Đề số 1 - Đề kiểm tra giữa học kì II - Hóa học 12 có đáp án và lời giải chi tiết


Đề bài

Câu 1 : Cho các chất sau: phenylamoni clorua, anilin, glyxin, ancol benzylic, metyl axetat. Số chất phản ứng được với dung dịch KOH là

A. 4.

B. 2.

C. 1.

D. 3.

Câu 2 : Kim loại nào sau đây có khối lượng riêng lớn nhất?

A. Fe.

B. Pb.

C. Ag.

D. Os.

Câu 3 : Kim loại sắt không phản ứng được với dung dịch nào sau đây?

A. ZnCl2.

B. FeCl3.

C. H2SO4 loãng, nguội.

D. AgNO3.

Câu 4 : Crom(III) hiđroxit tan trong dung dịch nào sau đây?

A. KCl.

B. NaOH.

C. KNO3.

D. NaCrO2.

Câu 5 : Phản ứng nào sau đây là phản ứng trao đổi ion trong dung dịch?

A. Mg + H2SO4 → MgSO4 + H2.

B. Fe(NO3)3 + 2KI → Fe(NO3)2 + I2 + 2KNO3.

C. Fe(NO3)3 + 3NaOH → Fe(OH)3 + 3NaNO3.

D. Cu + 2FeCl3 → CuCl2 + 2FeCl2.

Câu 6 : Chất nào sau đây có tính lưỡng tính?

A. Valin.

B. Metylamin.

C. Etylamin.

D. Anilin.

Câu 7 : Thủy phân 68,4 gam saccarozơ trong môi trường axit với hiệu suất 92%, sau phản ứng thu được dung dịch chứa m gam glucozơ. Giá trị của m là

A. 33,12.

B. 66,24.

C. 72,00.

D. 36,00.

Câu 8 : Este nào sau đây là no, đơn chức, mạch hở?

A. CH3COOC6H5.

B. HCOOCH=CH2.

C. CH3COOCH3.

D. (HCOO)2C2H4.

Câu 9 : Chất bột X màu đỏ, được quét lên phía ngoài của vỏ bao diêm. Chất X là

A. Kali nitrat.

B. Photpho.

C. Lưu huỳnh.

D. Đá vôi.

Câu 10 : Chất hữu cơ X thuộc loại cacbohiđrat là chất rắn, màu trắng, không tan trong nước, dạng nguyên chất hay gần nguyên chất, được chế thành sợi, tơ, giấy viết. Chất X là

A. xenlulozơ.

B. tinh bột.

C. saccarozơ.

D. tristearin.

Câu 11 : Cho 86,3 gam hỗn hợp X gồm Na, K, Ba và Al2O3 (trong đó oxi chiếm 19,47% về khối lượng) tan  hết vào nước thu được dung dịch Y và 13,44 lít H2 (đktc). Cho 3,2 lít dung dịch HCl 0,75M vào dung dịch Y, thu được m gam kết tủa. Giá trị của m là

A. 54,6.

B. 27,3.

C. 23,4.

D. 10,4.

Câu 12 : Metylamin phản ứng với dung dịch chất nào sau đây?

A. Ca(OH)2.

B. NH3.

C. CH3COOH.

D. NaCl.

Câu 13 : Thí nghiệm nào sau đây xảy ra ăn mòn điện hóa?

A. Cho lá sắt nguyên chất vào dung dịch gồm CuSO4 và H2SO4 loãng.

B. Nhúng thanh kẽm nguyên chất vào dung dịch HCl.

C. Để thanh thép đã được phủ sơn kín trong không khí khô.

D. Cho lá đồng nguyên chất vào dung dịch gồm Fe(NO3)3 và HNO3.

Câu 14 : Cho luồng khí H2 dư qua hỗn hợp các oxit CuO, Fe2O3, Al2O3, MgO nung nóng ở nhiệt độ cao. Sau phản ứng, hỗn hợp chất rắn thu được gồm

A. Cu, Fe, Al, Mg.

B. Cu, Fe, Al2O3, MgO.

C. Cu, Fe, Al, MgO.

D. Cu, FeO, Al2O3, MgO.

Câu 15 : Dung dịch chứa chất nào sau đây không làm đổi màu quỳ tím?

A. Axit amino axetic.

B. Metylamin.

C. Axit glutamic.

D. Lysin.

Câu 16 : Kim loại nào sau đây được điều chế bằng phản ứng thủy luyện?

A. Na.

B. Mg.

C. Cu.

D. Al.

Câu 17 : Cho 16,1 gam hỗn hợp X gồm CaCO3 và MgCO3 (có tỉ lệ mol 1 : 1) tan hết trong dung dịch HCl dư, thu được V lít (đktc) khí CO2. Giá trị của V là

A. 7,84.

B. 2,94.

C. 3,92.

D. 1,96.

Câu 18 : Thủy phân hoàn toàn đisaccarit A thu được hai monosaccarit X và Y. Hiđro hóa X hoặc Y đều thu được chất hữu cơ Z. A và Z lần lượt là

A. Saccarozơ và glucozơ.

B. Glucozơ và sobitol.

C. Tinh bột và glucozơ.

D. Saccarozơ và sobitol.

Câu 19 : Cho các polime sau: polietilen, poli(vinyl clorua), cao su lưu hóa, nilon-6,6, amilopectin, xenlulozơ. Số polime có cấu trúc mạch không phân nhánh là

A. 5.

B. 3.

C. 6.

D. 4.

Câu 20 : Chất nào sau đây là polisaccarit?

A. Tinh bột.

B. Glucozơ.

C. Saccarozơ.

D. Fructozơ.

Câu 21 : Este X mạch hở có công thức phân tử C5H8O2. Khi đun nóng X với dung dịch NaOH, thu được muối của axit cacboxylic và ancol no. Số đồng phân của X thỏa mãn là

A. 6.

B. 5.

C. 3.

D. 4.

Câu 22 : Cho 10,7 gam hỗn hợp X gồm Al và MgO vào dung dịch NaOH dư, sau khi phản ứng xảy ra hoàn toàn, thu được 3,36 lít khí H2 (đktc). Khối lượng MgO trong X là

A. 2,7 gam.

B. 4,0 gam.

C. 8,0 gam.

D. 6,0 gam.

Câu 23 : Khi cho dung dịch anbumin (protein lòng trắng trứng) tác dụng với Cu(OH)2 thì thu được dung dịch có màu gì?

