1 (g)

Chọn B

Câu 38:

Phương pháp:

Đặt công thức este có dạng: RCOOR’

PTHH: RCOOR’ + NaOH → RCOONa + R’OH

BTKL ta có: mX + mNaOH = mmuối + mR’OH →  mR’OH = ? (g)

→ MR’OH = mR’OH : nR’OH = ? (g/mol) → ancol: C2H5OH

Có MX → CTCT của X =?

Hướng dẫn giải:

MX = 51,5. MH2 = 51,5.2 = 103 (g/mol)

→ nX = mX : MX = 41,2 : 103 = 0,4 (mol)

Đặt công thức este có dạng: RCOOR’

PTHH: RCOOR’ + NaOH → RCOONa + R’OH

(mol)    0,4           → 0,4        → 0,4        → 0,4

BTKL ta có: mX + mNaOH = mmuối + mR’OH

→ 41,2 + 0,4.40 = 38,8 + mR’OH

→  mR’OH = 18,4 (g)

→ MR’OH = mR’OH : nR’OH = 18,4 : 0,4 = 46 (g/mol)

→ ancol: C2H5OH

→ RCOOC2H5 có M = 103

→ R + 44 + 29 = 103

→ R = 30 (H2N-CH2-)

→ H2N-CH2-COOCH2CH3

Chọn B

Câu 39:

Phương pháp: Từ tên gọi của este suy ngược lại CTCT ban đầu

Hướng dẫn giải:

Isoamyl axetat có CTCT CH3COOCH2CH2CH(CH3)CH3

→ được điều chế từ CH3COOH và  CH3CH(CH3)-CH2-CH2-OH

Chọn A

Câu 40:

Phương pháp:

nC12H22O11 = V. CM = ? (mol) → mC12H22O11 = nC12H22O11× MC12H22O11  = ?

Hướng dẫn giải:

300 ml  = 0,3 (lít)

nC12H22O11 = V. CM = 0,3.1 = 0,3 (mol)

→ mC12H22O11 = nC12H22O11× MC12H22O11  = 0,3×342= 102,6 (g)

Chọn D

Loigiaihay.com


Bình chọn:
4 trên 3 phiếu

Luyện Bài tập trắc nghiệm môn Hóa lớp 12 - Xem ngay

>> Luyện thi tốt nghiệp THPT và Đại học năm 2021, mọi lúc, mọi nơi tất cả các môn cùng các thầy cô giỏi nổi tiếng, dạy hay dễ hiểu trên Tuyensinh247.com. Đã có đầy đủ các khóa học từ nền tảng tới luyện thi chuyên sâu.


Gửi bài