A. vàng.

B. tím.

C. đỏ.

D. trắng.

Câu 24 : Cho 50 ml dung dịch FeCl2 1M vào dung dịch AgNO3 dư, sau khi các phản ứng xảy ra hoàn toàn thu được m gam kết tủa. Giá trị của m là

A. 18,15.

B. 14,35.

C. 15,75.

D. 19,75.

Câu 25 : Cho 2,52 gam kim loại M tác dụng với dung dịch H2SO4 loãng, vừa đủ, sau phản ứng thu được 6,84 gam muối sunfat trung hòa. Kim loại M là

A. Zn.

B. Ca.

C. Fe.

D. Mg.

Câu 26 : Thủy phân hợp chất: H2N-CH(CH3)-CONH-CH2-CONH-CH2-CH2-CONH-CH(C6H5)-CONH-CH(CH3)-COOH thì số α-amino axit thu được là

A. 4.

B. 2.

C. 5.

D. 3.

Câu 27 :  Cho 1 mol X tác dụng tối đa 1 mol Br2. X có thể là chất nào sau đây?

A. Metan.

B. Buta-1,3-đien.

C. Etilen.

D. Axetilen.

Câu 28 : Loại tơ nào sau đây có nguồn gốc từ xenlulozơ?

A. Tơ visco.

B. Tơ tằm.

C. Tơ nilon-6,6.

D. Tơ olon.

Câu 29 : Cho a gam hỗn hợp X gồm glyxin, alanin và valin phản ứng với 100 ml dung dịch HCl 1M thu được dung dịch Y. Để phản ứng hết với các chất trong dung dịch Y cần 380 ml dung dịch KOH 0,5M. Mặt khác, đốt cháy hoàn toàn a gam hỗn hợp X rồi cho sản phẩm cháy vào bình đựng dung dịch Ba(OH)2 dư, sau phản ứng khối lượng dung dịch trong bình giảm 43,74 gam. Giá trị của a là

A. 7,57.

B. 8,85.

C. 7,75.

D. 5,48.

Câu 30 : Cho các bước tiến hành thí nghiệm tráng bạc của glucozơ:

(1) Thêm 3 - 5 giọt glucozơ vào ống nghiệm.

(2) Nhỏ từ từ dung dịch NH3 cho đến khi kết tủa tan hết.

(3) Đun nóng nhẹ hỗn hợp ở 60 - 70°C trong vài phút.

(4) Cho 1 ml dung dịch AgNO3 1% vào ống nghiệm sạch.

Thứ tự tiến hành đúng

A. (4), (2), (1), (3).

B. (1), (4), (2), (3).

C. (1), (2), (3), (4).

D. (4), (2), (3), (1).

Câu 31 : Thuỷ phân hoàn toàn a mol triglixerit X trong dung dịch NaOH vừa đủ, thu được glixerol và  m  gam hỗn hợp muối. Đốt cháy hoàn toàn a mol X cần vừa đủ 7,75 mol O2 và thu được 5,5 mol CO2. Mặt khác, a mol X tác dụng tối đa với 0,2 mol Br2 trong dung dịch. Giá trị của m là

A. 82,4.

B. 97,6.

C. 80,6.

D. 88,6.

Câu 32 : Rót từ từ dung dịch HCl vào dung dịch hỗn hợp X chứa a mol K2CO3 và 1,25a mol KHCO3 ta có  đồ thị như hình bên. Khi số mol HCl là x thì dung dịch chứa 97,02 gam chất tan. Giá trị của a là

A. 0,24.

B. 0,20.

C. 0,18.

D. 0,36.

 

Câu 33 : Cho hỗn hợp E gồm X (C6H16O4N2 là muối của axit hai chức) và Y (C9H23O6N3, là muối của axit glutamic) tác dụng hoàn toàn với dung dịch KOH thu được 7,392 lít (đktc) hỗn hợp hai amin no (kế tiếp trong dãy đồng đẳng, có tỉ khối so với H2 là 107/6) và dung dịch T. Cô cạn T, thu được m gam hỗn hợp G gồm ba muối khan trong đó có 2 muối có cùng số nguyên tử cacbon trong phân tử. Giá trị của m là

A. 58,52.

B. 93,83.

C. 51,48.

D. 44,44.

Câu 34 : Điện phân dung dịch X chứa Cu(NO3)2 và NaCl với cường độ dòng điện không đổi, điện cực trơ  thấy thể tích khí thoát ra ở cả 2 điện cực (V lít, đktc) và thời gian điện phân (t giây) phụ thuộc nhau theo đồ thị hình bên.

Nếu điện phân dung dịch đến thời gian 2a giây rồi dừng điện phân thì dung dịch sau điện phân có tổng số mol các chất tan là

A. 0,75.

B. 0,50.

C. 0,80.

D. 0,65.

 

Câu 35 : Hỗn hợp X gồm Al, Fe2O3, Fe3O4, CuO (trong đó oxi chiếm 25,39% về khối lượng hỗn hợp). Cho m gam hỗn hợp X tác dụng với 8,96 lít khí CO (ở đktc) sau một thời gian thu được hỗn hợp rắn Y và hỗn hợp khí Z có tỉ khối so với hiđro là 19. Cho hỗn hợp Y tác dụng với dung dịch HNO3 loãng dư thu được dung dịch T và 7,168 lít khí NO (ở đktc, sản phẩm khử duy nhất). Cô cạn T thu được 3,456m gam muối khan. Giá trị  của m gần nhất với giá trị nào sau đây?

A. 38,43.

B. 35,19.

C. 41,13.

D. 40,43.

Câu 36 : Đốt cháy hoàn toàn 0,6 mol hỗn hợp E chứa ancol X, este đơn chức Y và anđehit Z (X, Y, Z đều  no, mạch hở và có cùng số nguyên tử hiđro) có tỉ lệ mol tương ứng 3 : 1 : 2 thu được 24,64 lít CO2 (đktc) và 21,6 gam nước. Mặt khác, cho 0,6 mol hỗn hợp E trên tác dụng với dung dịch AgNO3 trong NH3 đun nóng thu được m gam Ag. Giá trị m của là

A. 97,2.

B. 64,8.

C. 108.

D. 86,4.

Câu 37 : Cho các phát biểu sau:

(a) Thủy phân tripanmitin và etyl axetat đều thu được ancol.

(b) Mỡ động vật và dầu thực vật đều chứa nhiều chất béo.

(c) Hiđro hóa triolein thu được tripanmitin.

(d) Thủy phân vinyl fomat thu được hai sản phẩm đều có phản ứng tráng bạc.

(e) Ứng với công thức đơn giản nhất là CH2O có 3 chất hữu cơ đơn chức, mạch hở.

Số phát biểu đúng

A. 5.

B. 4.

C. 3.

D. 2.

Câu 38 : Đốt cháy hoàn toàn m gam hỗn hợp A gồm 3 este X, Y, Z (đều mạch hở và chỉ chứa chức este, Z chiếm phần trăm khối lượng lớn nhất trong A) thu được lượng CO2 lớn hơn H2O là 0,25 mol. Mặt khác, m gam A phản ứng vừa đủ với dung dịch NaOH thu được 22,2 gam 2 ancol hơn kém nhau 1 nguyên tử cacbon và hỗn hợp T gồm 2 muối. Đốt cháy hoàn toàn T cần vừa đủ 0,275 mol O2 thu được CO2, 0,35 mol Na2CO3 và 0,2 mol H2O. Phần trăm khối lượng của Z trong A là

A. 45,20%.

B. 42,65%.

C. 62,10%.

D. 50,40%.

Câu 39 : Thực hiện các thí nghiệm sau:

(a) Cu vào dung dịch Fe2(SO4)3.

(b) Sục khí CO2 vào dung dịch Ca(OH)2.

(c) Sục hỗn hợp NO2 và O2 vào nước.

(d) Cho dung dịch HCl vào dung dịch Fe(NO3)2.

(e) Cho FeO vào dung dịch H2SO4 đặc, nóng.

(f) Hòa tan BaO vào nước.

Số thí nghiệm có xảy ra phản ứng oxi hóa - khử là

A. 3.

B. 4.

C. 5.

D. 2.

Câu 40 : Cho các phát biểu sau:

(a) Dầu mỡ sau khi sử dụng, có thể tái chế thành nhiên liệu.

(b) Muối mononatri của axit glutamic được dùng làm bột ngọt (mì chính).

(c) Amilopectin, tơ tằm, lông cừu là polime thiên nhiên.

(d) Chất độn amiăng làm tăng tính chịu nhiệt của chất dẻo.

(e) Khi cho giấm ăn (hoặc chanh) vào sữa bò hoặc sữa đậu nành thì thấy có kết tủa xuất hiện.

(f) Thành phần chính của khi biogas là metan.

Số phát biểu đúng

A. 5.

B. 3.

C. 4.

D. 6.

Lời giải chi tiết

Câu 1

Có 3 chất có phản ứng với dung dịch KOH:

- Phenylamoni clorua (C6H5NH3Cl):

            C6H5NH3Cl + KOH → C6H5NH2 + KCl + H2O

- Glyxin (H2NCH2COOH):

            H2NCH2COOH + KOH → H2NCH2COOK + H2O

- Metyl axetat (CH3COOCH3):

            CH3COOCH3 + KOH  CH3COOK + CH3OH

Đáp án D

Câu 2

Kim loại có khối lượng riêng lớn nhất là Os.

Đáp án D

Câu 3

Theo quy tắc α, dễ thấy Fe không phản ứng được với dung dịch ZnCl2.

Đáp án A

Câu 4

Crom(III) hiđroxit - Cr(OH)3 có tính lưỡng tính.

⟹ Cr(OH)3 tan được trong dung dịch NaOH: Cr(OH)3 + NaOH → NaCrO2 + 2H2O.

Đáp án B

Câu 5

Phương pháp:

Phản ứng trao đổi ion trong dung dịch (dung dịch chất điện li) là phản ứng giữa các ion.

Phản ứng trao đổi ion trong dung dịch có dạng:

AB + CD → AD + BC

Trong đó sản phẩm phải có chất kết tủa hoặc chất bay hơi hoặc chất điện li yếu.

Hướng dẫn giải:

Phản ứng "Fe(NO3)3 + 3NaOH → Fe(OH)3 + 3NaNO3" thuộc loại phản ứng trao đổi ion trong dung dịch.

Đáp án C

Câu 6

Valin là amino axit có nhóm NH2 thể hiện tính bazơ và nhóm COOH thể hiện tính axit

⟹ Valin có tính lưỡng tính.

Đáp án A

Câu 7

Phương pháp:

Phản ứng thủy phân:

C12H22O11 + H2O \(\xrightarrow{{{H}^{+}}}\) C6H12O6 + C6H12O6

                                          glucozơ     fructozơ

Tính nC12H22O11 ⟹ nglucozơ LT ⟹ nglucozơ TT = nglucozơ LT . H% ⟹ mglucozơ TT.

Hướng dẫn giải:

Phản ứng thủy phân:

C12H22O11 + H2O \(\xrightarrow{{{H}^{+}}}\) C6H12O6 + C6H12O6

                                          glucozơ     fructozơ

nC12H22O11 = 68,4/342 = 0,2 mol.

Theo PTHH: nglucozơ LT = nC12H22O11 = 0,2 mol

⟹  nglucozơ TT = nglucozơ LT . H% = 0,2.92% = 0,184 mol

⟹ mglucozơ TT = 0,184.180 = 33,12 gam.

Đáp án A

Câu 8

CH3COOCH3 thuộc loại este no, đơn chức, mạch hở.

Đáp án C

Câu 9

Photpho đỏ được quét lên phía ngoài của vỏ bao diêm.

Đáp án B

Câu 10

Xenlulozơ là chất rắn, màu trắng, không tan trong nước, dạng nguyên chất hay gần nguyên chất, được chế thành sợi, tơ, giấy viết, …

Đáp án A

Câu 11

Phương pháp:

- Khi hỗn hợp X + H2O:

            2Na + 2H2O → 2NaOH + H2             (1)

            2K + 2H2O → 2KOH + H2                 (2)

            Ba + 2H2O → Ba(OH)2 + H2              (3)

            Al2O3 + 2OH- → 2AlO2- + H2O         (4)

Từ (1) (2) (3) ta thấy nOH- = 2nH2.

Tính toán theo (4) ⟹ Thành phần của dung dịch Y.

- Khi dung dịch Y + HCl thì các phản ứng xảy ra theo thứ tự:

            H+ + OH- → H2O

            H+ + AlO2- + H2O → Al(OH)3

            3H+ + Al(OH)3 → Al3+ + 3H2O

Hướng dẫn giải:

Ta có mO(X) = 86,3.19,47% = 16,8 gam.

⟹ nO(X) = 16,8/16 = 1,05 mol

⟹ nAl2O3 = 1/3.nO(X) = 0,35 mol

- Khi hỗn hợp X + H2O:

nH2 = 13,44/22,4 = 0,6 mol

            2Na + 2H2O → 2NaOH + H2            (1)

            2K + 2H2O → 2KOH + H2                 (2)

            Ba + 2H2O → Ba(OH)2 + H2              (3)

Từ (1) (2) (3) ta thấy nOH- = 2nH2 = 1,2 mol

            Al2O3 + 2OH- → 2AlO2- + H2O         (4)

             0,35 →  0,7 →     0,7                (mol)

Trong dung dịch Y có chứa: OH- dư (1,2 - 0,7 = 0,5 mol) và AlO2- (0,7 mol).

- Khi dung dịch Y + HCl thì các phản ứng xảy ra theo thứ tự:

nH+ = 3,2.0,75 = 2,4 mol

  H+   +   OH-   →   H2O

  0,5  ←  0,5                                                    (mol)

  H+   +   AlO2-   +   H2O   →   Al(OH)3

 0,7 ←     0,7                      →     0,7               (mol)

→ nH+ còn lại = 2,4 - 0,5 - 0,7 = 1,2 mol

 3H+   +   Al(OH)3   →   Al3+   +   3H2O

 1,2 →         0,4                                               (mol)

⟹ nAl(OH)3 còn lại = 0,7 - 0,4 = 0,3 mol

⟹ m = 0,3.78 = 23,4 gam.

Đáp án C

Câu 12

Metylamin (CH3NH2) hay các amin nói chung có tính bazơ.

⟹ Phản ứng được với axit: CH3NH2 + CH3COOH → CH3NH3+CH3COO-.

Đáp án C

Câu 13

Phương pháp:

Điều kiện để xảy ra ăn mòn điện hóa:

- Bản chất hai điện cực phải khác nhau về bản chất (KL-KL, KL-PK,…)

- Hai điện cực phải tiếp xúc trực tiếp hoặc gián tiếp với nhau (qua dây dẫn)

- Hai điện cực phải cùng tiếp xúc với môi trường chất điện li

Hướng dẫn giải:

- Xét đáp án A:

Xảy ra phản ứng: Fe + CuSO4 → FeSO4 + Cu; kim loại Cu bám vào thanh Fe tạo thành cặp điện cực Fe-Cu, cùng nhúng trong dd điện li ⟹ Có xảy ra ăn mòn điện hóa.

- Xét đáp án B:

Không có cặp điện cực khác nhau về bản chất ⟹ Không xảy ra ăn mòn điện hóa.

- Xét đáp án C:

Có cặp điện cực Fe - C nhưng lại bị phủ sơn kín nên không tiếp xúc được môi trường chất điện li, mặt khác không khí khô không phải môi trường chất điện li ⟹ Không xảy ra ăn mòn điện hóa.

- Xét đáp án D:

Cu chỉ khử được Fe3+ thành Fe2+ chứ không khử được Fe2+ thành Fe nên không có cặp điện cực khác nhau về bản chất ⟹ Không xảy ra ăn mòn điện hóa.

Đáp án A

Câu 14

Phương pháp:

Ở nhiệt độ cao: H2, CO khử được các oxit kim loại từ đứng sau Αl (từ Zn trở đi) trong dãy hoạt động hóa học của kim loại.

Hướng dẫn giải:

H2 khử được các oxit: CuO, Fe2O3

CuO + H2 \(\xrightarrow{{{t}^{o}}}\) Cu + H2O

Fe2O3 + 3H2 \(\xrightarrow{{{t}^{o}}}\)  2Fe + 3H2O

Al2O3, MgO không phản ứng ⟹ còn lại trong hỗn hợp chất rắn sau phản ứng.

Vậy hỗn hợp chất rắn thu được gồm Cu, Fe, Al2O3, MgO.

Đáp án B

Câu 15

Phương pháp:

*Amin:

- Amin có nguyên tử N gắn trực tiếp với vòng benzen có tính bazơ rất yếu, không làm đổi màu quỳ tím.

- Các amin khác làm quỳ tím chuyển xanh.

*Amino axit:

- Số nhóm NH2 = số nhóm COOH ⟹ Không làm đổi màu quỳ tím

- Số nhóm NH2 > số nhóm COOH ⟹ Làm quỳ tím hóa xanh (VD: Lysin)

- Số nhóm NH2 < số nhóm COOH ⟹ Làm quỳ tím hóa đỏ (VD: Axit glutamic)

Hướng dẫn giải:

- Axit amino axetic hay glyxin trong phân tử có 1 nhóm NH2 và 1 nhóm COOH

⟹ không làm đổi màu quỳ tím.

- Metylamin (CH3NH2) làm đổi màu quỳ tím thành xanh.

- Axit glutamic trong phân tử có 1 nhóm NH2 và 2 nhóm COOH

⟹ làm đổi màu quỳ tím thành đỏ.

- Lysin trong phân tử có 2 nhóm NH2 và 1 nhóm COOH

⟹ làm đổi màu quỳ tím thành xanh.

Đáp án A

Câu 16

Phương pháp:

Điều chế kim loại

Phương pháp thủy luyện:

- Nguyên tắc: Dùng dung dịch thích hợp (HCl, HNO3, nước cường toan, CN-…) hòa tan nguyên liệu sau đó lấy kim loại mạnh (không tan trong nước) đẩy kim loại yếu khỏi dung dịch của nó.

-  Phạm vi sử dụng: Thường dùng trong phòng thí nghiệm để điều chế các kim loại sau Mg (thường là kim loại yếu).

Phương pháp nhiệt luyện:

- Nguyên tắc: Dùng chất khử CO, C, Al, H2 khử oxit kim loại ở nhiệt độ cao.

- Phạm vi sử dụng: Thường dùng trong công nghiệp với kim loại sau Al.

Phương pháp điện phân:

- Nguyên tắc: Dùng dòng điện một chiều để khử các ion kim loại.

- Phạm vi sử dụng: Điều chế được hầu hết các kim loại.

Hướng dẫn giải:

- Na, Mg, Αl (hoạt động hóa học mạnh) được điều chế bằng phương pháp điện phân nóng chảy các hợp chất thích hợp tương ứng.

- Cu (hoạt động hóa học yếu) được điều chế bằng phương pháp thủy luyện hoặc phương pháp điện phân dung dịch.

Đáp án C

Câu 17

nCaCO3 = nMgCO3 = 16,1 : (100 + 84) = 0,0875 mol.

Bảo toàn nguyên tố C: nCO2 = nCaCO3 + nMgCO3 = 2.0,0875 = 0,175 mol.

⟹ V = 0,175.22,4 = 3,92 lít.

Đáp án C

Câu 18

A là saccarozơ; X, Y là glucozơ và fructozơ; Z là sobitol.

Thủy phân saccarozơ: C12H22O11 (A) + H2O \(\xrightarrow{{{H}^{+}}}\) C6H12O6 (X) + C6H12O6 (Y)

                                                                                     glucozơ           fructozơ

Hiđro hóa glucozơ thu được sobitol; hiđro hóa fructozơ thu được hỗn hợp gồm sobitol và mannitol

⟹ Hiđro hóa glucozơ và fructozơ cùng thu được sobitol (Z).

Đáp án D

Câu 19

Phương pháp:

Các polime có thể nối với nhau thành:

- Mạch không phân nhánh: amilozơ, …

- Mạch phân nhánh: amilopectin, glicogen, …

- Mạch mạng không gian: cao su lưu hóa, nhựa bakelit, …

Lưu ý: xét sự phân nhánh của toàn mạch polime chứ không phải mạch cacbon của mắt xích.

Hướng dẫn giải:

Các polime có cấu trúc mạch không phân nhánh là: polietilen; poli(vinyl clorua); nilon-6,6; xenlulozơ.

Vậy có 4 polime có cấu trúc mạch không phân nhánh.

Đáp án D

Câu 20

Tinh bột thuộc loại polisaccarit.

Đáp án A

Câu 21

Phương pháp:

Tính độ bất bão hòa k = \(\frac{2C-H+2}{2}\) ⟹ Đặc điểm cấu tạo của este X.

X được tạo bởi axit cacboxylic và ancol no ⟹ Các đồng phân của X (chú ý cả đồng phân hình học).

Hướng dẫn giải:

Este X có độ bất bão hòa k = \(\frac{5.2-8+2}{2}\) = 2

⟹ X là este đơn chức, mạch hở có 1 liên kết đôi C=C.

Mặt khác, X được tạo bởi axit cacboxylic và ancol no

⟹ Các đồng phân của X thỏa mãn là:

            CH2=CH-CH2-COO-CH3    

            cis - CH3-CH=CH-COO-CH3

            trans - CH3-CH=CH-COO-CH3      

            CH2=C(CH3)-COO-CH3      

            CH2=CH-COO-CH2-CH3

Vậy có 5 đồng phân phù hợp với X.

Đáp án B

Câu 22

Phương pháp:

PTHH: Αl + NaOH + H2O → NaAlO2 + 3/2 H2

Từ nH2 ⟹ nAl ⟹ mAl ⟹ mMgO = mX - mAl.

Hướng dẫn giải:

nH2 = 3,36/22,4 = 0,15 mol

Αl + NaOH + H2O → NaAlO2 + 3/2 H2

0,1 ←                                            0,15           (mol)

⟹ mAl = 0,1.27 = 2,7 gam.

⟹ mMgO = mX - mAl = 10,7 - 2,7 = 8 gam.

Đáp án C

Câu 23

Dung dịch protein có phản ứng màu biure với Cu(OH)2 tạo sản phẩm có màu tím đặc trưng.

⟹ Khi cho dung dịch anbumin (protein lòng trắng trứng) tác dụng với Cu(OH)2 thu được dung dịch có màu tím.

Đáp án B

Câu 24

nFeCl2 = 0,05 mol ⟹ nFe2+ = 0,05 mol; nCl- = 0,1 mol.

Ag+ + Cl- → AgCl ↓

          0,1 →   0,1                    (mol)

Ag+ + Fe2+ → Fe3+ + Ag ↓

          0,05       →      0,05       (mol)

Vậy kết tủa thu được sau phản ứng gồm 0,1 mol AgCl và 0,05 mol Ag

⟹ m = 0,1.143,5 + 0,05.108 = 19,75 gam.

Đáp án D

Câu 25

Gọi hóa trị của kim loại M trong phản ứng với H2SO4 loãng là n.

PTHH: 2M + nH2SO4 → M2(SO4)n + nH2O

nM = \(\frac{2,52}{M}\) (mol)

nMSO4 = \(\frac{6,84}{2M+96n}\) (mol)

Theo PTHH: nM = 2nMSO4 ⟹ \(\frac{2,52}{M}=2.\frac{6,84}{2M+96n}\) ⟹ M = 28n

Chọn n = 2 ⟹ M = 56 (Fe)

Vậy kim loại M là Fe.

Đáp án C

Câu 26

Thủy phân hợp chất trên sẽ thu được các amino axit sau:

H2N-CH(CH3)-COOH (α-amino axit)

NH2-CH2-COOH (α-amino axit)

NH2-CH2-CH2-COOH (không phải α-amino axit)

NH2-CH(C6H5)-COOH (α-amino axit)

Vậy thủy phân hợp chất trên thu được 3 α-amino axit.

Đáp án D

Câu 27

Metan (CH4) là hiđrocacbon no ⟹ không tác dụng với Br2.

Buta-1,3-đien (CH3-CH=CH-CH3) có 2 liên kết đôi C=C ⟹ tác dụng với Br2 theo tỉ lệ 1:2.

Etilen (CH2=CH2) có 1 liên kết đôi C=C ⟹ tác dụng với Br2 theo tỉ lệ 1:1.

Axetilen (CH≡CH) có 1 liên kết ba C≡C ⟹ tác dụng với Br2 theo tỉ lệ 1:2.

Vậy X có thể là etilen.

Đáp án C

Câu 28

Tơ visco có nguồn gốc từ xenlulozơ.

Đáp án A

Câu 29

Phương pháp:

- Để đơn giản hóa, coi dung dịch Y gồm các amino axit và HCl

⟹ nKOH = nHCl + nCOOH

⟹ nCOOH = nKOH - nHCl

- Công thức chung của hỗn hợp X là: CnH2n+1NO2

CnH2n+1NO2 (X) + O2 \(\xrightarrow{{{t}^{o}}}\) nCO2 + \(\frac{2n+1}{2}\) H2O + ½ N2

Từ PT phản ứng cháy ⟹ nX = (nH2O - nCO2)/0,5

- Đặt nCO2 = x mol; nH2O = y mol

Lập hệ PT tìm x, y dựa vào:

+) Quan hệ với nX.

+) Khối lượng dung dịch Ba(OH)2 giảm.

- Tính số mol các nguyên tố trong X ⟹ a.

Hướng dẫn giải:

- Để đơn giản hóa, coi dung dịch Y gồm các amino axit và HCl

⟹ nKOH = nHCl + nCOOH

⟹ nCOOH = nKOH - nHCl = 0,38.0,5 - 0,1.1 = 0,09 mol.

Các chất trong X chứa 1 nhóm COOH ⟹ nX = nCOOH = 0,09 mol

- Công thức chung của hỗn hợp X là: CnH2n+1NO2

CnH2n+1NO2 (X) + O2 \(\xrightarrow{{{t}^{o}}}\) nCO2 + \(\frac{2n+1}{2}\) H2O + ½ N2

Từ PT phản ứng cháy ⟹ nX = (nH2O - nCO2)/0,5

Đặt nCO2 = x mol; nH2O = y mol

⟹ (y - x)/0,5 = 0,09 ⟹ y - x = 0,045 (1)

- Cho sản phẩm cháy vào bình đựng Ba(OH)2 dư:

CO2 + Ba(OH)2 → BaCO3 ↓ + H2O

  x                      →      x                                  (mol)

mdd giảm = m- mCO2 - mH2O = 43,74 g.

⟹ 197x - 44x - 18y = 43,74

⟹ 153x - 18y = 43,74 (2)

Từ (1)(2) ⟹ x = 0,33; y = 0,375

⟹       nC = nCO2 = 0,33 mol

            nH = 2nH2O = 2.0,375 = 0,75 mol

            nO = 2nCOOH = 2.0,09 = 0,18 mol

            nN = nX = 2.0,045 = 0,09 mol

⟹ a = 0,33.12 + 0,75 + 0,18.16 + 0,09.14 = 8,85 gam.

Đáp án B

Câu 30

Các bước tiến hành thí nghiệm theo thứ tự là:

(4) Cho 1 ml dung dịch AgNO3 1% vào ống nghiệm sạch.

(2) Nhỏ từ từ dung dịch NH3 cho đến khi kết tủa tan hết.

(1) Thêm 3 - 5 giọt glucozơ vào ống nghiệm.

(3) Đun nóng nhẹ hỗn hợp ở 60 - 70°C trong vài phút.

Đáp án A

Câu 31

Phương pháp:

Giả sử chất béo X có độ bất bão hòa toàn phân tử là k.

+ Khi đốt cháy: \({{n}_{X}}=\frac{{{n}_{C{{O}_{2}}}}-{{n}_{{{H}_{2}}O}}}{k-1}\)

+ Khi tác dụng với Br2 thì: X + (k-3) Br2 → Sản phẩm cộng

Hướng dẫn giải:

*Đốt a mol X:

Bảo toàn O → nH2O = 6nX + 2nO2 - 2nCO2 = 6a + 2.7,75 - 2.5,5 = 6a + 4,5 (mol)

Giả sử chất béo X có độ bất bão hòa toàn phân tử là k.

Ta có công thức: \({{n}_{X}}=\frac{{{n}_{C{{O}_{2}}}}-{{n}_{{{H}_{2}}O}}}{k-1}\to a=\frac{5,5-\left( 6\text{a}+4,5 \right)}{k-1}\)

→ ak + 5a = 1 (1)

*a mol X + Br2 thì:

X + (k - 3)Br2 → Sản phẩm cộng

→ nBr2 = (k - 3).nX → 0,2 = (k - 3).a

→ ak - 3a = 0,2 (2)

Như vậy ta có hệ pt:

BTKL phản ứng cháy → mX = mCO2 + mH2O - mO2 = 85,8 gam

BTKL phản ứng thủy phân → mmuối = mX + mNaOH - mC3H5(OH)3 = 85,8 + 0,3.40 - 0,1.92 = 88,6 gam.

Đáp án D

Câu 32

Phương pháp:

Rót từ từ H+ vào dung dịch hỗn hợp HCO3- + CO32- xảy ra 2 phản ứng theo thứ tự lần lượt:

H+ + CO32 → HCO3-

HCO3- + H+ → CO2 ↑ + H2O

Hướng dẫn giải:

Rót từ từ H+ vào dung dịch hỗn hợp HCO3- + CO32- xảy ra 2 phản ứng theo thứ tự lần lượt:

H+ + CO32 → HCO3-                          (1)

H+ + HCO3- → CO2 ↑ + H2O             (2)

- Khi nH+ = 2a mol, đã có khí CO2 thoát ra

⟹ (1) kết thúc, (2) đang xảy ra.

⟹ nCO2 = nH+(2) = nH+ - nH+(1) = nH+ - nCO32- = 2a - a = a (mol).

⟹ a = 0,25x hay x = 4a.

- Để phản ứng hết với HCO3- và CO32-, lượng HCl cần dùng bằng:

nHCl = nHCO3- + 2nCO32- = 1,25a + 2a = 3,25a (mol).

- Khi nHCl = x = 4a mol, dung dịch gồm:

 

⟹ 74,5 . 3,25a + 36,5 . 0,75a = 97,02

⟹ a = 0,36 mol.

Đáp án D

Câu 33

Phương pháp:

MTB amin = 35,67 ⟹ 2 amin là CH3NH2 và C2H5NH2.

Kết hợp:

- Công thức phân tử của X và Y

- Công thức của axit glutamic: HOOC-CH2-CH2-CH(NH2)-COOH

- Công thức 2 amin

- Hỗn hợp G gồm 3 muối trong đó có 2 muối có cùng số C

⟹ CTCT của X và Y

⟹ Thành phần các muối ⟹ m.

Hướng dẫn giải:

MTB amin = 107/6 . 2 = 35,67 ⟹ 2 amin là CH3NH2 và C2H5NH2.

Đặt nCH3NH2 = a mol; nC2H5NH2 = b mol

⟹ 

⟹ a = 0,22; b = 0,11 (mol)

Kết hợp các dữ kiện:

- Công thức phân tử của X và Y

- Công thức của axit glutamic: HOOC-CH2-CH2-CH(NH2)-COOH

- Công thức 2 amin

- Hỗn hợp G gồm 3 muối trong đó có 2 muối có cùng số C

⟹ Công thức của X và Y lần lượt là:

            X:        (COONH3C2H5)2

            Y:        CH3NH3OOC-CH2-CH2-CH(NH3OOCCH3)-COOCH3NH3

⟹ nX = b/2 = 0,055 mol; nY = a/2 = 0,11 mol

- Khi hỗn hợp E + KOH:

(COONH3C2H5)2 + 2KOH → (COOK)2 + 2C2H5NH2 + 2H2O

CH3NH3OOC-CH2-CH2-CH(NH3OOCCH3)-COOCH3NH3 + 3KOH → KOOC-CH2-CH2-CH(NH2)-COOK + CH3COOK + 2CH3NH2 + 3H2O

Muối thu được gồm:

 

⟹ m = 44,44 gam.

Đáp án D

Câu 34

Phương pháp:

 

Chia đồ thị thành các đoạn như hình.

Ta thấy đoạn (2) độ dốc ít hơn so với đoạn (1)

Suy ra:

- Giai đoạn 1: Khí Cl2 thoát ra từ anot.

- Giai đoạn 2: Khí O2 thoát ra từ anot.

- Giai đoạn 3: Khí O2 thoát ra từ anot, khí H2 thoát ra từ catot.

Hướng dẫn giải:

- Chia đồ thị thành các đoạn như ở phần Phương pháp.

Ta thấy đoạn (2) độ dốc ít hơn so với đoạn (1)

Suy ra:

+ Giai đoạn 1: Khí Cl2 thoát ra từ anot (ở catot Cu2+ bị điện phân; ở anot Cl- bị điện phân)

+ Giai đoạn 2: Khí O2  thoát ra từ anot (ở catot Cu2+ bị điện phân; ở anot hết Cl-, nước bị điện phân)

+ Giai đoạn 3: Khí O2 thoát ra từ anot, khí H2 thoát ra từ catot (ở catot hết Cu2+, nước bị điện phân; ở anot nước bị điện phân).

- Khi kết thúc giai đoạn (1): t = a (s); ứng với sự trao đổi b (mol) electron

Ở anot:            2Cl- - 2e → Cl2

                                   b   → 0,5b                    (mol)

 - Khi kết thúc giai đoạn (2): t = 3a (s); ứng với sự trao đổi 3b (mol) electron

Ở anot:            2Cl- - 2e → Cl2

                                   b  →  0,5b                    (mol)

                        H2O - 2e → 2H+ + ½ O2

                                   2b            →  0,5b        (mol)

- Khi t = 4a (s), tổng số mol khí thu được là 0,35 mol; ứng với sự trao đổi 4b (mol) electron

Ở anot:            2Cl- - 2e → Cl2

                                   b  →  0,5b                    (mol)

                        H2O - 2e → 2H+ + ½ O2

                                   3b            →  0,75b      (mol)

Ở catot:           Cu2+ + 2e → Cu

                                   3b → 1,5b                    (mol)

2H2O + 2e → 2OH- + H2

              b               → 0,5b     (mol)

⟹ 0,5b + 0,75b + 0,5b = 0,35 ⟹ b = 0,2 mol

⟹ nCu(NO3)2 = 1,5.0,2 = 0,3 mol

      nNaCl = b = 0,2 mol

- Khi t = 2a (s); ứng với sự trao đổi 2b = 0,4 mol electron

Ở anot:            2Cl- - 2e → Cl2

                                 0,2 → 0,1           (mol)

                        H2O - 2e → 2H+ + ½ O2

                                   0,2          →  0,05         (mol)

Ở catot:           Cu2+ + 2e → Cu

                                   0,4 → 0,2                     (mol)

⟹ Dung dịch khi đó gồm:

 ⟹  => 

⟹ Tổng số mol các chất tan là 0,1 + 0,2 + 0,2 = 0,5 mol.

Đáp án B

Câu 35

Phương pháp:

- Hỗn hợp khí Z gồm CO2: x (mol) và CO dư: y (mol)

Lập hệ PT tìm x, y dựa vào số mol và khối lượng hỗn hợp Z.

⟹ nO(bị CO lấy đi) = nCO2

⟹ mY = mX - mO(bị CO lấy đi); nO(Y) = nO/X - nO(bị CO lấy đi)

- Ta thấy H+ tham gia vào các bán phản ứng sau:

            4H+ + NO3- + 3e → NO + 2H2O

            2H+ + O2- → H2O

⟹ nHNO3 = nH+ = 4nNO + 2nO/Y

⟹ nH2O = nHNO3/2

Bảo toàn khối lượng: mY + mHNO3 = mmuối + mNO + mH2O

⟹ m.

Hướng dẫn giải:

nCO(bđ) = 0,4 mol; nNO = 0,32 mol

- Hỗn hợp khí Z gồm CO2: x (mol) và CO dư: y (mol)

⟹ 

⟹ x = 0,25; y = 0,15 (mol)

⟹ nO(bị CO lấy đi) = nCO2 = 0,25 (mol)

⟹ mY = mX - mO(bị CO lấy đi) = m - 0,25.16 = m - 4 (g)

⟹ nO(Y) = nO(X) - nO(bị CO lấy đi) = \(\frac{0,2593m}{16}-0,25\) (mol)

- Ta thấy H+ tham gia vào các bán phản ứng sau:

            4H+ + NO3- + 3e → NO + 2H2O

            2H+ + O2- → H2O

⟹ nHNO3 = nH+ = 4nNO + 2nO(Y) = 4.0,32 + 2(\(\frac{0,2593m}{16}-0,25\)) = \(1,28+\frac{0,2593m}{8}-0,5\)

⟹ nH2O = nHNO3/2 = \(0,64+\frac{0,2593m}{16}-0,25\)

Bảo toàn khối lượng: mY + mHNO3 = mmuối + mNO + mH2O

⟹ \(m-4+63(1,28+\frac{0,2593m}{8}-0,5)=3,456m+30.0,32+18(0,64+\frac{0,2593m}{16}-0,25)\)

⟹ m ≈ 38,43 gam.

Đáp án A

Câu 36

Phương pháp:

Tính số mol CO2, H2O; số mol X, Y, Z trong hỗn hợp E.

⟹ Số nguyên tử H trong X, Y, Z = 2nH2O/nX

⟹ Công thức của X.

Gọi số nguyên tử cacbon trong Y là a; số nguyên tử cacbon trong Z là b; biện luận theo số mol CO2 để tìm a, b.

⟹ Công thức của Y, Z.

⟹ nAg pứ ⟹ mAg.

Hướng dẫn giải:

- Khi đốt cháy hỗn hợp E:

nCO2 = 24,64/22,4 = 1,1 mol

nH2O = 21,6/18 = 1,2 mol

⟹ \(H=\frac{{{n}_{H}}}{{{n}_{hh}}}=\frac{2{{n}_{{{H}_{2}}O}}}{{{n}_{hh}}}=\frac{2.1,2}{0,6}=4\)

⟹ Ancol X phải là CH3OH

Tỉ lệ mol X, Y, Z là 3 : 1 : 2 ⟹ nX = 0,3 mol; nY = 0,1 mol; nZ = 0,2 mol.

- Gọi số nguyên tử cacbon trong Y là a; số nguyên tử cacbon trong Z là b (a, b ≥ 2)

⟹ 0,3 + 0,1a + 0,2b = 1,1

⟹ a + 2b = 8

⟹ a = 2, b = 3 thỏa mãn ⟹ Y là HCOOCH3, Z là OHC-CH2-CHO

- Y (HCOOCH3) phản ứng với Ag theo tỉ lệ 1 : 2, Z (HOC-CH2-CHO) phản ứng với Ag theo tỉ lệ 1 : 4

⟹ nAg = 2nY + 4nZ = 2.0,1 + 4.0,2 = 1 mol

⟹ mAg = 108 gam.

Đáp án C

Câu 37

Phương pháp:

Dựa vào lý thuyết tổng hợp chương 1: Este - Lipit.

Hướng dẫn giải:

- (a) đúng, thủy phân tripanmitin thu được glixerol, thủy phân etyl axetat thu được ancol etylic.

VD với MT kiềm:

            (C15H31COO)3C3H5 + 3NaOH $\xrightarrow[{}]{{{t}^{o}}}\) 3C15H31COONa + C3H5(OH)3

            CH3COOC2H5 + NaOH \(\xrightarrow[{}]{{{t}^{o}}}\) CH3COONa + C2H5OH

- (b) đúng, mỡ động vật và dầu thực vật đều chứa nhiều chất béo.

- (c) sai, hiđro hóa hoàn toàn triolein thu được tristearin.

(C17H33COO)3C3H5 (triolein) + 3H2 \(\xrightarrow[{{t}^{o}}]{Ni}\) (C17H35COO)3C3H5 (tristearin).

- (d) đúng, thủy phân vinyl fomat thu được hai sản phẩm đều có phản ứng tráng bạc:

            HCOOCH=CH2 \(\xrightarrow[{{H}_{2}}S{{O}_{4}}dac,{{t}^{o}}]{{{H}_{2}}O}\) HCOOH + CH3CHO

            HCOOCH=CH2 \(\xrightarrow[{{t}^{o}}]{NaOH}\) HCOONa + CH3CHO

- (e) đúng: ứng với công thức đơn giản nhất là CH2O có 3 chất hữu cơ đơn chức, mạch hở:

            HCHO (anđehit đơn chức)

            CH3COOH (axit đơn chức)

            HCOOCH3 (este đơn chức)

Vậy có 4 phát biểu đúng (a, b, d, e).

Đáp án B

Câu 38

Phương pháp:

- Khi đốt cháy hỗn hợp T gồm 2 muối:

nNa(T) = 2nNa2CO3

Bảo toàn nguyên tố O: 2nCOONa + 2nO2 = 2nCO2 + 3nNa2CO3 + nH2O ⟹ nCO2

Đánh giá nNa(T) và nC(T) để tìm ra công thức 2 muối.

- Khi thủy phân hỗn hợp A:

nNaOH = nNa(T) ⟹ mNaOH

Bảo toàn khối lượng ⟹ mA

- Khi đốt cháy hỗn hợp A:

Đặt nCO2 = x mol; nH2O = y mol

Lập hệ PT tìm x, y dựa vào chênh lệch số mol CO2 và số mol H2O; khối lượng hỗn hợp A (quy về 3 nguyên tố C, H, O).

- Dùng liên tiếp các định luật bảo toàn để tìm số mol các nguyên tố C, H, O trong hỗn hợp ancol, sau đó đánh giá và tìm ra công thức 2 ancol

- Ghép các muối và các ancol một cách thích hợp để tìm ra công thức các este ban đầu.

Hướng dẫn giải:

- Khi đốt cháy hỗn hợp T gồm 2 muối:

nNa(T) = 2nNa2CO3 = 2.0,35 = 0,7 mol

Bảo toàn nguyên tố O: 2nCOONa + 2nO2 = 2nCO2 + 3nNa2CO3 + nH2O

⟹ nCO2 = (2.0,7 + 2.0,275 - 3.0,35 - 0,2) : 2 = 0,35 mol

Bảo toàn nguyên tố C: nC(T) = nCO2 + nNa2CO3 = 0,35 + 0,35 = 0,7 mol

⟹ nNa(T) = nC(T) ⟹ Các chất trong T có số nguyên tử C bằng số nguyên tử Na

⟹ T gồm 2 muối HCOONa và (COONa)2

nHCOONa = 2nH2O = 2.0,2 = 0,4 mol

n(COONa)2 = (0,7 - 0,4) : 2 = 0,15 mol

⟹ mT = 0,4.68 + 0,15.134 = 47,3 gam.

- Khi thủy phân hỗn hợp A:

nNaOH = nNa(T) = 0,7 mol ⟹ mNaOH = 40.0,7 = 28 gam.

Bảo toàn khối lượng: mA = mancol + mT - mNaOH = 22,2 + 47,3 - 28 = 41,5 gam.

- Khi đốt cháy hỗn hợp A:

Đặt nCO2 = x mol; nH2O = y mol

⟹ x - y = 0,25 mol (1)

nO(A) = 2nCOO = 2nNa(T) = 2.0,7 = 1,4 mol

Trong A gồm: x mol C; 2y mol H; 1,4 mol O

⟹ 12x + 2y + 1,4.16 = 41,5

⟹ 12x + 2y = 19,1 (2)

Từ (1)(2) ⟹ x = 1,4; y = 1,15

- Bảo toàn nguyên tố C:

nC(ancol) = nC(A) - nC(T) = 1,4 - 0,7 = 0,7 mol

nO(ancol) = nNaOH = 0,7 mol

nH(ancol) = nH(A) - nH(T) = 2.1,15 + 0,7 - 0,4 = 2,6 mol

⟹ nancol = nH2O - nCO2 = 2,6/2 - 0,7 = 0,6 mol (do số nguyên tử O trong ancol bằng số nguyên tử C nên 2 ancol đều là ancol no).

⟹ Số C TB = 0,7/0,6 = 1,17

Mặt khác, số nguyên tử O trong ancol bằng số nguyên tử C

⟹ Hai ancol đó là CH3OH: a mol và C2H4(OH)2: b mol

⟹ \(\left\{ \begin{array}{*{35}{l}}

   x+y=0,6  \\

   x+2y=0,7  \\

\end{array} \right.\) ⟹ x = 0,5; y = 0,1

- Ghép 2 muối ở hỗn hợp T và 2 ancol ta được:

­

%mHCOOCH3 = 0,2.60/41,5 . 100% = 28,92%

%m(HCOO)2C2H4 = 0,1.118/41,5 . 100% = 28,43%

%m(COOCH3)2 = 100% - 28,92% - 28,43% = 42,65%

Mà Z chiếm % khối lượng lớn nhất ⟹ %mZ = 42,65%.

Đáp án B

Câu 39

Phương pháp:

Phản ứng oxi hóa - khử là phản ứng hóa học trong đó có sự thay đổi số oxi hóa của các nguyên tố.

Hướng dẫn giải:

(a) Cu + Fe2(SO4)3 → CuSO4 + 2FeSO4

(b) CO2 + Ca(OH)2 → CaCO3 + H2O

(c) 4NO2 + O2 + 2H2O → 4HNO3

(d) 3Fe2+ + 4H+ + NO3- → 3Fe3+ + NO + 2H2O

(e) 2FeO + 4H2SO4 đặc, nóng → Fe2(SO4)3 + SO2 + 4H2O

(f) BaO + H2O → Ba(OH)2

⟹ Có 4 thí nghiệm xảy ra phản ứng oxi hóa - khử: a, c, d, e.

Đáp án B

Câu 40

Phương pháp:

Dựa vào lý thuyết hữu cơ tổng hợp chương 1-2-3-4.

Hướng dẫn giải:

(a) đúng, dầu mỡ sau khi sử dụng, có thể tái chế thành nhiên liệu.

(b) đúng, muối mononatri của axit glutamic được dùng làm bột ngọt (mì chính).

(c) đúng, amilopectin, tơ tằm, lông cừu là polime thiên nhiên.

(d) đúng, chất độn amiăng làm tăng tính chịu nhiệt của chất dẻo.

(e) đúng, khi cho giấm ăn (hoặc chanh) vào sữa bò hoặc sữa đậu nành thì thấy có kết tủa xuất hiện (sự đông tụ protein).

(f) đúng, thành phần chính của khí biogas là metan.

Vậy cả 6 nhận định đều đúng.

Loigiaihay.com


Bình chọn:
3.6 trên 5 phiếu

Luyện Bài tập trắc nghiệm môn Hóa lớp 12 - Xem ngay

>> Luyện thi TN THPT & ĐH năm 2022 trên trang trực tuyến Tuyensinh247.com. Học mọi lúc, mọi nơi với Thầy Cô giáo giỏi, đầy đủ các khoá: Nền tảng lớp 12; Luyện thi chuyên sâu; Luyện đề đủ dạng; Tổng ôn chọn lọc.